mirror of
https://github.com/Grasscutters/Cultivation.git
synced 2025-12-13 15:44:35 +01:00
BREAKING: Migrate to Tauri v2
This commit is contained in:
NotThorny
5
src-tauri/.gitignore
vendored
5
src-tauri/.gitignore
vendored
@@ -1,4 +1,7 @@
|
||||
# Generated by Cargo
|
||||
# will have compiled files and executables
|
||||
/target/
|
||||
WixTools
|
||||
|
||||
# Generated by Tauri
|
||||
# will have schema files for capabilities auto-completion
|
||||
/gen/schemas
|
||||
|
||||
5807
src-tauri/Cargo.lock
generated
5807
src-tauri/Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
@@ -1,92 +1,61 @@
|
||||
[package]
|
||||
name = "cultivation"
|
||||
version = "1.6.3"
|
||||
version = "2.0.0"
|
||||
description = "A custom launcher for anime game."
|
||||
authors = ["KingRainbow44", "SpikeHD"]
|
||||
license = ""
|
||||
repository = "https://github.com/Grasscutters/Cultivation.git"
|
||||
default-run = "cultivation"
|
||||
authors = ["KingRainbow44", "SpikeHD", "NotThorny"]
|
||||
edition = "2021"
|
||||
rust-version = "1.57"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[build-dependencies]
|
||||
tauri-build = { version = "1.0.0-rc.8", features = [] }
|
||||
cc = "1.0"
|
||||
[lib]
|
||||
# The `_lib` suffix may seem redundant but it is necessary
|
||||
# to make the lib name unique and wouldn't conflict with the bin name.
|
||||
# This seems to be only an issue on Windows, see https://github.com/rust-lang/cargo/issues/8519
|
||||
name = "cultivation_lib"
|
||||
crate-type = ["staticlib", "cdylib", "rlib"]
|
||||
|
||||
[target.'cfg(windows)'.dependencies]
|
||||
is_elevated = "0.1.2"
|
||||
registry = "1.2.1"
|
||||
[build-dependencies]
|
||||
tauri-build = { version = "2", features = [] }
|
||||
|
||||
[dependencies]
|
||||
tauri = { version = "2", features = [] }
|
||||
tauri-plugin-opener = "2"
|
||||
serde = { version = "1", features = ["derive"] }
|
||||
serde_json = "1"
|
||||
args = "2.2.0"
|
||||
once_cell = "1.21.3"
|
||||
sysinfo = "0.37.2"
|
||||
futures-util = "0.3.31"
|
||||
file_diff = "1.0.0"
|
||||
tokio = { version = "1.48.0", features = ["signal"] }
|
||||
hudsucker = { version = "0.21", features = ["rcgen-ca", "rustls-client"], default-features = false }
|
||||
dirs = "6.0.0"
|
||||
reqwest = {version = "0.12.24", features = ["stream"] }
|
||||
unrar = "0.5.8"
|
||||
zip = "6.0.0"
|
||||
sevenz-rust = "0.6.1"
|
||||
simple-zip = "1.0.1"
|
||||
ctrlc = "3.5.1"
|
||||
getopts = "0.2.24"
|
||||
open = "5.3.3"
|
||||
rust-ini = "0.21.3"
|
||||
rcgen = { version = "0.9", features = ["x509-parser"] }
|
||||
rustls-pemfile = "1.0.0"
|
||||
tauri-plugin-fs = "2.4.4"
|
||||
tauri-plugin-dialog = "2.4.2"
|
||||
tauri-plugin-shell = "2.3.3"
|
||||
|
||||
[target.'cfg(unix)'.dependencies]
|
||||
sudo = "0.6.0"
|
||||
|
||||
[target.'cfg(target_os = "linux")'.dependencies]
|
||||
anyhow = "1.0.58"
|
||||
term-detect = "0.1.8"
|
||||
anyhow = "1.0.100"
|
||||
which = "8.0.0"
|
||||
os_type = "2.6"
|
||||
term-detect = "0.1.7"
|
||||
which = "4.4"
|
||||
|
||||
[dependencies]
|
||||
serde = { version = "1.0", features = ["derive"] }
|
||||
tauri = { version = "1.0.9", features = ["api-all"] }
|
||||
|
||||
# Arg parsing
|
||||
args = "2.0"
|
||||
getopts = "0.2"
|
||||
|
||||
# Access system process info.
|
||||
sysinfo = "0.28.4"
|
||||
|
||||
# ZIP-archive library.
|
||||
zip-extract = "0.1.1"
|
||||
unrar = "0.4.4"
|
||||
zip = "0.6.2"
|
||||
sevenz-rust = "0.2.9"
|
||||
|
||||
# For creating a "global" downloads list.
|
||||
once_cell = "1.13.0"
|
||||
|
||||
# Program opener.
|
||||
open = "3.0.2"
|
||||
|
||||
# Services
|
||||
windows-service = "0.6.0"
|
||||
|
||||
# Serialization.
|
||||
serde_json = "1"
|
||||
|
||||
# Dependencies for the HTTP(S) proxy.
|
||||
http = "0.2"
|
||||
hudsucker = "0.19.2"
|
||||
tracing = "0.1.21"
|
||||
tokio-rustls = "0.23.0"
|
||||
tokio-tungstenite = "0.17.0"
|
||||
tokio = { version = "1.20.4", features = ["signal"] }
|
||||
rustls-pemfile = "1.0.0"
|
||||
reqwest = { version = "0.11.3", features = ["stream"] }
|
||||
futures-util = "0.3.14"
|
||||
rcgen = { version = "0.9", features = ["x509-parser"] }
|
||||
|
||||
# metadata stuff
|
||||
regex = "1"
|
||||
|
||||
# other
|
||||
file_diff = "1.0.0"
|
||||
rust-ini = "0.18.0"
|
||||
ctrlc = "3.2.3"
|
||||
|
||||
[target.'cfg(target_os = "linux")'.dependencies.anime-launcher-sdk]
|
||||
git = "https://github.com/an-anime-team/anime-launcher-sdk.git"
|
||||
tag = "1.11.1"
|
||||
tag = "1.32.0"
|
||||
default-features = false
|
||||
features = ["all", "genshin"]
|
||||
|
||||
[features]
|
||||
# by default Tauri runs in production mode
|
||||
# when `tauri dev` runs it is executed with `cargo run --no-default-features` if `devPath` is an URL
|
||||
default = [ "custom-protocol" ]
|
||||
# this feature is used used for production builds where `devPath` points to the filesystem
|
||||
# DO NOT remove this
|
||||
custom-protocol = [ "tauri/custom-protocol" ]
|
||||
|
||||
@@ -1,16 +1,3 @@
|
||||
fn main() {
|
||||
cc::Build::new()
|
||||
.include("mhycrypto")
|
||||
.cpp(true)
|
||||
.file("mhycrypto/memecrypto.cpp")
|
||||
.file("mhycrypto/metadata.cpp")
|
||||
.file("mhycrypto/metadatastringdec.cpp")
|
||||
.compile("mhycrypto");
|
||||
|
||||
cc::Build::new()
|
||||
.include("mhycrypto")
|
||||
.file("mhycrypto/aes.c")
|
||||
.compile("mhycrypto-aes");
|
||||
|
||||
tauri_build::build()
|
||||
tauri_build::build()
|
||||
}
|
||||
|
||||
33
src-tauri/capabilities/default.json
Normal file
33
src-tauri/capabilities/default.json
Normal file
@@ -0,0 +1,33 @@
|
||||
{
|
||||
"$schema": "../gen/schemas/desktop-schema.json",
|
||||
"identifier": "default",
|
||||
"description": "Capability for the main window",
|
||||
"windows": ["main"],
|
||||
"permissions": [
|
||||
"core:default",
|
||||
"opener:default",
|
||||
"fs:allow-read",
|
||||
"fs:allow-write",
|
||||
"fs:allow-app-write",
|
||||
"fs:allow-app-read",
|
||||
"fs:allow-app-write-recursive",
|
||||
"fs:allow-app-read-recursive",
|
||||
"fs:allow-appcache-write",
|
||||
"fs:allow-appcache-read",
|
||||
{
|
||||
"identifier": "fs:scope",
|
||||
"allow": ["$DATA", "$DATA/cultivation", "$DATA/cultivation/**"]
|
||||
},
|
||||
"shell:allow-execute",
|
||||
"shell:allow-open",
|
||||
"dialog:allow-open",
|
||||
"dialog:allow-save",
|
||||
"dialog:allow-message",
|
||||
"dialog:allow-ask",
|
||||
"dialog:allow-confirm",
|
||||
"core:app:allow-app-show",
|
||||
"core:app:allow-app-hide",
|
||||
"fs:default",
|
||||
"dialog:default"
|
||||
]
|
||||
}
|
||||
@@ -1,387 +0,0 @@
|
||||
// Simple, thoroughly commented implementation of 128-bit AES / Rijndael using C
|
||||
// Chris Hulbert - chris.hulbert@gmail.com - http://splinter.com.au/blog
|
||||
// References:
|
||||
// http://en.wikipedia.org/wiki/Advanced_Encryption_Standard
|
||||
// http://en.wikipedia.org/wiki/Rijndael_key_schedule
|
||||
// http://en.wikipedia.org/wiki/Rijndael_mix_columns
|
||||
// http://en.wikipedia.org/wiki/Rijndael_S-box
|
||||
|
||||
// This code is public domain, or any OSI-approved license, your choice. No warranty.
|
||||
|
||||
#include <assert.h>
|
||||
#include <stdio.h>
|
||||
#include <string.h>
|
||||
|
||||
#include "aes.h"
|
||||
|
||||
typedef unsigned char byte;
|
||||
|
||||
// Here are all the lookup tables for the row shifts, rcon, s-boxes, and galois field multiplications
|
||||
static const byte shift_rows_table[] = {0, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, 1, 6, 11};
|
||||
static const byte shift_rows_table_inv[] = {0, 13, 10, 7, 4, 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3};
|
||||
static const byte lookup_rcon[] = {
|
||||
0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a};
|
||||
static const byte lookup_sbox[] = {
|
||||
0x63, 0x7c, 0x77, 0x7b, 0xf2, 0x6b, 0x6f, 0xc5, 0x30, 0x01, 0x67, 0x2b, 0xfe, 0xd7, 0xab, 0x76,
|
||||
0xca, 0x82, 0xc9, 0x7d, 0xfa, 0x59, 0x47, 0xf0, 0xad, 0xd4, 0xa2, 0xaf, 0x9c, 0xa4, 0x72, 0xc0,
|
||||
0xb7, 0xfd, 0x93, 0x26, 0x36, 0x3f, 0xf7, 0xcc, 0x34, 0xa5, 0xe5, 0xf1, 0x71, 0xd8, 0x31, 0x15,
|
||||
0x04, 0xc7, 0x23, 0xc3, 0x18, 0x96, 0x05, 0x9a, 0x07, 0x12, 0x80, 0xe2, 0xeb, 0x27, 0xb2, 0x75,
|
||||
0x09, 0x83, 0x2c, 0x1a, 0x1b, 0x6e, 0x5a, 0xa0, 0x52, 0x3b, 0xd6, 0xb3, 0x29, 0xe3, 0x2f, 0x84,
|
||||
0x53, 0xd1, 0x00, 0xed, 0x20, 0xfc, 0xb1, 0x5b, 0x6a, 0xcb, 0xbe, 0x39, 0x4a, 0x4c, 0x58, 0xcf,
|
||||
0xd0, 0xef, 0xaa, 0xfb, 0x43, 0x4d, 0x33, 0x85, 0x45, 0xf9, 0x02, 0x7f, 0x50, 0x3c, 0x9f, 0xa8,
|
||||
0x51, 0xa3, 0x40, 0x8f, 0x92, 0x9d, 0x38, 0xf5, 0xbc, 0xb6, 0xda, 0x21, 0x10, 0xff, 0xf3, 0xd2,
|
||||
0xcd, 0x0c, 0x13, 0xec, 0x5f, 0x97, 0x44, 0x17, 0xc4, 0xa7, 0x7e, 0x3d, 0x64, 0x5d, 0x19, 0x73,
|
||||
0x60, 0x81, 0x4f, 0xdc, 0x22, 0x2a, 0x90, 0x88, 0x46, 0xee, 0xb8, 0x14, 0xde, 0x5e, 0x0b, 0xdb,
|
||||
0xe0, 0x32, 0x3a, 0x0a, 0x49, 0x06, 0x24, 0x5c, 0xc2, 0xd3, 0xac, 0x62, 0x91, 0x95, 0xe4, 0x79,
|
||||
0xe7, 0xc8, 0x37, 0x6d, 0x8d, 0xd5, 0x4e, 0xa9, 0x6c, 0x56, 0xf4, 0xea, 0x65, 0x7a, 0xae, 0x08,
|
||||
0xba, 0x78, 0x25, 0x2e, 0x1c, 0xa6, 0xb4, 0xc6, 0xe8, 0xdd, 0x74, 0x1f, 0x4b, 0xbd, 0x8b, 0x8a,
|
||||
0x70, 0x3e, 0xb5, 0x66, 0x48, 0x03, 0xf6, 0x0e, 0x61, 0x35, 0x57, 0xb9, 0x86, 0xc1, 0x1d, 0x9e,
|
||||
0xe1, 0xf8, 0x98, 0x11, 0x69, 0xd9, 0x8e, 0x94, 0x9b, 0x1e, 0x87, 0xe9, 0xce, 0x55, 0x28, 0xdf,
|
||||
0x8c, 0xa1, 0x89, 0x0d, 0xbf, 0xe6, 0x42, 0x68, 0x41, 0x99, 0x2d, 0x0f, 0xb0, 0x54, 0xbb, 0x16};
|
||||
static const byte lookup_sbox_inv[] = {
|
||||
0x52, 0x09, 0x6a, 0xd5, 0x30, 0x36, 0xa5, 0x38, 0xbf, 0x40, 0xa3, 0x9e, 0x81, 0xf3, 0xd7, 0xfb,
|
||||
0x7c, 0xe3, 0x39, 0x82, 0x9b, 0x2f, 0xff, 0x87, 0x34, 0x8e, 0x43, 0x44, 0xc4, 0xde, 0xe9, 0xcb,
|
||||
0x54, 0x7b, 0x94, 0x32, 0xa6, 0xc2, 0x23, 0x3d, 0xee, 0x4c, 0x95, 0x0b, 0x42, 0xfa, 0xc3, 0x4e,
|
||||
0x08, 0x2e, 0xa1, 0x66, 0x28, 0xd9, 0x24, 0xb2, 0x76, 0x5b, 0xa2, 0x49, 0x6d, 0x8b, 0xd1, 0x25,
|
||||
0x72, 0xf8, 0xf6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xd4, 0xa4, 0x5c, 0xcc, 0x5d, 0x65, 0xb6, 0x92,
|
||||
0x6c, 0x70, 0x48, 0x50, 0xfd, 0xed, 0xb9, 0xda, 0x5e, 0x15, 0x46, 0x57, 0xa7, 0x8d, 0x9d, 0x84,
|
||||
0x90, 0xd8, 0xab, 0x00, 0x8c, 0xbc, 0xd3, 0x0a, 0xf7, 0xe4, 0x58, 0x05, 0xb8, 0xb3, 0x45, 0x06,
|
||||
0xd0, 0x2c, 0x1e, 0x8f, 0xca, 0x3f, 0x0f, 0x02, 0xc1, 0xaf, 0xbd, 0x03, 0x01, 0x13, 0x8a, 0x6b,
|
||||
0x3a, 0x91, 0x11, 0x41, 0x4f, 0x67, 0xdc, 0xea, 0x97, 0xf2, 0xcf, 0xce, 0xf0, 0xb4, 0xe6, 0x73,
|
||||
0x96, 0xac, 0x74, 0x22, 0xe7, 0xad, 0x35, 0x85, 0xe2, 0xf9, 0x37, 0xe8, 0x1c, 0x75, 0xdf, 0x6e,
|
||||
0x47, 0xf1, 0x1a, 0x71, 0x1d, 0x29, 0xc5, 0x89, 0x6f, 0xb7, 0x62, 0x0e, 0xaa, 0x18, 0xbe, 0x1b,
|
||||
0xfc, 0x56, 0x3e, 0x4b, 0xc6, 0xd2, 0x79, 0x20, 0x9a, 0xdb, 0xc0, 0xfe, 0x78, 0xcd, 0x5a, 0xf4,
|
||||
0x1f, 0xdd, 0xa8, 0x33, 0x88, 0x07, 0xc7, 0x31, 0xb1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xec, 0x5f,
|
||||
0x60, 0x51, 0x7f, 0xa9, 0x19, 0xb5, 0x4a, 0x0d, 0x2d, 0xe5, 0x7a, 0x9f, 0x93, 0xc9, 0x9c, 0xef,
|
||||
0xa0, 0xe0, 0x3b, 0x4d, 0xae, 0x2a, 0xf5, 0xb0, 0xc8, 0xeb, 0xbb, 0x3c, 0x83, 0x53, 0x99, 0x61,
|
||||
0x17, 0x2b, 0x04, 0x7e, 0xba, 0x77, 0xd6, 0x26, 0xe1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0c, 0x7d};
|
||||
static const byte lookup_g2[] = {
|
||||
0x00, 0x02, 0x04, 0x06, 0x08, 0x0a, 0x0c, 0x0e, 0x10, 0x12, 0x14, 0x16, 0x18, 0x1a, 0x1c, 0x1e,
|
||||
0x20, 0x22, 0x24, 0x26, 0x28, 0x2a, 0x2c, 0x2e, 0x30, 0x32, 0x34, 0x36, 0x38, 0x3a, 0x3c, 0x3e,
|
||||
0x40, 0x42, 0x44, 0x46, 0x48, 0x4a, 0x4c, 0x4e, 0x50, 0x52, 0x54, 0x56, 0x58, 0x5a, 0x5c, 0x5e,
|
||||
0x60, 0x62, 0x64, 0x66, 0x68, 0x6a, 0x6c, 0x6e, 0x70, 0x72, 0x74, 0x76, 0x78, 0x7a, 0x7c, 0x7e,
|
||||
0x80, 0x82, 0x84, 0x86, 0x88, 0x8a, 0x8c, 0x8e, 0x90, 0x92, 0x94, 0x96, 0x98, 0x9a, 0x9c, 0x9e,
|
||||
0xa0, 0xa2, 0xa4, 0xa6, 0xa8, 0xaa, 0xac, 0xae, 0xb0, 0xb2, 0xb4, 0xb6, 0xb8, 0xba, 0xbc, 0xbe,
|
||||
0xc0, 0xc2, 0xc4, 0xc6, 0xc8, 0xca, 0xcc, 0xce, 0xd0, 0xd2, 0xd4, 0xd6, 0xd8, 0xda, 0xdc, 0xde,
|
||||
0xe0, 0xe2, 0xe4, 0xe6, 0xe8, 0xea, 0xec, 0xee, 0xf0, 0xf2, 0xf4, 0xf6, 0xf8, 0xfa, 0xfc, 0xfe,
|
||||
0x1b, 0x19, 0x1f, 0x1d, 0x13, 0x11, 0x17, 0x15, 0x0b, 0x09, 0x0f, 0x0d, 0x03, 0x01, 0x07, 0x05,
|
||||
0x3b, 0x39, 0x3f, 0x3d, 0x33, 0x31, 0x37, 0x35, 0x2b, 0x29, 0x2f, 0x2d, 0x23, 0x21, 0x27, 0x25,
|
||||
0x5b, 0x59, 0x5f, 0x5d, 0x53, 0x51, 0x57, 0x55, 0x4b, 0x49, 0x4f, 0x4d, 0x43, 0x41, 0x47, 0x45,
|
||||
0x7b, 0x79, 0x7f, 0x7d, 0x73, 0x71, 0x77, 0x75, 0x6b, 0x69, 0x6f, 0x6d, 0x63, 0x61, 0x67, 0x65,
|
||||
0x9b, 0x99, 0x9f, 0x9d, 0x93, 0x91, 0x97, 0x95, 0x8b, 0x89, 0x8f, 0x8d, 0x83, 0x81, 0x87, 0x85,
|
||||
0xbb, 0xb9, 0xbf, 0xbd, 0xb3, 0xb1, 0xb7, 0xb5, 0xab, 0xa9, 0xaf, 0xad, 0xa3, 0xa1, 0xa7, 0xa5,
|
||||
0xdb, 0xd9, 0xdf, 0xdd, 0xd3, 0xd1, 0xd7, 0xd5, 0xcb, 0xc9, 0xcf, 0xcd, 0xc3, 0xc1, 0xc7, 0xc5,
|
||||
0xfb, 0xf9, 0xff, 0xfd, 0xf3, 0xf1, 0xf7, 0xf5, 0xeb, 0xe9, 0xef, 0xed, 0xe3, 0xe1, 0xe7, 0xe5};
|
||||
static const byte lookup_g3[] = {
|
||||
0x00, 0x03, 0x06, 0x05, 0x0c, 0x0f, 0x0a, 0x09, 0x18, 0x1b, 0x1e, 0x1d, 0x14, 0x17, 0x12, 0x11,
|
||||
0x30, 0x33, 0x36, 0x35, 0x3c, 0x3f, 0x3a, 0x39, 0x28, 0x2b, 0x2e, 0x2d, 0x24, 0x27, 0x22, 0x21,
|
||||
0x60, 0x63, 0x66, 0x65, 0x6c, 0x6f, 0x6a, 0x69, 0x78, 0x7b, 0x7e, 0x7d, 0x74, 0x77, 0x72, 0x71,
|
||||
0x50, 0x53, 0x56, 0x55, 0x5c, 0x5f, 0x5a, 0x59, 0x48, 0x4b, 0x4e, 0x4d, 0x44, 0x47, 0x42, 0x41,
|
||||
0xc0, 0xc3, 0xc6, 0xc5, 0xcc, 0xcf, 0xca, 0xc9, 0xd8, 0xdb, 0xde, 0xdd, 0xd4, 0xd7, 0xd2, 0xd1,
|
||||
0xf0, 0xf3, 0xf6, 0xf5, 0xfc, 0xff, 0xfa, 0xf9, 0xe8, 0xeb, 0xee, 0xed, 0xe4, 0xe7, 0xe2, 0xe1,
|
||||
0xa0, 0xa3, 0xa6, 0xa5, 0xac, 0xaf, 0xaa, 0xa9, 0xb8, 0xbb, 0xbe, 0xbd, 0xb4, 0xb7, 0xb2, 0xb1,
|
||||
0x90, 0x93, 0x96, 0x95, 0x9c, 0x9f, 0x9a, 0x99, 0x88, 0x8b, 0x8e, 0x8d, 0x84, 0x87, 0x82, 0x81,
|
||||
0x9b, 0x98, 0x9d, 0x9e, 0x97, 0x94, 0x91, 0x92, 0x83, 0x80, 0x85, 0x86, 0x8f, 0x8c, 0x89, 0x8a,
|
||||
0xab, 0xa8, 0xad, 0xae, 0xa7, 0xa4, 0xa1, 0xa2, 0xb3, 0xb0, 0xb5, 0xb6, 0xbf, 0xbc, 0xb9, 0xba,
|
||||
0xfb, 0xf8, 0xfd, 0xfe, 0xf7, 0xf4, 0xf1, 0xf2, 0xe3, 0xe0, 0xe5, 0xe6, 0xef, 0xec, 0xe9, 0xea,
|
||||
0xcb, 0xc8, 0xcd, 0xce, 0xc7, 0xc4, 0xc1, 0xc2, 0xd3, 0xd0, 0xd5, 0xd6, 0xdf, 0xdc, 0xd9, 0xda,
|
||||
0x5b, 0x58, 0x5d, 0x5e, 0x57, 0x54, 0x51, 0x52, 0x43, 0x40, 0x45, 0x46, 0x4f, 0x4c, 0x49, 0x4a,
|
||||
0x6b, 0x68, 0x6d, 0x6e, 0x67, 0x64, 0x61, 0x62, 0x73, 0x70, 0x75, 0x76, 0x7f, 0x7c, 0x79, 0x7a,
|
||||
0x3b, 0x38, 0x3d, 0x3e, 0x37, 0x34, 0x31, 0x32, 0x23, 0x20, 0x25, 0x26, 0x2f, 0x2c, 0x29, 0x2a,
|
||||
0x0b, 0x08, 0x0d, 0x0e, 0x07, 0x04, 0x01, 0x02, 0x13, 0x10, 0x15, 0x16, 0x1f, 0x1c, 0x19, 0x1a};
|
||||
static const byte lookup_g9[] = {
|
||||
0x00, 0x09, 0x12, 0x1b, 0x24, 0x2d, 0x36, 0x3f, 0x48, 0x41, 0x5a, 0x53, 0x6c, 0x65, 0x7e, 0x77,
|
||||
0x90, 0x99, 0x82, 0x8b, 0xb4, 0xbd, 0xa6, 0xaf, 0xd8, 0xd1, 0xca, 0xc3, 0xfc, 0xf5, 0xee, 0xe7,
|
||||
0x3b, 0x32, 0x29, 0x20, 0x1f, 0x16, 0x0d, 0x04, 0x73, 0x7a, 0x61, 0x68, 0x57, 0x5e, 0x45, 0x4c,
|
||||
0xab, 0xa2, 0xb9, 0xb0, 0x8f, 0x86, 0x9d, 0x94, 0xe3, 0xea, 0xf1, 0xf8, 0xc7, 0xce, 0xd5, 0xdc,
|
||||
0x76, 0x7f, 0x64, 0x6d, 0x52, 0x5b, 0x40, 0x49, 0x3e, 0x37, 0x2c, 0x25, 0x1a, 0x13, 0x08, 0x01,
|
||||
0xe6, 0xef, 0xf4, 0xfd, 0xc2, 0xcb, 0xd0, 0xd9, 0xae, 0xa7, 0xbc, 0xb5, 0x8a, 0x83, 0x98, 0x91,
|
||||
0x4d, 0x44, 0x5f, 0x56, 0x69, 0x60, 0x7b, 0x72, 0x05, 0x0c, 0x17, 0x1e, 0x21, 0x28, 0x33, 0x3a,
|
||||
0xdd, 0xd4, 0xcf, 0xc6, 0xf9, 0xf0, 0xeb, 0xe2, 0x95, 0x9c, 0x87, 0x8e, 0xb1, 0xb8, 0xa3, 0xaa,
|
||||
0xec, 0xe5, 0xfe, 0xf7, 0xc8, 0xc1, 0xda, 0xd3, 0xa4, 0xad, 0xb6, 0xbf, 0x80, 0x89, 0x92, 0x9b,
|
||||
0x7c, 0x75, 0x6e, 0x67, 0x58, 0x51, 0x4a, 0x43, 0x34, 0x3d, 0x26, 0x2f, 0x10, 0x19, 0x02, 0x0b,
|
||||
0xd7, 0xde, 0xc5, 0xcc, 0xf3, 0xfa, 0xe1, 0xe8, 0x9f, 0x96, 0x8d, 0x84, 0xbb, 0xb2, 0xa9, 0xa0,
|
||||
0x47, 0x4e, 0x55, 0x5c, 0x63, 0x6a, 0x71, 0x78, 0x0f, 0x06, 0x1d, 0x14, 0x2b, 0x22, 0x39, 0x30,
|
||||
0x9a, 0x93, 0x88, 0x81, 0xbe, 0xb7, 0xac, 0xa5, 0xd2, 0xdb, 0xc0, 0xc9, 0xf6, 0xff, 0xe4, 0xed,
|
||||
0x0a, 0x03, 0x18, 0x11, 0x2e, 0x27, 0x3c, 0x35, 0x42, 0x4b, 0x50, 0x59, 0x66, 0x6f, 0x74, 0x7d,
|
||||
0xa1, 0xa8, 0xb3, 0xba, 0x85, 0x8c, 0x97, 0x9e, 0xe9, 0xe0, 0xfb, 0xf2, 0xcd, 0xc4, 0xdf, 0xd6,
|
||||
0x31, 0x38, 0x23, 0x2a, 0x15, 0x1c, 0x07, 0x0e, 0x79, 0x70, 0x6b, 0x62, 0x5d, 0x54, 0x4f, 0x46};
|
||||
static const byte lookup_g11[] = {
|
||||
0x00, 0x0b, 0x16, 0x1d, 0x2c, 0x27, 0x3a, 0x31, 0x58, 0x53, 0x4e, 0x45, 0x74, 0x7f, 0x62, 0x69,
|
||||
0xb0, 0xbb, 0xa6, 0xad, 0x9c, 0x97, 0x8a, 0x81, 0xe8, 0xe3, 0xfe, 0xf5, 0xc4, 0xcf, 0xd2, 0xd9,
|
||||
0x7b, 0x70, 0x6d, 0x66, 0x57, 0x5c, 0x41, 0x4a, 0x23, 0x28, 0x35, 0x3e, 0x0f, 0x04, 0x19, 0x12,
|
||||
0xcb, 0xc0, 0xdd, 0xd6, 0xe7, 0xec, 0xf1, 0xfa, 0x93, 0x98, 0x85, 0x8e, 0xbf, 0xb4, 0xa9, 0xa2,
|
||||
0xf6, 0xfd, 0xe0, 0xeb, 0xda, 0xd1, 0xcc, 0xc7, 0xae, 0xa5, 0xb8, 0xb3, 0x82, 0x89, 0x94, 0x9f,
|
||||
0x46, 0x4d, 0x50, 0x5b, 0x6a, 0x61, 0x7c, 0x77, 0x1e, 0x15, 0x08, 0x03, 0x32, 0x39, 0x24, 0x2f,
|
||||
0x8d, 0x86, 0x9b, 0x90, 0xa1, 0xaa, 0xb7, 0xbc, 0xd5, 0xde, 0xc3, 0xc8, 0xf9, 0xf2, 0xef, 0xe4,
|
||||
0x3d, 0x36, 0x2b, 0x20, 0x11, 0x1a, 0x07, 0x0c, 0x65, 0x6e, 0x73, 0x78, 0x49, 0x42, 0x5f, 0x54,
|
||||
0xf7, 0xfc, 0xe1, 0xea, 0xdb, 0xd0, 0xcd, 0xc6, 0xaf, 0xa4, 0xb9, 0xb2, 0x83, 0x88, 0x95, 0x9e,
|
||||
0x47, 0x4c, 0x51, 0x5a, 0x6b, 0x60, 0x7d, 0x76, 0x1f, 0x14, 0x09, 0x02, 0x33, 0x38, 0x25, 0x2e,
|
||||
0x8c, 0x87, 0x9a, 0x91, 0xa0, 0xab, 0xb6, 0xbd, 0xd4, 0xdf, 0xc2, 0xc9, 0xf8, 0xf3, 0xee, 0xe5,
|
||||
0x3c, 0x37, 0x2a, 0x21, 0x10, 0x1b, 0x06, 0x0d, 0x64, 0x6f, 0x72, 0x79, 0x48, 0x43, 0x5e, 0x55,
|
||||
0x01, 0x0a, 0x17, 0x1c, 0x2d, 0x26, 0x3b, 0x30, 0x59, 0x52, 0x4f, 0x44, 0x75, 0x7e, 0x63, 0x68,
|
||||
0xb1, 0xba, 0xa7, 0xac, 0x9d, 0x96, 0x8b, 0x80, 0xe9, 0xe2, 0xff, 0xf4, 0xc5, 0xce, 0xd3, 0xd8,
|
||||
0x7a, 0x71, 0x6c, 0x67, 0x56, 0x5d, 0x40, 0x4b, 0x22, 0x29, 0x34, 0x3f, 0x0e, 0x05, 0x18, 0x13,
|
||||
0xca, 0xc1, 0xdc, 0xd7, 0xe6, 0xed, 0xf0, 0xfb, 0x92, 0x99, 0x84, 0x8f, 0xbe, 0xb5, 0xa8, 0xa3};
|
||||
static const byte lookup_g13[] = {
|
||||
0x00, 0x0d, 0x1a, 0x17, 0x34, 0x39, 0x2e, 0x23, 0x68, 0x65, 0x72, 0x7f, 0x5c, 0x51, 0x46, 0x4b,
|
||||
0xd0, 0xdd, 0xca, 0xc7, 0xe4, 0xe9, 0xfe, 0xf3, 0xb8, 0xb5, 0xa2, 0xaf, 0x8c, 0x81, 0x96, 0x9b,
|
||||
0xbb, 0xb6, 0xa1, 0xac, 0x8f, 0x82, 0x95, 0x98, 0xd3, 0xde, 0xc9, 0xc4, 0xe7, 0xea, 0xfd, 0xf0,
|
||||
0x6b, 0x66, 0x71, 0x7c, 0x5f, 0x52, 0x45, 0x48, 0x03, 0x0e, 0x19, 0x14, 0x37, 0x3a, 0x2d, 0x20,
|
||||
0x6d, 0x60, 0x77, 0x7a, 0x59, 0x54, 0x43, 0x4e, 0x05, 0x08, 0x1f, 0x12, 0x31, 0x3c, 0x2b, 0x26,
|
||||
0xbd, 0xb0, 0xa7, 0xaa, 0x89, 0x84, 0x93, 0x9e, 0xd5, 0xd8, 0xcf, 0xc2, 0xe1, 0xec, 0xfb, 0xf6,
|
||||
0xd6, 0xdb, 0xcc, 0xc1, 0xe2, 0xef, 0xf8, 0xf5, 0xbe, 0xb3, 0xa4, 0xa9, 0x8a, 0x87, 0x90, 0x9d,
|
||||
0x06, 0x0b, 0x1c, 0x11, 0x32, 0x3f, 0x28, 0x25, 0x6e, 0x63, 0x74, 0x79, 0x5a, 0x57, 0x40, 0x4d,
|
||||
0xda, 0xd7, 0xc0, 0xcd, 0xee, 0xe3, 0xf4, 0xf9, 0xb2, 0xbf, 0xa8, 0xa5, 0x86, 0x8b, 0x9c, 0x91,
|
||||
0x0a, 0x07, 0x10, 0x1d, 0x3e, 0x33, 0x24, 0x29, 0x62, 0x6f, 0x78, 0x75, 0x56, 0x5b, 0x4c, 0x41,
|
||||
0x61, 0x6c, 0x7b, 0x76, 0x55, 0x58, 0x4f, 0x42, 0x09, 0x04, 0x13, 0x1e, 0x3d, 0x30, 0x27, 0x2a,
|
||||
0xb1, 0xbc, 0xab, 0xa6, 0x85, 0x88, 0x9f, 0x92, 0xd9, 0xd4, 0xc3, 0xce, 0xed, 0xe0, 0xf7, 0xfa,
|
||||
0xb7, 0xba, 0xad, 0xa0, 0x83, 0x8e, 0x99, 0x94, 0xdf, 0xd2, 0xc5, 0xc8, 0xeb, 0xe6, 0xf1, 0xfc,
|
||||
0x67, 0x6a, 0x7d, 0x70, 0x53, 0x5e, 0x49, 0x44, 0x0f, 0x02, 0x15, 0x18, 0x3b, 0x36, 0x21, 0x2c,
|
||||
0x0c, 0x01, 0x16, 0x1b, 0x38, 0x35, 0x22, 0x2f, 0x64, 0x69, 0x7e, 0x73, 0x50, 0x5d, 0x4a, 0x47,
|
||||
0xdc, 0xd1, 0xc6, 0xcb, 0xe8, 0xe5, 0xf2, 0xff, 0xb4, 0xb9, 0xae, 0xa3, 0x80, 0x8d, 0x9a, 0x97};
|
||||
static const byte lookup_g14[] = {
|
||||
0x00, 0x0e, 0x1c, 0x12, 0x38, 0x36, 0x24, 0x2a, 0x70, 0x7e, 0x6c, 0x62, 0x48, 0x46, 0x54, 0x5a,
|
||||
0xe0, 0xee, 0xfc, 0xf2, 0xd8, 0xd6, 0xc4, 0xca, 0x90, 0x9e, 0x8c, 0x82, 0xa8, 0xa6, 0xb4, 0xba,
|
||||
0xdb, 0xd5, 0xc7, 0xc9, 0xe3, 0xed, 0xff, 0xf1, 0xab, 0xa5, 0xb7, 0xb9, 0x93, 0x9d, 0x8f, 0x81,
|
||||
0x3b, 0x35, 0x27, 0x29, 0x03, 0x0d, 0x1f, 0x11, 0x4b, 0x45, 0x57, 0x59, 0x73, 0x7d, 0x6f, 0x61,
|
||||
0xad, 0xa3, 0xb1, 0xbf, 0x95, 0x9b, 0x89, 0x87, 0xdd, 0xd3, 0xc1, 0xcf, 0xe5, 0xeb, 0xf9, 0xf7,
|
||||
0x4d, 0x43, 0x51, 0x5f, 0x75, 0x7b, 0x69, 0x67, 0x3d, 0x33, 0x21, 0x2f, 0x05, 0x0b, 0x19, 0x17,
|
||||
0x76, 0x78, 0x6a, 0x64, 0x4e, 0x40, 0x52, 0x5c, 0x06, 0x08, 0x1a, 0x14, 0x3e, 0x30, 0x22, 0x2c,
|
||||
0x96, 0x98, 0x8a, 0x84, 0xae, 0xa0, 0xb2, 0xbc, 0xe6, 0xe8, 0xfa, 0xf4, 0xde, 0xd0, 0xc2, 0xcc,
|
||||
0x41, 0x4f, 0x5d, 0x53, 0x79, 0x77, 0x65, 0x6b, 0x31, 0x3f, 0x2d, 0x23, 0x09, 0x07, 0x15, 0x1b,
|
||||
0xa1, 0xaf, 0xbd, 0xb3, 0x99, 0x97, 0x85, 0x8b, 0xd1, 0xdf, 0xcd, 0xc3, 0xe9, 0xe7, 0xf5, 0xfb,
|
||||
0x9a, 0x94, 0x86, 0x88, 0xa2, 0xac, 0xbe, 0xb0, 0xea, 0xe4, 0xf6, 0xf8, 0xd2, 0xdc, 0xce, 0xc0,
|
||||
0x7a, 0x74, 0x66, 0x68, 0x42, 0x4c, 0x5e, 0x50, 0x0a, 0x04, 0x16, 0x18, 0x32, 0x3c, 0x2e, 0x20,
|
||||
0xec, 0xe2, 0xf0, 0xfe, 0xd4, 0xda, 0xc8, 0xc6, 0x9c, 0x92, 0x80, 0x8e, 0xa4, 0xaa, 0xb8, 0xb6,
|
||||
0x0c, 0x02, 0x10, 0x1e, 0x34, 0x3a, 0x28, 0x26, 0x7c, 0x72, 0x60, 0x6e, 0x44, 0x4a, 0x58, 0x56,
|
||||
0x37, 0x39, 0x2b, 0x25, 0x0f, 0x01, 0x13, 0x1d, 0x47, 0x49, 0x5b, 0x55, 0x7f, 0x71, 0x63, 0x6d,
|
||||
0xd7, 0xd9, 0xcb, 0xc5, 0xef, 0xe1, 0xf3, 0xfd, 0xa7, 0xa9, 0xbb, 0xb5, 0x9f, 0x91, 0x83, 0x8d};
|
||||
|
||||
// Xor's all elements in a n byte array a by b
|
||||
static void xor_s(byte * a, const byte *b, int n) {
|
||||
int i;
|
||||
for (i = 0; i < n; i++) {
|
||||
a[i] ^= b[i];
|
||||
}
|
||||
}
|
||||
|
||||
// Xor the current cipher state by a specific round key
|
||||
static void xor_round_key(byte *state, const byte *keys, int round) {
|
||||
xor_s(state, keys + round * 16, 16);
|
||||
}
|
||||
|
||||
// Apply the rijndael s-box to all elements in an array
|
||||
// http://en.wikipedia.org/wiki/Rijndael_S-box
|
||||
static void sub_bytes(byte *a, int n) {
|
||||
int i;
|
||||
for (i = 0; i < n; i++) {
|
||||
a[i] = lookup_sbox[a[i]];
|
||||
}
|
||||
}
|
||||
static void sub_bytes_inv(byte *a, int n) {
|
||||
int i;
|
||||
for (i = 0; i < n; i++) {
|
||||
a[i] = lookup_sbox_inv[a[i]];
|
||||
}
|
||||
}
|
||||
|
||||
// Perform the core key schedule transform on 4 bytes, as part of the key expansion process
|
||||
// http://en.wikipedia.org/wiki/Rijndael_key_schedule#Key_schedule_core
|
||||
static void key_schedule_core(byte *a, int i) {
|
||||
byte temp = a[0]; // Rotate the output eight bits to the left
|
||||
a[0] = a[1];
|
||||
a[1] = a[2];
|
||||
a[2] = a[3];
|
||||
a[3] = temp;
|
||||
sub_bytes(a, 4); // Apply Rijndael's S-box on all four individual bytes in the output word
|
||||
a[0] ^= lookup_rcon[i]; // On just the first (leftmost) byte of the output word, perform the rcon operation with i
|
||||
// as the input, and exclusive or the rcon output with the first byte of the output word
|
||||
}
|
||||
|
||||
// Expand the 16-byte key to 11 round keys (176 bytes)
|
||||
// http://en.wikipedia.org/wiki/Rijndael_key_schedule#The_key_schedule
|
||||
void oqs_aes128_load_schedule_c(const uint8_t *key, void **_schedule) {
|
||||
*_schedule = malloc(16 * 11);
|
||||
assert(*_schedule != NULL);
|
||||
uint8_t *schedule = (uint8_t *) *_schedule;
|
||||
int bytes = 16; // The count of how many bytes we've created so far
|
||||
int i = 1; // The rcon iteration value i is set to 1
|
||||
int j; // For repeating the second stage 3 times
|
||||
byte t[4]; // Temporary working area known as 't' in the Wiki article
|
||||
memcpy(schedule, key, 16); // The first 16 bytes of the expanded key are simply the encryption key
|
||||
|
||||
while (bytes < 176) { // Until we have 176 bytes of expanded key, we do the following:
|
||||
memcpy(t, schedule + bytes - 4, 4); // We assign the value of the previous four bytes in the expanded key to t
|
||||
key_schedule_core(t, i); // We perform the key schedule core on t, with i as the rcon iteration value
|
||||
i++; // We increment i by 1
|
||||
xor_s(t, schedule + bytes - 16, 4); // We exclusive-or t with the four-byte block 16 bytes before the new expanded key.
|
||||
memcpy(schedule + bytes, t, 4); // This becomes the next 4 bytes in the expanded key
|
||||
bytes += 4; // Keep track of how many expanded key bytes we've added
|
||||
|
||||
// We then do the following three times to create the next twelve bytes
|
||||
for (j = 0; j < 3; j++) {
|
||||
memcpy(t, schedule + bytes - 4, 4); // We assign the value of the previous 4 bytes in the expanded key to t
|
||||
xor_s(t, schedule + bytes - 16, 4); // We exclusive-or t with the four-byte block n bytes before
|
||||
memcpy(schedule + bytes, t, 4); // This becomes the next 4 bytes in the expanded key
|
||||
bytes += 4; // Keep track of how many expanded key bytes we've added
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void oqs_aes128_free_schedule_c(void *schedule) {
|
||||
if (schedule != NULL) {
|
||||
free(schedule);
|
||||
}
|
||||
}
|
||||
|
||||
// Apply the shift rows step on the 16 byte cipher state
|
||||
// http://en.wikipedia.org/wiki/Advanced_Encryption_Standard#The_ShiftRows_step
|
||||
static void shift_rows(byte *state) {
|
||||
int i;
|
||||
byte temp[16];
|
||||
memcpy(temp, state, 16);
|
||||
for (i = 0; i < 16; i++) {
|
||||
state[i] = temp[shift_rows_table[i]];
|
||||
}
|
||||
}
|
||||
static void shift_rows_inv(byte *state) {
|
||||
int i;
|
||||
byte temp[16];
|
||||
memcpy(temp, state, 16);
|
||||
for (i = 0; i < 16; i++) {
|
||||
state[i] = temp[shift_rows_table_inv[i]];
|
||||
}
|
||||
}
|
||||
|
||||
// Perform the mix columns matrix on one column of 4 bytes
|
||||
// http://en.wikipedia.org/wiki/Rijndael_mix_columns
|
||||
static void mix_col(byte *state) {
|
||||
byte a0 = state[0];
|
||||
byte a1 = state[1];
|
||||
byte a2 = state[2];
|
||||
byte a3 = state[3];
|
||||
state[0] = lookup_g2[a0] ^ lookup_g3[a1] ^ a2 ^ a3;
|
||||
state[1] = lookup_g2[a1] ^ lookup_g3[a2] ^ a3 ^ a0;
|
||||
state[2] = lookup_g2[a2] ^ lookup_g3[a3] ^ a0 ^ a1;
|
||||
state[3] = lookup_g2[a3] ^ lookup_g3[a0] ^ a1 ^ a2;
|
||||
}
|
||||
|
||||
// Perform the mix columns matrix on each column of the 16 bytes
|
||||
static void mix_cols(byte *state) {
|
||||
mix_col(state);
|
||||
mix_col(state + 4);
|
||||
mix_col(state + 8);
|
||||
mix_col(state + 12);
|
||||
}
|
||||
|
||||
// Perform the inverse mix columns matrix on one column of 4 bytes
|
||||
// http://en.wikipedia.org/wiki/Rijndael_mix_columns
|
||||
static void mix_col_inv(byte *state) {
|
||||
byte a0 = state[0];
|
||||
byte a1 = state[1];
|
||||
byte a2 = state[2];
|
||||
byte a3 = state[3];
|
||||
state[0] = lookup_g14[a0] ^ lookup_g9[a3] ^ lookup_g13[a2] ^ lookup_g11[a1];
|
||||
state[1] = lookup_g14[a1] ^ lookup_g9[a0] ^ lookup_g13[a3] ^ lookup_g11[a2];
|
||||
state[2] = lookup_g14[a2] ^ lookup_g9[a1] ^ lookup_g13[a0] ^ lookup_g11[a3];
|
||||
state[3] = lookup_g14[a3] ^ lookup_g9[a2] ^ lookup_g13[a1] ^ lookup_g11[a0];
|
||||
}
|
||||
|
||||
// Perform the inverse mix columns matrix on each column of the 16 bytes
|
||||
static void mix_cols_inv(byte *state) {
|
||||
mix_col_inv(state);
|
||||
mix_col_inv(state + 4);
|
||||
mix_col_inv(state + 8);
|
||||
mix_col_inv(state + 12);
|
||||
}
|
||||
|
||||
void oqs_aes128_enc_c(const uint8_t *plaintext, const void *_schedule, uint8_t *ciphertext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// First Round
|
||||
memcpy(ciphertext, plaintext, 16);
|
||||
xor_round_key(ciphertext, schedule, 0);
|
||||
|
||||
// Middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
sub_bytes(ciphertext, 16);
|
||||
shift_rows(ciphertext);
|
||||
mix_cols(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, i + 1);
|
||||
}
|
||||
|
||||
// Final Round
|
||||
sub_bytes(ciphertext, 16);
|
||||
shift_rows(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, 10);
|
||||
}
|
||||
|
||||
|
||||
void oqs_aes128_dec_c(const uint8_t *ciphertext, const void *_schedule, uint8_t *plaintext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// Reverse the final Round
|
||||
memcpy(plaintext, ciphertext, 16);
|
||||
xor_round_key(plaintext, schedule, 10);
|
||||
shift_rows_inv(plaintext);
|
||||
sub_bytes_inv(plaintext, 16);
|
||||
|
||||
// Reverse the middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
xor_round_key(plaintext, schedule, 9 - i);
|
||||
mix_cols_inv(plaintext);
|
||||
shift_rows_inv(plaintext);
|
||||
sub_bytes_inv(plaintext, 16);
|
||||
}
|
||||
|
||||
// Reverse the first Round
|
||||
xor_round_key(plaintext, schedule, 0);
|
||||
}
|
||||
|
||||
// It's not enc nor dec, it's something in between
|
||||
void oqs_mhy128_enc_c(const uint8_t *plaintext, const void *_schedule, uint8_t *ciphertext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// First Round
|
||||
memcpy(ciphertext, plaintext, 16);
|
||||
xor_round_key(ciphertext, schedule, 0);
|
||||
|
||||
// Middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
sub_bytes_inv(ciphertext, 16);
|
||||
shift_rows_inv(ciphertext);
|
||||
mix_cols_inv(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, i + 1);
|
||||
}
|
||||
|
||||
// Final Round
|
||||
sub_bytes_inv(ciphertext, 16);
|
||||
shift_rows_inv(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, 10);
|
||||
}
|
||||
|
||||
void oqs_mhy128_dec_c(const uint8_t *ciphertext, const void *_schedule, uint8_t *plaintext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// Reverse the final Round
|
||||
memcpy(plaintext, ciphertext, 16);
|
||||
xor_round_key(plaintext, schedule, 10);
|
||||
shift_rows(plaintext);
|
||||
sub_bytes(plaintext, 16);
|
||||
|
||||
// Reverse the middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
xor_round_key(plaintext, schedule, 9 - i);
|
||||
mix_cols(plaintext);
|
||||
shift_rows(plaintext);
|
||||
sub_bytes(plaintext, 16);
|
||||
}
|
||||
|
||||
// Reverse the first Round
|
||||
xor_round_key(plaintext, schedule, 0);
|
||||
}
|
||||
@@ -1,66 +0,0 @@
|
||||
/**
|
||||
* \file aes.h
|
||||
* \brief Header defining the API for OQS AES
|
||||
*/
|
||||
|
||||
#ifndef __OQS_AES_H
|
||||
#define __OQS_AES_H
|
||||
|
||||
#include <stdint.h>
|
||||
#include <stdlib.h>
|
||||
|
||||
/**
|
||||
* Function to fill a key schedule given an initial key.
|
||||
*
|
||||
* @param key Initial Key.
|
||||
* @param schedule Abstract data structure for a key schedule.
|
||||
* @param forEncryption 1 if key schedule is for encryption, 0 if for decryption.
|
||||
*/
|
||||
void OQS_AES128_load_schedule(const uint8_t *key, void **schedule, int for_encryption);
|
||||
|
||||
/**
|
||||
* Function to free a key schedule.
|
||||
*
|
||||
* @param schedule Schedule generated with OQS_AES128_load_schedule().
|
||||
*/
|
||||
void OQS_AES128_free_schedule(void *schedule);
|
||||
|
||||
/**
|
||||
* Function to encrypt blocks of plaintext using ECB mode.
|
||||
* A schedule based on the key is generated and used internally.
|
||||
*
|
||||
* @param plaintext Plaintext to be encrypted.
|
||||
* @param plaintext_len Length on the plaintext in bytes. Must be a multiple of 16.
|
||||
* @param key Key to be used for encryption.
|
||||
* @param ciphertext Pointer to a block of memory which >= in size to the plaintext block. The result will be written here.
|
||||
*/
|
||||
void OQS_AES128_ECB_enc(const uint8_t *plaintext, const size_t plaintext_len, const uint8_t *key, uint8_t *ciphertext);
|
||||
|
||||
/**
|
||||
* Function to decrypt blocks of plaintext using ECB mode.
|
||||
* A schedule based on the key is generated and used internally.
|
||||
*
|
||||
* @param ciphertext Ciphertext to be decrypted.
|
||||
* @param ciphertext_len Length on the ciphertext in bytes. Must be a multiple of 16.
|
||||
* @param key Key to be used for encryption.
|
||||
* @param ciphertext Pointer to a block of memory which >= in size to the ciphertext block. The result will be written here.
|
||||
*/
|
||||
void OQS_AES128_ECB_dec(const uint8_t *ciphertext, const size_t ciphertext_len, const uint8_t *key, uint8_t *plaintext);
|
||||
|
||||
/**
|
||||
* Same as OQS_AES128_ECB_enc() except a schedule generated by
|
||||
* OQS_AES128_load_schedule() is passed rather then a key. This is faster
|
||||
* if the same schedule is used for multiple encryptions since it does
|
||||
* not have to be regenerated from the key.
|
||||
*/
|
||||
void OQS_AES128_ECB_enc_sch(const uint8_t *plaintext, const size_t plaintext_len, const void *schedule, uint8_t *ciphertext);
|
||||
|
||||
/**
|
||||
* Same as OQS_AES128_ECB_dec() except a schedule generated by
|
||||
* OQS_AES128_load_schedule() is passed rather then a key. This is faster
|
||||
* if the same schedule is used for multiple encryptions since it does
|
||||
* not have to be regenerated from the key.
|
||||
*/
|
||||
void OQS_AES128_ECB_dec_sch(const uint8_t *ciphertext, const size_t ciphertext_len, const void *schedule, uint8_t *plaintext);
|
||||
|
||||
#endif
|
||||
@@ -1,31 +0,0 @@
|
||||
#include "memecrypto.h"
|
||||
|
||||
#include <cstring>
|
||||
#include <stdio.h>
|
||||
|
||||
extern "C" void oqs_mhy128_enc_c(const uint8_t *plaintext, const void *_schedule, uint8_t *ciphertext);
|
||||
extern "C" void oqs_mhy128_dec_c(const uint8_t *ciphertext, const void *_schedule, uint8_t *plaintext);
|
||||
|
||||
static uint8_t dexor16(const uint8_t *c) {
|
||||
uint8_t ret = 0;
|
||||
for (int i = 0; i < 16; i++)
|
||||
ret ^= c[i];
|
||||
return ret;
|
||||
}
|
||||
|
||||
void memecrypto_prepare_key(const uint8_t *in, uint8_t *out) {
|
||||
for (int i = 0; i < 0xB0; i++)
|
||||
out[i] = dexor16(&in[0x10 * i]);
|
||||
}
|
||||
|
||||
void memecrypto_decrypt(const uint8_t *key, uint8_t *data) {
|
||||
uint8_t plaintext[16];
|
||||
oqs_mhy128_enc_c(data, key, plaintext);
|
||||
memcpy(data, plaintext, 16);
|
||||
}
|
||||
|
||||
void memecrypto_encrypt(const uint8_t *key, uint8_t *data) {
|
||||
uint8_t ciphertext[16];
|
||||
oqs_mhy128_dec_c(data, key, ciphertext);
|
||||
memcpy(data, ciphertext, 16);
|
||||
}
|
||||
@@ -1,12 +0,0 @@
|
||||
#ifndef MEMECRYPTO_H
|
||||
#define MEMECRYPTO_H
|
||||
|
||||
#include <cstdint>
|
||||
|
||||
void memecrypto_prepare_key(const uint8_t *in, uint8_t *out);
|
||||
|
||||
void memecrypto_decrypt(const uint8_t *key, uint8_t *data);
|
||||
|
||||
void memecrypto_encrypt(const uint8_t *key, uint8_t *data);
|
||||
|
||||
#endif //MEMECRYPTO_H
|
||||
@@ -1,146 +0,0 @@
|
||||
#include "metadata.h"
|
||||
|
||||
#include <cstring>
|
||||
#include <random>
|
||||
#include <stdio.h>
|
||||
|
||||
#include "memecrypto.h"
|
||||
#include "metadatastringdec.h"
|
||||
|
||||
unsigned char initial_prev_xor[] = { 0xad, 0x2f, 0x42, 0x30, 0x67, 0x04, 0xb0, 0x9c, 0x9d, 0x2a, 0xc0, 0xba, 0x0e, 0xbf, 0xa5, 0x68 };
|
||||
|
||||
bool get_global_metadata_keys(uint8_t *src, size_t srcn, uint8_t *longkey, uint8_t *shortkey) {
|
||||
if (srcn != 0x4000)
|
||||
return false;
|
||||
|
||||
if (*(uint16_t *) (src + 0xc8) != 0xfc2e || *(uint16_t *) (src + 0xca) != 0x2cfe)
|
||||
return true;
|
||||
|
||||
auto offB00 = *(uint16_t *) (src + 0xd2);
|
||||
|
||||
for (size_t i = 0; i < 16; i++)
|
||||
shortkey[i] = src[offB00 + i] ^ src[0x3000 + i];
|
||||
|
||||
for (size_t i = 0; i < 0xb00; i++)
|
||||
longkey[i] = src[offB00 + 0x10 + i] ^ src[0x3000 + 0x10 + i] ^ shortkey[i % 16];
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
bool gen_global_metadata_key(uint8_t* src, size_t srcn) {
|
||||
if (srcn != 0x4000)
|
||||
return false;
|
||||
|
||||
#if 0
|
||||
std::vector<uint8_t> read_file(const char* n);
|
||||
auto data = read_file("xorpad.bin");
|
||||
memcpy(src, data.data(), 0x4000);
|
||||
|
||||
return false;
|
||||
#endif
|
||||
|
||||
std::mt19937_64 rand (0xDEADBEEF);
|
||||
|
||||
uint64_t* key = (uint64_t*)src;
|
||||
|
||||
for (size_t i = 0; i < srcn / sizeof(uint64_t); i++)
|
||||
key[i] = rand();
|
||||
|
||||
*(uint16_t *) (src + 0xc8) = 0xfc2e; // Magic
|
||||
*(uint16_t *) (src + 0xca) = 0x2cfe; // Magic
|
||||
*(uint16_t *) (src + 0xd2) = rand() & 0x1FFFu; // Just some random value
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
void decrypt_global_metadata_inner(uint8_t *data, size_t size) {
|
||||
uint8_t longkey[0xB00];
|
||||
uint8_t longkeyp[0xB0];
|
||||
uint8_t shortkey[16];
|
||||
get_global_metadata_keys(data + size - 0x4000, 0x4000, longkey, shortkey);
|
||||
for (int i = 0; i < 16; i++)
|
||||
shortkey[i] ^= initial_prev_xor[i];
|
||||
memecrypto_prepare_key(longkey, longkeyp);
|
||||
|
||||
auto perentry = (uint32_t) (size / 0x100 / 0x40);
|
||||
for (int i = 0; i < 0x100; i++) {
|
||||
auto off = (0x40u * perentry) * i;
|
||||
|
||||
uint8_t prev[16];
|
||||
memcpy(prev, shortkey, 16);
|
||||
for (int j = 0; j < 4; j++) {
|
||||
uint8_t curr[16];
|
||||
memcpy(curr, &data[off + j * 0x10], 16);
|
||||
|
||||
memecrypto_decrypt(longkeyp, curr);
|
||||
|
||||
for (int k = 0; k < 16; k++)
|
||||
curr[k] ^= prev[k];
|
||||
|
||||
memcpy(prev, &data[off + j * 0x10], 16);
|
||||
memcpy(&data[off + j * 0x10], curr, 16);
|
||||
}
|
||||
}
|
||||
|
||||
uint8_t literal_dec_key[0x5000];
|
||||
recrypt_global_metadata_header_string_fields(data, size, literal_dec_key);
|
||||
recrypt_global_metadata_header_string_literals(data, size, literal_dec_key);
|
||||
}
|
||||
|
||||
extern "C" int decrypt_global_metadata(uint8_t *data, size_t size) {
|
||||
try {
|
||||
decrypt_global_metadata_inner(data, size);
|
||||
return 0;
|
||||
} catch (...) {
|
||||
return -1;
|
||||
}
|
||||
}
|
||||
|
||||
void encrypt_global_metadata_inner(uint8_t* data, size_t size) {
|
||||
uint8_t literal_dec_key[0x5000];
|
||||
|
||||
gen_global_metadata_key(data + size - 0x4000, 0x4000);
|
||||
|
||||
generate_key_for_global_metadata_header_string(data, size, literal_dec_key);
|
||||
|
||||
recrypt_global_metadata_header_string_literals(data, size, literal_dec_key);
|
||||
recrypt_global_metadata_header_string_fields(data, size, literal_dec_key);
|
||||
|
||||
uint8_t longkey[0xB00];
|
||||
uint8_t longkeyp[0xB0];
|
||||
uint8_t shortkey[16];
|
||||
|
||||
get_global_metadata_keys(data + size - 0x4000, 0x4000, longkey, shortkey);
|
||||
for (int i = 0; i < 16; i++)
|
||||
shortkey[i] ^= initial_prev_xor[i];
|
||||
memecrypto_prepare_key(longkey, longkeyp);
|
||||
|
||||
auto perentry = (uint32_t) (size / 0x100 / 0x40);
|
||||
for (int i = 0; i < 0x100; i++) {
|
||||
auto off = (0x40u * perentry) * i;
|
||||
|
||||
uint8_t prev[16];
|
||||
memcpy(prev, shortkey, 16);
|
||||
for (int j = 0; j < 4; j++) {
|
||||
uint8_t curr[16];
|
||||
memcpy(curr, &data[off + j * 0x10], 16);
|
||||
|
||||
for (int k = 0; k < 16; k++)
|
||||
curr[k] ^= prev[k];
|
||||
|
||||
memecrypto_encrypt(longkeyp, curr);
|
||||
|
||||
memcpy(prev, curr, 16);
|
||||
memcpy(&data[off + j * 0x10], curr, 16);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" int encrypt_global_metadata(uint8_t* data, size_t size) {
|
||||
try {
|
||||
encrypt_global_metadata_inner(data, size);
|
||||
return 0;
|
||||
} catch (...) {
|
||||
return -1;
|
||||
}
|
||||
}
|
||||
@@ -1,10 +0,0 @@
|
||||
#ifndef METADATA_H
|
||||
#define METADATA_H
|
||||
|
||||
#include <cstdint>
|
||||
#include <cstdlib>
|
||||
|
||||
extern "C" int decrypt_global_metadata(uint8_t *data, size_t size);
|
||||
extern "C" int encrypt_global_metadata(uint8_t *data, size_t size);
|
||||
|
||||
#endif //METADATA_H
|
||||
@@ -1,121 +0,0 @@
|
||||
#include "metadatastringdec.h"
|
||||
|
||||
#include <stdexcept>
|
||||
#include <random>
|
||||
#include <stdio.h>
|
||||
|
||||
struct m_header_fields {
|
||||
char filler1[0x18];
|
||||
uint32_t stringLiteralDataOffset; // 18
|
||||
uint32_t stringLiteralDataCount; // 1c
|
||||
uint32_t stringLiteralOffset; // 20
|
||||
uint32_t stringLiteralCount; // 24
|
||||
char filler2[0xd8 - 0x28];
|
||||
uint32_t stringOffset, stringCount;
|
||||
};
|
||||
|
||||
struct m_literal {
|
||||
uint32_t offset, length;
|
||||
};
|
||||
|
||||
void generate_key_for_global_metadata_header_string(uint8_t* data, size_t len, uint8_t* literal_dec_key) {
|
||||
if (len < sizeof(m_header_fields))
|
||||
throw std::out_of_range("data not big enough for global metadata header");
|
||||
|
||||
uint32_t values[0x12] = {
|
||||
*(uint32_t *) (data + 0x60),
|
||||
*(uint32_t *) (data + 0x64),
|
||||
*(uint32_t *) (data + 0x68),
|
||||
*(uint32_t *) (data + 0x6c),
|
||||
*(uint32_t *) (data + 0x140),
|
||||
*(uint32_t *) (data + 0x144),
|
||||
*(uint32_t *) (data + 0x148),
|
||||
*(uint32_t *) (data + 0x14c),
|
||||
*(uint32_t *) (data + 0x100),
|
||||
*(uint32_t *) (data + 0x104),
|
||||
*(uint32_t *) (data + 0x108),
|
||||
*(uint32_t *) (data + 0x10c),
|
||||
*(uint32_t *) (data + 0xf0),
|
||||
*(uint32_t *) (data + 0xf4),
|
||||
*(uint32_t *) (data + 8),
|
||||
*(uint32_t *) (data + 0xc),
|
||||
*(uint32_t *) (data + 0x10),
|
||||
*(uint32_t *) (data + 0x14)
|
||||
};
|
||||
|
||||
uint64_t seed = ((uint64_t) values[values[0] & 0xfu] << 0x20u) | values[(values[0x11] & 0xf) + 2];
|
||||
|
||||
std::mt19937_64 rand (seed);
|
||||
|
||||
for (int i = 0; i < 6; i++) // Skip
|
||||
rand();
|
||||
|
||||
auto key64 = (uint64_t *) literal_dec_key;
|
||||
for (int i = 0; i < 0xa00; i++)
|
||||
key64[i] = rand();
|
||||
}
|
||||
|
||||
void recrypt_global_metadata_header_string_fields(uint8_t *data, size_t len, uint8_t *literal_dec_key) {
|
||||
if (len < sizeof(m_header_fields))
|
||||
throw std::out_of_range("data not big enough for global metadata header");
|
||||
|
||||
uint32_t values[0x12] = {
|
||||
*(uint32_t *) (data + 0x60),
|
||||
*(uint32_t *) (data + 0x64),
|
||||
*(uint32_t *) (data + 0x68),
|
||||
*(uint32_t *) (data + 0x6c),
|
||||
*(uint32_t *) (data + 0x140),
|
||||
*(uint32_t *) (data + 0x144),
|
||||
*(uint32_t *) (data + 0x148),
|
||||
*(uint32_t *) (data + 0x14c),
|
||||
*(uint32_t *) (data + 0x100),
|
||||
*(uint32_t *) (data + 0x104),
|
||||
*(uint32_t *) (data + 0x108),
|
||||
*(uint32_t *) (data + 0x10c),
|
||||
*(uint32_t *) (data + 0xf0),
|
||||
*(uint32_t *) (data + 0xf4),
|
||||
*(uint32_t *) (data + 8),
|
||||
*(uint32_t *) (data + 0xc),
|
||||
*(uint32_t *) (data + 0x10),
|
||||
*(uint32_t *) (data + 0x14)
|
||||
};
|
||||
|
||||
uint64_t seed = ((uint64_t) values[values[0] & 0xfu] << 0x20u) | values[(values[0x11] & 0xf) + 2];
|
||||
|
||||
std::mt19937_64 rand (seed);
|
||||
|
||||
auto header = (m_header_fields *) data;
|
||||
header->stringCount ^= (uint32_t) rand();
|
||||
header->stringOffset ^= (uint32_t) rand();
|
||||
rand();
|
||||
header->stringLiteralOffset ^= (uint32_t) rand();
|
||||
header->stringLiteralDataCount ^= (uint32_t) rand();
|
||||
header->stringLiteralDataOffset ^= (uint32_t) rand();
|
||||
|
||||
auto key64 = (uint64_t *) literal_dec_key;
|
||||
for (int i = 0; i < 0xa00; i++)
|
||||
key64[i] = rand();
|
||||
}
|
||||
|
||||
void recrypt_global_metadata_header_string_literals(uint8_t *data, size_t len, uint8_t *literal_dec_key) {
|
||||
if (len < sizeof(m_header_fields))
|
||||
throw std::out_of_range("data not big enough for global metadata header");
|
||||
|
||||
auto header = (m_header_fields *) data;
|
||||
if ((size_t) header->stringLiteralCount + header->stringLiteralOffset > len)
|
||||
throw std::out_of_range("file trimmed or string literal offset/count field invalid");
|
||||
|
||||
auto literals = (m_literal *) (data + header->stringLiteralOffset);
|
||||
auto count = header->stringLiteralCount / sizeof(m_literal);
|
||||
for (size_t i = 0; i < count; i++) {
|
||||
auto slen = literals[i].length;
|
||||
uint8_t *str = data + header->stringLiteralDataOffset + literals[i].offset;
|
||||
uint8_t *okey = literal_dec_key + (i % 0x2800);
|
||||
|
||||
if ((size_t) header->stringLiteralDataOffset + literals[i].offset + slen > len)
|
||||
throw std::out_of_range("file trimmed or contains invalid string entry");
|
||||
|
||||
for (size_t j = 0; j < slen; j++)
|
||||
str[j] ^= literal_dec_key[(j + 0x1400u) % 0x5000u] ^ (okey[j % 0x2800u] + (uint8_t) j);
|
||||
}
|
||||
}
|
||||
@@ -1,13 +0,0 @@
|
||||
#ifndef METADATASTRINGDEC_H
|
||||
#define METADATASTRINGDEC_H
|
||||
|
||||
#include <cstdint>
|
||||
#include <cstdlib>
|
||||
|
||||
void recrypt_global_metadata_header_string_fields(uint8_t *data, size_t len, uint8_t *literal_dec_key);
|
||||
|
||||
void recrypt_global_metadata_header_string_literals(uint8_t *data, size_t len, uint8_t *literal_dec_key);
|
||||
|
||||
void generate_key_for_global_metadata_header_string(uint8_t* data, size_t len, uint8_t* literal_dec_key);
|
||||
|
||||
#endif //METADATASTRINGDEC_H
|
||||
@@ -1,4 +0,0 @@
|
||||
newline_style = "Unix"
|
||||
tab_spaces = 2
|
||||
use_field_init_shorthand = true
|
||||
use_try_shorthand = true
|
||||
@@ -35,7 +35,7 @@ pub struct Configuration {
|
||||
}
|
||||
|
||||
pub fn config_path(profile: String) -> PathBuf {
|
||||
let mut path = tauri::api::path::data_dir().unwrap();
|
||||
let mut path = dirs::data_dir().unwrap();
|
||||
path.push("cultivation");
|
||||
if profile.as_str() == "default" {
|
||||
path.push("configuration.json");
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
use once_cell::sync::Lazy;
|
||||
use tauri::Emitter;
|
||||
|
||||
use std::cmp::min;
|
||||
use std::fs::File;
|
||||
|
||||
@@ -1,3 +1,5 @@
|
||||
use tauri::Emitter;
|
||||
|
||||
use crate::system_helpers::*;
|
||||
use std::path::{Path, PathBuf};
|
||||
|
||||
|
||||
542
src-tauri/src/lib.rs
Normal file
542
src-tauri/src/lib.rs
Normal file
@@ -0,0 +1,542 @@
|
||||
#![cfg_attr(
|
||||
all(not(debug_assertions), target_os = "windows"),
|
||||
windows_subsystem = "windows"
|
||||
)]
|
||||
|
||||
use args::{Args, ArgsError};
|
||||
|
||||
use once_cell::sync::Lazy;
|
||||
use proxy::set_proxy_addr;
|
||||
use tauri::{Listener, Emitter};
|
||||
use std::ffi::OsStr;
|
||||
use std::io::Write;
|
||||
use std::{collections::HashMap, sync::Mutex};
|
||||
use tauri::async_runtime::block_on;
|
||||
|
||||
use std::thread;
|
||||
use sysinfo::{Pid, System};
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
use crate::admin::reopen_as_admin;
|
||||
#[cfg(target_os = "windows")]
|
||||
use system_helpers::is_elevated;
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
use std::{
|
||||
thread::{sleep, JoinHandle},
|
||||
time::{Duration, Instant},
|
||||
};
|
||||
|
||||
mod admin;
|
||||
mod config;
|
||||
mod downloader;
|
||||
mod file_helpers;
|
||||
mod gamebanana;
|
||||
mod lang;
|
||||
mod patch;
|
||||
mod proxy;
|
||||
mod release;
|
||||
mod system_helpers;
|
||||
mod unzip;
|
||||
mod web;
|
||||
|
||||
static WATCH_GAME_PROCESS: Lazy<Mutex<String>> = Lazy::new(|| Mutex::new(String::new()));
|
||||
static WATCH_GRASSCUTTER_PROCESS: Lazy<Mutex<String>> = Lazy::new(|| Mutex::new(String::new()));
|
||||
static GC_PID: std::sync::Mutex<usize> = Mutex::new(696969);
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub static AAGL_THREAD: Lazy<Mutex<Option<JoinHandle<()>>>> = Lazy::new(|| Mutex::new(None));
|
||||
|
||||
fn try_flush() {
|
||||
std::io::stdout().flush().unwrap_or(())
|
||||
}
|
||||
|
||||
async fn parse_args(inp: &Vec<String>) -> Result<Args, ArgsError> {
|
||||
let mut args = Args::new(
|
||||
"Cultivation",
|
||||
"Private server helper program for an Anime Game",
|
||||
);
|
||||
args.flag("h", "help", "Print various CLI args");
|
||||
args.flag("p", "proxy", "Start the proxy server");
|
||||
args.flag("G", "launch-game", "Launch the game");
|
||||
args.flag("o", "other-redirects", "Redirect other certain anime games");
|
||||
args.flag(
|
||||
"A",
|
||||
"no-admin",
|
||||
"Launch without requiring admin permissions",
|
||||
);
|
||||
args.flag(
|
||||
"g",
|
||||
"no-gui",
|
||||
"Run in CLI mode. Requires -A to be passed as well.",
|
||||
);
|
||||
args.flag("s", "server", "Launch the configured GC server");
|
||||
args.flag(
|
||||
"P",
|
||||
"patch",
|
||||
"Patch your game before launching, with whatever your game version needs",
|
||||
);
|
||||
args.flag(
|
||||
"N",
|
||||
"non-elevated-game",
|
||||
"Launch the game without admin permissions",
|
||||
);
|
||||
args.option(
|
||||
"H",
|
||||
"host",
|
||||
"Set host to connect to (eg. 'localhost:443' or 'my.awesomeserver.com:6969)",
|
||||
"SERVER_HOST",
|
||||
getopts::Occur::Optional,
|
||||
None,
|
||||
);
|
||||
args.option(
|
||||
"a",
|
||||
"game-args",
|
||||
"Arguments to pass to the game process, if launching it",
|
||||
r#""-opt-one -opt-two""#,
|
||||
getopts::Occur::Optional,
|
||||
None,
|
||||
);
|
||||
|
||||
args.parse(inp).unwrap();
|
||||
|
||||
let config = config::get_config(String::from("default"));
|
||||
|
||||
if args.value_of("help")? {
|
||||
println!("{}", args.full_usage());
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
// Patch if needed
|
||||
if args.value_of("patch")? {
|
||||
patch::patch_game(false, 0.to_string()).await;
|
||||
}
|
||||
|
||||
if args.value_of("launch-game")? {
|
||||
let game_path = config.game_install_path;
|
||||
let game_args: String = args.value_of("game-args").unwrap_or_default();
|
||||
|
||||
if game_path.is_some() {
|
||||
if args.value_of("non-elevated-game")? {
|
||||
system_helpers::run_un_elevated(game_path.unwrap(), Some(game_args))
|
||||
} else {
|
||||
system_helpers::run_program(game_path.unwrap(), Some(game_args))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if args.value_of("server")? && config.grasscutter_path.is_some() && config.java_path.is_some() {
|
||||
let server_jar = config.grasscutter_path.unwrap();
|
||||
let mut server_path = server_jar.clone();
|
||||
// Strip jar name from path
|
||||
if server_path.contains('/') {
|
||||
// Can never panic because of if
|
||||
let len = server_jar.rfind('/').unwrap();
|
||||
server_path.truncate(len);
|
||||
} else if server_path.contains('\\') {
|
||||
let len = server_jar.rfind('\\').unwrap();
|
||||
server_path.truncate(len);
|
||||
}
|
||||
let java_path = config.java_path.unwrap();
|
||||
|
||||
system_helpers::run_jar(server_jar, server_path.to_string(), java_path);
|
||||
}
|
||||
|
||||
if args.value_of::<String>("host").is_ok() && !args.value_of::<String>("host")?.is_empty() {
|
||||
let host = args.value_of::<String>("host")?;
|
||||
set_proxy_addr(host);
|
||||
}
|
||||
|
||||
if args.value_of("proxy")? {
|
||||
println!("Starting proxy server...");
|
||||
let mut pathbuf = dirs::config_dir().unwrap();
|
||||
pathbuf.push("cultivation");
|
||||
pathbuf.push("ca");
|
||||
|
||||
if args.value_of("other-redirects")? {
|
||||
// proxy::set_redirect_more(); // Unused
|
||||
}
|
||||
|
||||
connect(8035, pathbuf.to_str().unwrap().to_string()).await;
|
||||
}
|
||||
|
||||
Ok(args)
|
||||
}
|
||||
|
||||
pub fn run() {
|
||||
let args: Vec<String> = std::env::args().collect();
|
||||
let parsed_args = block_on(parse_args(&args)).unwrap();
|
||||
#[cfg(target_os = "windows")]
|
||||
if !is_elevated() && !parsed_args.value_of("no-admin")? {
|
||||
println!("===============================================================================");
|
||||
println!("You running as a non-elevated user. Some stuff will almost definitely not work.");
|
||||
println!("===============================================================================");
|
||||
|
||||
reopen_as_admin();
|
||||
}
|
||||
let mut exe_path = std::env::current_exe().unwrap();
|
||||
exe_path.pop();
|
||||
std::env::set_current_dir(&exe_path).unwrap();
|
||||
ctrlc::set_handler(|| {
|
||||
disconnect();
|
||||
block_on(patch::unpatch_game());
|
||||
std::process::exit(0);
|
||||
})
|
||||
.unwrap_or(());
|
||||
if parsed_args.has_value("no-gui") {
|
||||
tauri::Builder::default()
|
||||
.plugin(tauri_plugin_opener::init())
|
||||
.plugin(tauri_plugin_fs::init())
|
||||
.plugin(tauri_plugin_dialog::init())
|
||||
.plugin(tauri_plugin_shell::init())
|
||||
.invoke_handler(tauri::generate_handler![
|
||||
enable_process_watcher,
|
||||
enable_grasscutter_watcher,
|
||||
connect,
|
||||
disconnect,
|
||||
req_get,
|
||||
is_game_running,
|
||||
is_grasscutter_running,
|
||||
restart_grasscutter,
|
||||
get_theme_list,
|
||||
get_profile_list,
|
||||
system_helpers::run_command,
|
||||
system_helpers::run_program,
|
||||
system_helpers::run_program_args,
|
||||
system_helpers::run_program_relative,
|
||||
system_helpers::start_service,
|
||||
system_helpers::service_status,
|
||||
system_helpers::stop_service,
|
||||
system_helpers::run_jar,
|
||||
system_helpers::run_jar_root,
|
||||
system_helpers::open_in_browser,
|
||||
system_helpers::install_location,
|
||||
system_helpers::is_elevated,
|
||||
system_helpers::set_migoto_delay,
|
||||
system_helpers::wipe_registry,
|
||||
system_helpers::get_platform,
|
||||
system_helpers::run_un_elevated,
|
||||
system_helpers::jvm_add_cap,
|
||||
system_helpers::jvm_remove_cap,
|
||||
patch::patch_game,
|
||||
patch::unpatch_game,
|
||||
proxy::set_proxy_addr,
|
||||
proxy::generate_ca_files,
|
||||
release::get_latest_release,
|
||||
unzip::unzip,
|
||||
file_helpers::rename,
|
||||
file_helpers::dir_create,
|
||||
file_helpers::dir_exists,
|
||||
file_helpers::dir_is_empty,
|
||||
file_helpers::dir_delete,
|
||||
file_helpers::copy_file,
|
||||
file_helpers::copy_file_with_new_name,
|
||||
file_helpers::delete_file,
|
||||
file_helpers::are_files_identical,
|
||||
file_helpers::read_file,
|
||||
file_helpers::write_file,
|
||||
file_helpers::does_file_exist,
|
||||
downloader::download_file,
|
||||
downloader::stop_download,
|
||||
lang::get_lang,
|
||||
lang::get_languages,
|
||||
web::valid_url,
|
||||
web::web_get,
|
||||
gamebanana::get_download_links,
|
||||
gamebanana::list_submissions,
|
||||
gamebanana::list_mods
|
||||
])
|
||||
.on_window_event(|_window, event| {
|
||||
if let tauri::WindowEvent::CloseRequested { .. } = event {
|
||||
// Ensure all proxy stuff is handled
|
||||
disconnect();
|
||||
}
|
||||
})
|
||||
.run(tauri::generate_context!())
|
||||
.expect("error while running tauri application");
|
||||
} else {
|
||||
try_flush();
|
||||
println!("Press enter or CTRL-C twice to quit...");
|
||||
std::io::stdin().read_line(&mut String::new()).unwrap();
|
||||
}
|
||||
disconnect();
|
||||
block_on(patch::unpatch_game());
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn is_game_running() -> bool {
|
||||
// Grab the game process name
|
||||
let proc = WATCH_GAME_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
!proc.is_empty()
|
||||
}
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = process;
|
||||
|
||||
window.listen("disable_process_watcher", |_e| {
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
});
|
||||
|
||||
println!("Starting process watcher...");
|
||||
|
||||
thread::spawn(move || {
|
||||
// Initial sleep for 8 seconds, since running 20 different injectors or whatever can take a while
|
||||
std::thread::sleep(std::time::Duration::from_secs(60));
|
||||
|
||||
let mut system = System::new_all();
|
||||
|
||||
loop {
|
||||
// Shorten loop timer to avoid user closing Cultivation before unpatching/proxy disconnecting
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
|
||||
// Refresh system info
|
||||
system.refresh_all();
|
||||
|
||||
// Grab the game process name
|
||||
let proc = WATCH_GAME_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
if !proc.is_empty() {
|
||||
let mut proc_with_name = system.processes_by_exact_name(&proc);
|
||||
let exists = proc_with_name.next().is_some();
|
||||
|
||||
// If the game process closes, disable the proxy.
|
||||
if !exists {
|
||||
println!("Game closed");
|
||||
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
disconnect();
|
||||
|
||||
window.emit("game_closed", &()).unwrap();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
// The library takes care of it
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {
|
||||
drop(process);
|
||||
thread::spawn(move || {
|
||||
let end_time = Instant::now() + Duration::from_secs(90);
|
||||
let game_thread = loop {
|
||||
let mut lock = AAGL_THREAD.lock().unwrap();
|
||||
if lock.is_some() {
|
||||
break lock.take().unwrap();
|
||||
}
|
||||
drop(lock);
|
||||
if end_time < Instant::now() {
|
||||
// If more than 60 seconds pass something has gone wrong
|
||||
println!("Waiting for game thread timed out");
|
||||
return;
|
||||
}
|
||||
// Otherwhise wait in order to not use too many CPU cycles
|
||||
sleep(Duration::from_millis(128));
|
||||
};
|
||||
game_thread.join().unwrap();
|
||||
println!("Game closed");
|
||||
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
disconnect();
|
||||
|
||||
window.emit("game_closed", &()).unwrap();
|
||||
});
|
||||
}
|
||||
|
||||
#[cfg(target_os = "macos")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {}
|
||||
|
||||
#[tauri::command]
|
||||
fn is_grasscutter_running() -> bool {
|
||||
// Grab the grasscutter process name
|
||||
let proc = WATCH_GRASSCUTTER_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
!proc.is_empty()
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
fn restart_grasscutter(window: tauri::Window) -> bool {
|
||||
let pid: usize = *GC_PID.lock().unwrap();
|
||||
let system = System::new_all();
|
||||
// Get the process
|
||||
if let Some(process) = system.process(Pid::from(pid)) {
|
||||
// Kill it
|
||||
if process.kill() {
|
||||
// Also kill the cmd it was open in
|
||||
if let Some(parent) = system.process(process.parent().unwrap()) {
|
||||
parent.kill();
|
||||
}
|
||||
for process_gc in system.processes_by_name("java") {
|
||||
if process_gc.cmd().last().unwrap().contains("grasscutter") {
|
||||
process_gc.kill();
|
||||
}
|
||||
}
|
||||
window.emit("disable_grasscutter_watcher", &()).unwrap();
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
// Start again
|
||||
window.emit("start_grasscutter", &()).unwrap();
|
||||
true
|
||||
} else {
|
||||
false
|
||||
}
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(unix)]
|
||||
#[tauri::command]
|
||||
fn restart_grasscutter(_window: tauri::Window) {
|
||||
// Placeholder text for imports
|
||||
let s = System::new();
|
||||
if let Some(process) = s.process(Pid::from(1337)) {
|
||||
println!("{:?}", process.name());
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn enable_grasscutter_watcher(window: tauri::Window, process: String) {
|
||||
let grasscutter_name = process.clone();
|
||||
let mut gc_pid = Pid::from(696969);
|
||||
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = process;
|
||||
|
||||
window.listen("disable_grasscutter_watcher", |_e| {
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = "".to_string();
|
||||
});
|
||||
|
||||
println!("Starting grasscutter watcher...");
|
||||
|
||||
thread::spawn(move || {
|
||||
// Initial sleep for 1 second while Grasscutter opens
|
||||
std::thread::sleep(std::time::Duration::from_secs(3));
|
||||
|
||||
let mut system = System::new_all();
|
||||
|
||||
for process_gc in system.processes_by_name(OsStr::new("java")) {
|
||||
if process_gc.cmd().last().unwrap().to_str().unwrap().contains(&grasscutter_name) {
|
||||
gc_pid = process_gc.pid();
|
||||
*GC_PID.lock().unwrap() = gc_pid.into();
|
||||
window
|
||||
.emit("grasscutter_started", gc_pid.to_string())
|
||||
.unwrap();
|
||||
}
|
||||
}
|
||||
|
||||
loop {
|
||||
// Shorten loop timer to avoid user closing Cultivation before automatic stuff
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
|
||||
// Refresh system info
|
||||
system.refresh_all();
|
||||
|
||||
// Grab the grasscutter process name
|
||||
let proc = WATCH_GRASSCUTTER_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
if !proc.is_empty() {
|
||||
let mut exists = true;
|
||||
|
||||
if system.process(gc_pid).is_none() {
|
||||
exists = false;
|
||||
}
|
||||
|
||||
// If the grasscutter process closes.
|
||||
if !exists {
|
||||
println!("Grasscutter closed");
|
||||
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = "".to_string();
|
||||
|
||||
window.emit("grasscutter_closed", &()).unwrap();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn connect(port: u16, certificate_path: String) {
|
||||
// Log message to console.
|
||||
println!("Connecting to proxy...");
|
||||
|
||||
// Change proxy settings.
|
||||
proxy::connect_to_proxy(port);
|
||||
|
||||
// Create and start a proxy.
|
||||
proxy::create_proxy(port, certificate_path).await;
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn disconnect() {
|
||||
// Log message to console.
|
||||
println!("Disconnecting from proxy...");
|
||||
|
||||
// Change proxy settings.
|
||||
proxy::disconnect_from_proxy();
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn req_get(url: String) -> String {
|
||||
// Send a GET request to the specified URL and send the response body back to the client.
|
||||
web::query(&url.to_string()).await
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn get_theme_list(data_dir: String) -> Vec<HashMap<String, String>> {
|
||||
let theme_loc = format!("{}/themes", data_dir);
|
||||
|
||||
// Ensure folder exists
|
||||
if !std::path::Path::new(&theme_loc).exists() {
|
||||
std::fs::create_dir_all(&theme_loc).unwrap();
|
||||
}
|
||||
|
||||
// Read each index.json folder in each theme folder
|
||||
let mut themes = Vec::new();
|
||||
|
||||
for entry in std::fs::read_dir(&theme_loc).unwrap() {
|
||||
let entry = entry.unwrap();
|
||||
let path = entry.path();
|
||||
|
||||
if path.is_dir() {
|
||||
let index_path = format!("{}/index.json", path.to_str().unwrap());
|
||||
|
||||
if std::path::Path::new(&index_path).exists() {
|
||||
let theme_json = std::fs::read_to_string(&index_path).unwrap();
|
||||
|
||||
let mut map = HashMap::new();
|
||||
|
||||
map.insert("json".to_string(), theme_json);
|
||||
map.insert("path".to_string(), path.to_str().unwrap().to_string());
|
||||
|
||||
// Push key-value pair containing "json" and "path"
|
||||
themes.push(map);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
themes
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn get_profile_list(data_dir: String) -> Vec<String> {
|
||||
let profile_loc = format!("{}/profiles", data_dir);
|
||||
|
||||
// Ensure folder exists
|
||||
if !std::path::Path::new(&profile_loc).exists() {
|
||||
std::fs::create_dir_all(&profile_loc).unwrap();
|
||||
}
|
||||
|
||||
let mut p_list = Vec::new();
|
||||
for entry in std::fs::read_dir(&profile_loc).unwrap() {
|
||||
p_list.push(entry.unwrap().file_name().into_string().unwrap());
|
||||
}
|
||||
|
||||
p_list
|
||||
}
|
||||
@@ -1,556 +1,6 @@
|
||||
#![cfg_attr(
|
||||
all(not(debug_assertions), target_os = "windows"),
|
||||
windows_subsystem = "windows"
|
||||
)]
|
||||
// Prevents additional console window on Windows in release, DO NOT REMOVE!!
|
||||
#![cfg_attr(not(debug_assertions), windows_subsystem = "windows")]
|
||||
|
||||
use args::{Args, ArgsError};
|
||||
use file_helpers::dir_exists;
|
||||
|
||||
use once_cell::sync::Lazy;
|
||||
use proxy::set_proxy_addr;
|
||||
use std::fs;
|
||||
use std::io::Write;
|
||||
use std::{collections::HashMap, sync::Mutex};
|
||||
use tauri::api::path::data_dir;
|
||||
use tauri::async_runtime::block_on;
|
||||
|
||||
use std::thread;
|
||||
use sysinfo::{Pid, ProcessExt, System, SystemExt};
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
use crate::admin::reopen_as_admin;
|
||||
#[cfg(target_os = "windows")]
|
||||
use system_helpers::is_elevated;
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
use std::{
|
||||
thread::{sleep, JoinHandle},
|
||||
time::{Duration, Instant},
|
||||
};
|
||||
|
||||
mod admin;
|
||||
mod config;
|
||||
mod downloader;
|
||||
mod file_helpers;
|
||||
mod gamebanana;
|
||||
mod lang;
|
||||
mod patch;
|
||||
mod proxy;
|
||||
mod release;
|
||||
mod system_helpers;
|
||||
mod unzip;
|
||||
mod web;
|
||||
|
||||
static WATCH_GAME_PROCESS: Lazy<Mutex<String>> = Lazy::new(|| Mutex::new(String::new()));
|
||||
static WATCH_GRASSCUTTER_PROCESS: Lazy<Mutex<String>> = Lazy::new(|| Mutex::new(String::new()));
|
||||
static GC_PID: std::sync::Mutex<usize> = Mutex::new(696969);
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub static AAGL_THREAD: Lazy<Mutex<Option<JoinHandle<()>>>> = Lazy::new(|| Mutex::new(None));
|
||||
|
||||
fn try_flush() {
|
||||
std::io::stdout().flush().unwrap_or(())
|
||||
}
|
||||
|
||||
async fn parse_args(inp: &Vec<String>) -> Result<Args, ArgsError> {
|
||||
let mut args = Args::new(
|
||||
"Cultivation",
|
||||
"Private server helper program for an Anime Game",
|
||||
);
|
||||
args.flag("h", "help", "Print various CLI args");
|
||||
args.flag("p", "proxy", "Start the proxy server");
|
||||
args.flag("G", "launch-game", "Launch the game");
|
||||
args.flag("o", "other-redirects", "Redirect other certain anime games");
|
||||
args.flag(
|
||||
"A",
|
||||
"no-admin",
|
||||
"Launch without requiring admin permissions",
|
||||
);
|
||||
args.flag(
|
||||
"g",
|
||||
"no-gui",
|
||||
"Run in CLI mode. Requires -A to be passed as well.",
|
||||
);
|
||||
args.flag("s", "server", "Launch the configured GC server");
|
||||
args.flag(
|
||||
"P",
|
||||
"patch",
|
||||
"Patch your game before launching, with whatever your game version needs",
|
||||
);
|
||||
args.flag(
|
||||
"N",
|
||||
"non-elevated-game",
|
||||
"Launch the game without admin permissions",
|
||||
);
|
||||
args.option(
|
||||
"H",
|
||||
"host",
|
||||
"Set host to connect to (eg. 'localhost:443' or 'my.awesomeserver.com:6969)",
|
||||
"SERVER_HOST",
|
||||
getopts::Occur::Optional,
|
||||
None,
|
||||
);
|
||||
args.option(
|
||||
"a",
|
||||
"game-args",
|
||||
"Arguments to pass to the game process, if launching it",
|
||||
r#""-opt-one -opt-two""#,
|
||||
getopts::Occur::Optional,
|
||||
None,
|
||||
);
|
||||
|
||||
args.parse(inp).unwrap();
|
||||
|
||||
let config = config::get_config(String::from("default"));
|
||||
|
||||
if args.value_of("help")? {
|
||||
println!("{}", args.full_usage());
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
// Patch if needed
|
||||
if args.value_of("patch")? {
|
||||
patch::patch_game(false, 0.to_string()).await;
|
||||
}
|
||||
|
||||
if args.value_of("launch-game")? {
|
||||
let game_path = config.game_install_path;
|
||||
let game_args: String = args.value_of("game-args").unwrap_or_default();
|
||||
|
||||
if game_path.is_some() {
|
||||
if args.value_of("non-elevated-game")? {
|
||||
system_helpers::run_un_elevated(game_path.unwrap(), Some(game_args))
|
||||
} else {
|
||||
system_helpers::run_program(game_path.unwrap(), Some(game_args))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if args.value_of("server")? && config.grasscutter_path.is_some() && config.java_path.is_some() {
|
||||
let server_jar = config.grasscutter_path.unwrap();
|
||||
let mut server_path = server_jar.clone();
|
||||
// Strip jar name from path
|
||||
if server_path.contains('/') {
|
||||
// Can never panic because of if
|
||||
let len = server_jar.rfind('/').unwrap();
|
||||
server_path.truncate(len);
|
||||
} else if server_path.contains('\\') {
|
||||
let len = server_jar.rfind('\\').unwrap();
|
||||
server_path.truncate(len);
|
||||
}
|
||||
let java_path = config.java_path.unwrap();
|
||||
|
||||
system_helpers::run_jar(server_jar, server_path.to_string(), java_path);
|
||||
}
|
||||
|
||||
if args.value_of::<String>("host").is_ok() && !args.value_of::<String>("host")?.is_empty() {
|
||||
let host = args.value_of::<String>("host")?;
|
||||
set_proxy_addr(host);
|
||||
}
|
||||
|
||||
if args.value_of("proxy")? {
|
||||
println!("Starting proxy server...");
|
||||
let mut pathbuf = tauri::api::path::data_dir().unwrap();
|
||||
pathbuf.push("cultivation");
|
||||
pathbuf.push("ca");
|
||||
|
||||
if args.value_of("other-redirects")? {
|
||||
// proxy::set_redirect_more(); // Unused
|
||||
}
|
||||
|
||||
connect(8035, pathbuf.to_str().unwrap().to_string()).await;
|
||||
}
|
||||
|
||||
Ok(args)
|
||||
}
|
||||
|
||||
fn main() -> Result<(), ArgsError> {
|
||||
let args: Vec<String> = std::env::args().collect();
|
||||
let parsed_args = block_on(parse_args(&args)).unwrap();
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
if !is_elevated() && !parsed_args.value_of("no-admin")? {
|
||||
println!("===============================================================================");
|
||||
println!("You running as a non-elevated user. Some stuff will almost definitely not work.");
|
||||
println!("===============================================================================");
|
||||
|
||||
reopen_as_admin();
|
||||
}
|
||||
|
||||
// Setup datadir/cultivation just in case something went funky and it wasn't made
|
||||
if !dir_exists(data_dir().unwrap().join("cultivation").to_str().unwrap()) {
|
||||
fs::create_dir_all(data_dir().unwrap().join("cultivation")).unwrap();
|
||||
}
|
||||
|
||||
// Always set CWD to the location of the executable.
|
||||
let mut exe_path = std::env::current_exe().unwrap();
|
||||
exe_path.pop();
|
||||
std::env::set_current_dir(&exe_path).unwrap();
|
||||
|
||||
// For disabled GUI
|
||||
ctrlc::set_handler(|| {
|
||||
disconnect();
|
||||
block_on(patch::unpatch_game());
|
||||
std::process::exit(0);
|
||||
})
|
||||
.unwrap_or(());
|
||||
|
||||
if !parsed_args.value_of("no-gui")? {
|
||||
tauri::Builder::default()
|
||||
.invoke_handler(tauri::generate_handler![
|
||||
enable_process_watcher,
|
||||
enable_grasscutter_watcher,
|
||||
connect,
|
||||
disconnect,
|
||||
req_get,
|
||||
is_game_running,
|
||||
is_grasscutter_running,
|
||||
restart_grasscutter,
|
||||
get_theme_list,
|
||||
get_profile_list,
|
||||
system_helpers::run_command,
|
||||
system_helpers::run_program,
|
||||
system_helpers::run_program_args,
|
||||
system_helpers::run_program_relative,
|
||||
system_helpers::start_service,
|
||||
system_helpers::service_status,
|
||||
system_helpers::stop_service,
|
||||
system_helpers::run_jar,
|
||||
system_helpers::run_jar_root,
|
||||
system_helpers::open_in_browser,
|
||||
system_helpers::install_location,
|
||||
system_helpers::is_elevated,
|
||||
system_helpers::set_migoto_delay,
|
||||
system_helpers::wipe_registry,
|
||||
system_helpers::get_platform,
|
||||
system_helpers::run_un_elevated,
|
||||
system_helpers::jvm_add_cap,
|
||||
system_helpers::jvm_remove_cap,
|
||||
patch::patch_game,
|
||||
patch::unpatch_game,
|
||||
proxy::set_proxy_addr,
|
||||
proxy::generate_ca_files,
|
||||
release::get_latest_release,
|
||||
unzip::unzip,
|
||||
file_helpers::rename,
|
||||
file_helpers::dir_create,
|
||||
file_helpers::dir_exists,
|
||||
file_helpers::dir_is_empty,
|
||||
file_helpers::dir_delete,
|
||||
file_helpers::copy_file,
|
||||
file_helpers::copy_file_with_new_name,
|
||||
file_helpers::delete_file,
|
||||
file_helpers::are_files_identical,
|
||||
file_helpers::read_file,
|
||||
file_helpers::write_file,
|
||||
file_helpers::does_file_exist,
|
||||
downloader::download_file,
|
||||
downloader::stop_download,
|
||||
lang::get_lang,
|
||||
lang::get_languages,
|
||||
web::valid_url,
|
||||
web::web_get,
|
||||
gamebanana::get_download_links,
|
||||
gamebanana::list_submissions,
|
||||
gamebanana::list_mods
|
||||
])
|
||||
.on_window_event(|event| {
|
||||
if let tauri::WindowEvent::CloseRequested { .. } = event.event() {
|
||||
// Ensure all proxy stuff is handled
|
||||
disconnect();
|
||||
}
|
||||
})
|
||||
.run(tauri::generate_context!())
|
||||
.expect("error while running tauri application");
|
||||
} else {
|
||||
try_flush();
|
||||
println!("Press enter or CTRL-C twice to quit...");
|
||||
std::io::stdin().read_line(&mut String::new()).unwrap();
|
||||
}
|
||||
|
||||
// Always disconnect upon closing the program
|
||||
disconnect();
|
||||
|
||||
// Always unpatch game upon closing the program
|
||||
block_on(patch::unpatch_game());
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn is_game_running() -> bool {
|
||||
// Grab the game process name
|
||||
let proc = WATCH_GAME_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
!proc.is_empty()
|
||||
}
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = process;
|
||||
|
||||
window.listen("disable_process_watcher", |_e| {
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
});
|
||||
|
||||
println!("Starting process watcher...");
|
||||
|
||||
thread::spawn(move || {
|
||||
// Initial sleep for 8 seconds, since running 20 different injectors or whatever can take a while
|
||||
std::thread::sleep(std::time::Duration::from_secs(60));
|
||||
|
||||
let mut system = System::new_all();
|
||||
|
||||
loop {
|
||||
// Shorten loop timer to avoid user closing Cultivation before unpatching/proxy disconnecting
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
|
||||
// Refresh system info
|
||||
system.refresh_all();
|
||||
|
||||
// Grab the game process name
|
||||
let proc = WATCH_GAME_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
if !proc.is_empty() {
|
||||
let mut proc_with_name = system.processes_by_exact_name(&proc);
|
||||
let exists = proc_with_name.next().is_some();
|
||||
|
||||
// If the game process closes, disable the proxy.
|
||||
if !exists {
|
||||
println!("Game closed");
|
||||
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
disconnect();
|
||||
|
||||
window.emit("game_closed", &()).unwrap();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
// The library takes care of it
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {
|
||||
drop(process);
|
||||
thread::spawn(move || {
|
||||
let end_time = Instant::now() + Duration::from_secs(90);
|
||||
let game_thread = loop {
|
||||
let mut lock = AAGL_THREAD.lock().unwrap();
|
||||
if lock.is_some() {
|
||||
break lock.take().unwrap();
|
||||
}
|
||||
drop(lock);
|
||||
if end_time < Instant::now() {
|
||||
// If more than 60 seconds pass something has gone wrong
|
||||
println!("Waiting for game thread timed out");
|
||||
return;
|
||||
}
|
||||
// Otherwhise wait in order to not use too many CPU cycles
|
||||
sleep(Duration::from_millis(128));
|
||||
};
|
||||
game_thread.join().unwrap();
|
||||
println!("Game closed");
|
||||
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
disconnect();
|
||||
|
||||
window.emit("game_closed", &()).unwrap();
|
||||
});
|
||||
}
|
||||
|
||||
#[cfg(target_os = "macos")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {}
|
||||
|
||||
#[tauri::command]
|
||||
fn is_grasscutter_running() -> bool {
|
||||
// Grab the grasscutter process name
|
||||
let proc = WATCH_GRASSCUTTER_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
!proc.is_empty()
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
fn restart_grasscutter(window: tauri::Window) -> bool {
|
||||
let pid: usize = *GC_PID.lock().unwrap();
|
||||
let system = System::new_all();
|
||||
// Get the process
|
||||
if let Some(process) = system.process(Pid::from(pid)) {
|
||||
// Kill it
|
||||
if process.kill() {
|
||||
// Also kill the cmd it was open in
|
||||
if let Some(parent) = system.process(process.parent().unwrap()) {
|
||||
parent.kill();
|
||||
}
|
||||
for process_gc in system.processes_by_name("java") {
|
||||
if process_gc.cmd().last().unwrap().contains("grasscutter") {
|
||||
process_gc.kill();
|
||||
}
|
||||
}
|
||||
window.emit("disable_grasscutter_watcher", &()).unwrap();
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
// Start again
|
||||
window.emit("start_grasscutter", &()).unwrap();
|
||||
true
|
||||
} else {
|
||||
false
|
||||
}
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(unix)]
|
||||
#[tauri::command]
|
||||
fn restart_grasscutter(_window: tauri::Window) {
|
||||
// Placeholder text for imports
|
||||
let s = System::new();
|
||||
if let Some(process) = s.process(Pid::from(1337)) {
|
||||
println!("{}", process.name());
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn enable_grasscutter_watcher(window: tauri::Window, process: String) {
|
||||
let grasscutter_name = process.clone();
|
||||
let mut gc_pid = Pid::from(696969);
|
||||
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = process;
|
||||
|
||||
window.listen("disable_grasscutter_watcher", |_e| {
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = "".to_string();
|
||||
});
|
||||
|
||||
println!("Starting grasscutter watcher...");
|
||||
|
||||
thread::spawn(move || {
|
||||
// Initial sleep for 1 second while Grasscutter opens
|
||||
std::thread::sleep(std::time::Duration::from_secs(3));
|
||||
|
||||
let mut system = System::new_all();
|
||||
|
||||
for process_gc in system.processes_by_name("java") {
|
||||
if process_gc.cmd().last().unwrap().contains(&grasscutter_name) {
|
||||
gc_pid = process_gc.pid();
|
||||
*GC_PID.lock().unwrap() = gc_pid.into();
|
||||
window
|
||||
.emit("grasscutter_started", gc_pid.to_string())
|
||||
.unwrap();
|
||||
}
|
||||
}
|
||||
|
||||
loop {
|
||||
// Shorten loop timer to avoid user closing Cultivation before automatic stuff
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
|
||||
// Refresh system info
|
||||
system.refresh_all();
|
||||
|
||||
// Grab the grasscutter process name
|
||||
let proc = WATCH_GRASSCUTTER_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
if !proc.is_empty() {
|
||||
let mut exists = true;
|
||||
|
||||
if system.process(gc_pid).is_none() {
|
||||
exists = false;
|
||||
}
|
||||
|
||||
// If the grasscutter process closes.
|
||||
if !exists {
|
||||
println!("Grasscutter closed");
|
||||
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = "".to_string();
|
||||
|
||||
window.emit("grasscutter_closed", &()).unwrap();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn connect(port: u16, certificate_path: String) {
|
||||
// Log message to console.
|
||||
println!("Connecting to proxy...");
|
||||
|
||||
// Change proxy settings.
|
||||
proxy::connect_to_proxy(port);
|
||||
|
||||
// Create and start a proxy.
|
||||
proxy::create_proxy(port, certificate_path).await;
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn disconnect() {
|
||||
// Log message to console.
|
||||
println!("Disconnecting from proxy...");
|
||||
|
||||
// Change proxy settings.
|
||||
proxy::disconnect_from_proxy();
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn req_get(url: String) -> String {
|
||||
// Send a GET request to the specified URL and send the response body back to the client.
|
||||
web::query(&url.to_string()).await
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn get_theme_list(data_dir: String) -> Vec<HashMap<String, String>> {
|
||||
let theme_loc = format!("{}/themes", data_dir);
|
||||
|
||||
// Ensure folder exists
|
||||
if !std::path::Path::new(&theme_loc).exists() {
|
||||
std::fs::create_dir_all(&theme_loc).unwrap();
|
||||
}
|
||||
|
||||
// Read each index.json folder in each theme folder
|
||||
let mut themes = Vec::new();
|
||||
|
||||
for entry in std::fs::read_dir(&theme_loc).unwrap() {
|
||||
let entry = entry.unwrap();
|
||||
let path = entry.path();
|
||||
|
||||
if path.is_dir() {
|
||||
let index_path = format!("{}/index.json", path.to_str().unwrap());
|
||||
|
||||
if std::path::Path::new(&index_path).exists() {
|
||||
let theme_json = std::fs::read_to_string(&index_path).unwrap();
|
||||
|
||||
let mut map = HashMap::new();
|
||||
|
||||
map.insert("json".to_string(), theme_json);
|
||||
map.insert("path".to_string(), path.to_str().unwrap().to_string());
|
||||
|
||||
// Push key-value pair containing "json" and "path"
|
||||
themes.push(map);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
themes
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn get_profile_list(data_dir: String) -> Vec<String> {
|
||||
let profile_loc = format!("{}/profiles", data_dir);
|
||||
|
||||
// Ensure folder exists
|
||||
if !std::path::Path::new(&profile_loc).exists() {
|
||||
std::fs::create_dir_all(&profile_loc).unwrap();
|
||||
}
|
||||
|
||||
let mut p_list = Vec::new();
|
||||
for entry in std::fs::read_dir(&profile_loc).unwrap() {
|
||||
p_list.push(entry.unwrap().file_name().into_string().unwrap());
|
||||
}
|
||||
|
||||
p_list
|
||||
fn main() {
|
||||
cultivation_lib::run()
|
||||
}
|
||||
|
||||
@@ -5,7 +5,6 @@
|
||||
|
||||
use once_cell::sync::Lazy;
|
||||
use std::{path::PathBuf, str::FromStr, sync::Mutex};
|
||||
|
||||
use hudsucker::{
|
||||
async_trait::async_trait,
|
||||
certificate_authority::RcgenAuthority,
|
||||
@@ -19,7 +18,6 @@ use std::net::SocketAddr;
|
||||
use std::path::Path;
|
||||
|
||||
use rustls_pemfile as pemfile;
|
||||
use tauri::{api::path::data_dir, http::Uri};
|
||||
|
||||
#[cfg(windows)]
|
||||
use registry::{Data, Hive, Security};
|
||||
@@ -59,7 +57,7 @@ impl HttpHandler for ProxyHandler {
|
||||
async fn handle_request(
|
||||
&mut self,
|
||||
_ctx: &HttpContext,
|
||||
mut req: Request<Body>,
|
||||
mut req: Request<Body>
|
||||
) -> RequestOrResponse {
|
||||
let uri = req.uri().to_string();
|
||||
|
||||
@@ -85,11 +83,9 @@ impl HttpHandler for ProxyHandler {
|
||||
} else {
|
||||
let uri_path_and_query = req.uri().path_and_query().unwrap().as_str();
|
||||
// Create new URI.
|
||||
let new_uri =
|
||||
Uri::from_str(format!("{}{}", SERVER.lock().unwrap(), uri_path_and_query).as_str())
|
||||
*req.uri_mut() =
|
||||
hudsucker::hyper::Uri::from_str(format!("{}{}", SERVER.lock().unwrap(), uri_path_and_query).as_str())
|
||||
.unwrap();
|
||||
// Set request URI to the new one.
|
||||
*req.uri_mut() = new_uri;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -132,7 +128,7 @@ pub async fn create_proxy(proxy_port: u16, certificate_path: String) {
|
||||
Ok(b) => b,
|
||||
Err(e) => {
|
||||
println!("Encountered {}. Regenerating CA cert and retrying...", e);
|
||||
generate_ca_files(&data_dir().unwrap().join("cultivation"));
|
||||
generate_ca_files(&dirs::config_dir().unwrap().join("cultivation"));
|
||||
|
||||
fs::read(&pk_path).expect("Could not read private key")
|
||||
}
|
||||
@@ -143,7 +139,7 @@ pub async fn create_proxy(proxy_port: u16, certificate_path: String) {
|
||||
Ok(b) => b,
|
||||
Err(e) => {
|
||||
println!("Encountered {}. Regenerating CA cert and retrying...", e);
|
||||
generate_ca_files(&data_dir().unwrap().join("cultivation"));
|
||||
generate_ca_files(&dirs::config_dir().unwrap().join("cultivation"));
|
||||
|
||||
fs::read(&ca_path).expect("Could not read certificate")
|
||||
}
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
use ini::Ini;
|
||||
use std::path::PathBuf;
|
||||
use std::process::Command;
|
||||
|
||||
@@ -18,6 +17,7 @@ use anime_launcher_sdk::{
|
||||
config::ConfigExt, genshin::config::Config, genshin::game, genshin::states::LauncherState,
|
||||
wincompatlib::prelude::*,
|
||||
};
|
||||
use ini::Ini;
|
||||
#[cfg(target_os = "linux")]
|
||||
use std::{path::Path, process::Stdio, thread};
|
||||
#[cfg(target_os = "linux")]
|
||||
@@ -296,11 +296,7 @@ fn aagl_wine_run<P: AsRef<Path>>(path: P, args: Option<String>) -> Command {
|
||||
.into_iter()
|
||||
.map(|(k, v)| (k.to_string(), v.to_string()))
|
||||
.collect();
|
||||
use anime_launcher_sdk::components::wine::UnifiedWine::*;
|
||||
let wined = match wine_run {
|
||||
Default(wine) => wine,
|
||||
Proton(proton) => proton.wine().clone(),
|
||||
};
|
||||
let wined = wine_run;
|
||||
let mut cmd = Command::new(&wined.binary);
|
||||
cmd.arg(path.as_ref()).envs(wined.get_envs()).envs(env);
|
||||
if let Some(args) = args {
|
||||
@@ -426,7 +422,7 @@ pub fn set_migoto_delay(migoto_path: String) -> bool {
|
||||
conf.with_section(Some("Loader")).set("delay", "20");
|
||||
conf
|
||||
.with_section(Some("Include"))
|
||||
.set("include", "ShaderFixes\\help.ini");
|
||||
.set("include", "ShaderFixes/help.ini");
|
||||
|
||||
// Write file
|
||||
match conf.write_to_file_opt(
|
||||
@@ -434,6 +430,7 @@ pub fn set_migoto_delay(migoto_path: String) -> bool {
|
||||
ini::WriteOption {
|
||||
escape_policy: (ini::EscapePolicy::Nothing),
|
||||
line_separator: (ini::LineSeparator::SystemDefault),
|
||||
kv_separator: "=",
|
||||
},
|
||||
) {
|
||||
Ok(_) => {
|
||||
|
||||
@@ -1,7 +1,9 @@
|
||||
use std::fs::{read_dir, File};
|
||||
use std::path;
|
||||
use std::path::{self, PathBuf};
|
||||
use std::thread;
|
||||
use unrar::archive::Archive;
|
||||
use tauri::Emitter;
|
||||
use unrar::Archive;
|
||||
use simple_zip::zip::Decompress;
|
||||
|
||||
#[tauri::command]
|
||||
pub fn unzip(
|
||||
@@ -70,22 +72,22 @@ pub fn unzip(
|
||||
if zipfile.ends_with(".rar") {
|
||||
success = extract_rar(&zipfile, &f, &full_path, top_level.unwrap_or(true));
|
||||
|
||||
let archive = Archive::new(zipfile.clone());
|
||||
name = archive.list().unwrap().next().unwrap().unwrap().filename;
|
||||
let archive = Archive::new(&zipfile);
|
||||
name = archive.open_for_listing().unwrap().next().unwrap().unwrap().filename;
|
||||
} else if zipfile.ends_with(".7z") {
|
||||
success = extract_7z(&zipfile, &f, &full_path, top_level.unwrap_or(true));
|
||||
success = Ok(extract_7z(&zipfile, &f, &full_path, top_level.unwrap_or(true)));
|
||||
|
||||
name = String::from("banana");
|
||||
name = PathBuf::from("banana");
|
||||
} else {
|
||||
success = extract_zip(&zipfile, &f, &full_path, top_level.unwrap_or(true));
|
||||
success = Ok(extract_zip(&full_path));
|
||||
|
||||
// Get the name of the inenr file in the zip file
|
||||
let mut zip = zip::ZipArchive::new(&f).unwrap();
|
||||
let file = zip.by_index(0).unwrap();
|
||||
name = file.name().to_string();
|
||||
name = PathBuf::from(file.name());
|
||||
}
|
||||
|
||||
if !success {
|
||||
if success.unwrap_or(false) {
|
||||
let mut res_hash = std::collections::HashMap::new();
|
||||
|
||||
res_hash.insert("path".to_string(), zipfile.to_string());
|
||||
@@ -94,9 +96,9 @@ pub fn unzip(
|
||||
}
|
||||
|
||||
// If the contents is a jar file, emit that we have extracted a new jar file
|
||||
if name.ends_with(".jar") {
|
||||
if name.to_str().unwrap().ends_with(".jar") {
|
||||
window
|
||||
.emit("jar_extracted", destpath.to_string() + name.as_str())
|
||||
.emit("jar_extracted", destpath.to_string() + name.to_str().unwrap())
|
||||
.unwrap();
|
||||
}
|
||||
|
||||
@@ -150,44 +152,25 @@ pub fn unzip(
|
||||
});
|
||||
}
|
||||
|
||||
fn extract_rar(rarfile: &str, _f: &File, full_path: &path::Path, _top_level: bool) -> bool {
|
||||
let archive = Archive::new(rarfile.to_string());
|
||||
fn extract_rar(rarfile: &str, _f: &File, full_path: &path::Path, _top_level: bool) -> Result<bool, Box<dyn std::error::Error>> {
|
||||
let archive = Archive::new(&rarfile);
|
||||
|
||||
let mut open_archive = archive
|
||||
.extract_to(full_path.to_str().unwrap().to_string())
|
||||
.unwrap();
|
||||
|
||||
match open_archive.process() {
|
||||
Ok(_) => {
|
||||
println!(
|
||||
"Extracted rar file to: {}",
|
||||
full_path.to_str().unwrap_or("Error")
|
||||
);
|
||||
|
||||
true
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Failed to extract rar file: {}", e);
|
||||
false
|
||||
.open_for_processing().unwrap();
|
||||
while let Some(header) = open_archive.read_header()? {
|
||||
open_archive = if header.entry().is_directory() || header.entry().is_file() {
|
||||
header.extract_to(full_path.to_str().unwrap().to_string())?
|
||||
} else {
|
||||
header.skip()?
|
||||
}
|
||||
|
||||
}
|
||||
Ok(true)
|
||||
}
|
||||
|
||||
fn extract_zip(_zipfile: &str, f: &File, full_path: &path::Path, top_level: bool) -> bool {
|
||||
match zip_extract::extract(f, full_path, top_level) {
|
||||
Ok(_) => {
|
||||
println!(
|
||||
"Extracted zip file to: {}",
|
||||
full_path.to_str().unwrap_or("Error")
|
||||
);
|
||||
|
||||
true
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Failed to extract zip file: {}", e);
|
||||
false
|
||||
}
|
||||
}
|
||||
fn extract_zip(full_path: &path::Path) -> bool {
|
||||
Decompress::local_buffer(full_path);
|
||||
true
|
||||
}
|
||||
|
||||
fn extract_7z(sevenzfile: &str, _f: &File, full_path: &path::Path, _top_level: bool) -> bool {
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
use http::header;
|
||||
use tauri::http::header;
|
||||
use once_cell::sync::Lazy;
|
||||
use reqwest::header::{CONTENT_TYPE, USER_AGENT};
|
||||
static CLIENT: Lazy<reqwest::Client> = Lazy::new(|| {
|
||||
|
||||
@@ -1,80 +1,36 @@
|
||||
{
|
||||
"$schema": "..\\node_modules/@tauri-apps/cli\\schema.json",
|
||||
"$schema": "https://schema.tauri.app/config/2",
|
||||
"productName": "cultivation",
|
||||
"version": "2.0.0",
|
||||
"identifier": "io.grasscutter.cultivation",
|
||||
"build": {
|
||||
"beforeDevCommand": "yarn start",
|
||||
"devPath": "http://localhost:3000",
|
||||
"distDir": "../build"
|
||||
"beforeDevCommand": "yarn dev",
|
||||
"devUrl": "http://localhost:1420",
|
||||
"beforeBuildCommand": "yarn build",
|
||||
"frontendDist": "../dist"
|
||||
},
|
||||
"package": {
|
||||
"productName": "Cultivation",
|
||||
"version": "1.7.2"
|
||||
},
|
||||
"tauri": {
|
||||
"allowlist": {
|
||||
"fs": {
|
||||
"scope": ["$DATA", "$DATA/cultivation", "$DATA/cultivation/**"]
|
||||
},
|
||||
"protocol": {
|
||||
"all": true,
|
||||
"asset": true,
|
||||
"assetScope": ["$DATA", "$DATA/cultivation", "$DATA/cultivation/**"]
|
||||
},
|
||||
"all": true
|
||||
},
|
||||
"bundle": {
|
||||
"active": true,
|
||||
"category": "Game",
|
||||
"copyright": "",
|
||||
"deb": {
|
||||
"depends": []
|
||||
},
|
||||
"externalBin": [],
|
||||
"icon": ["icons/32x32.png", "icons/128x128.png", "icons/128x128@2x.png", "icons/icon.icns", "icons/icon.ico"],
|
||||
"identifier": "io.grasscutter",
|
||||
"shortDescription": "A game launcher.",
|
||||
"longDescription": "A launcher for a certain anime game that proxies all related game traffic to external servers.",
|
||||
"macOS": {
|
||||
"entitlements": null,
|
||||
"exceptionDomain": "",
|
||||
"frameworks": [],
|
||||
"providerShortName": null,
|
||||
"signingIdentity": null
|
||||
},
|
||||
"resources": ["lang/*.json", "keys/*", "patch/*"],
|
||||
"targets": "all",
|
||||
"windows": {
|
||||
"allowDowngrades": false,
|
||||
"certificateThumbprint": null,
|
||||
"digestAlgorithm": "sha256",
|
||||
"timestampUrl": "",
|
||||
"wix": {
|
||||
"fragmentPaths": ["resources/wix.wxs"]
|
||||
}
|
||||
}
|
||||
},
|
||||
"security": {
|
||||
"csp": "default-src 'self'; img-src 'self' https://* asset: https://asset.localhost tauri://localhost; media-src https://* asset: https://asset.localhost tauri://localhost; style-src-elem https://* asset: https://asset.localhost tauri://localhost; script-src-elem https://* asset: https://asset.localhost tauri://localhost;"
|
||||
},
|
||||
"updater": {
|
||||
"active": false,
|
||||
"dialog": true,
|
||||
"endpoints": [
|
||||
"https://api.grasscutter.io/cultivation/updater?version={{current_version}}",
|
||||
"https://api.grasscutters.xyz/cultivation/updater?version={{current_version}}"
|
||||
],
|
||||
"pubkey": "dW50cnVzdGVkIGNvbW1lbnQ6IG1pbmlzaWduIHB1YmxpYyBrZXk6IEIyM0MzMzk0NkM4OTQzNQpSV1ExbE1oR09jTWpDNFJ4NURsaS9mdHpDWmpBM3JNVHkrdER4bS9KdHFCQnNVSWs0ZjZTU295WAo="
|
||||
},
|
||||
"app": {
|
||||
"windows": [
|
||||
{
|
||||
"fullscreen": false,
|
||||
"transparent": true,
|
||||
"height": 730,
|
||||
"resizable": true,
|
||||
"title": "Cultivation",
|
||||
"width": 1280,
|
||||
"decorations": false,
|
||||
"height": 730,
|
||||
"center": true
|
||||
}
|
||||
],
|
||||
"security": {
|
||||
"csp": null
|
||||
}
|
||||
},
|
||||
"bundle": {
|
||||
"active": true,
|
||||
"targets": "all",
|
||||
"icon": [
|
||||
"icons/32x32.png",
|
||||
"icons/128x128.png",
|
||||
"icons/128x128@2x.png",
|
||||
"icons/icon.icns",
|
||||
"icons/icon.ico"
|
||||
]
|
||||
}
|
||||
}
|
||||
|
||||
Reference in New Issue
Block a user