mirror of
https://github.com/Grasscutters/Cultivation.git
synced 2025-12-13 07:34:36 +01:00
feat: the great purge
This commit is contained in:
SpikeHD
@@ -16,7 +16,6 @@ tauri-build = { version = "1.0.0-rc.8", features = [] }
|
||||
cc = "1.0"
|
||||
|
||||
[target.'cfg(windows)'.dependencies]
|
||||
is_elevated = "0.1.2"
|
||||
registry = "1.2.1"
|
||||
|
||||
[target.'cfg(unix)'.dependencies]
|
||||
@@ -45,9 +44,6 @@ unrar = "0.4.4"
|
||||
zip = "0.6.2"
|
||||
sevenz-rust = "0.2.9"
|
||||
|
||||
# For creating a "global" downloads list.
|
||||
once_cell = "1.13.0"
|
||||
|
||||
# Program opener.
|
||||
open = "3.0.2"
|
||||
|
||||
@@ -62,7 +58,6 @@ http = "0.2"
|
||||
hudsucker = "0.19.2"
|
||||
tracing = "0.1.21"
|
||||
tokio-rustls = "0.23.0"
|
||||
tokio-tungstenite = "0.17.0"
|
||||
tokio = { version = "1.20.4", features = ["signal"] }
|
||||
rustls-pemfile = "1.0.0"
|
||||
reqwest = { version = "0.11.3", features = ["stream"] }
|
||||
@@ -73,7 +68,6 @@ rcgen = { version = "0.9", features = ["x509-parser"] }
|
||||
regex = "1"
|
||||
|
||||
# other
|
||||
file_diff = "1.0.0"
|
||||
rust-ini = "0.18.0"
|
||||
ctrlc = "3.2.3"
|
||||
|
||||
|
||||
@@ -1,16 +1,3 @@
|
||||
fn main() {
|
||||
cc::Build::new()
|
||||
.include("mhycrypto")
|
||||
.cpp(true)
|
||||
.file("mhycrypto/memecrypto.cpp")
|
||||
.file("mhycrypto/metadata.cpp")
|
||||
.file("mhycrypto/metadatastringdec.cpp")
|
||||
.compile("mhycrypto");
|
||||
|
||||
cc::Build::new()
|
||||
.include("mhycrypto")
|
||||
.file("mhycrypto/aes.c")
|
||||
.compile("mhycrypto-aes");
|
||||
|
||||
tauri_build::build()
|
||||
}
|
||||
|
||||
@@ -1,387 +0,0 @@
|
||||
// Simple, thoroughly commented implementation of 128-bit AES / Rijndael using C
|
||||
// Chris Hulbert - chris.hulbert@gmail.com - http://splinter.com.au/blog
|
||||
// References:
|
||||
// http://en.wikipedia.org/wiki/Advanced_Encryption_Standard
|
||||
// http://en.wikipedia.org/wiki/Rijndael_key_schedule
|
||||
// http://en.wikipedia.org/wiki/Rijndael_mix_columns
|
||||
// http://en.wikipedia.org/wiki/Rijndael_S-box
|
||||
|
||||
// This code is public domain, or any OSI-approved license, your choice. No warranty.
|
||||
|
||||
#include <assert.h>
|
||||
#include <stdio.h>
|
||||
#include <string.h>
|
||||
|
||||
#include "aes.h"
|
||||
|
||||
typedef unsigned char byte;
|
||||
|
||||
// Here are all the lookup tables for the row shifts, rcon, s-boxes, and galois field multiplications
|
||||
static const byte shift_rows_table[] = {0, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, 1, 6, 11};
|
||||
static const byte shift_rows_table_inv[] = {0, 13, 10, 7, 4, 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3};
|
||||
static const byte lookup_rcon[] = {
|
||||
0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a};
|
||||
static const byte lookup_sbox[] = {
|
||||
0x63, 0x7c, 0x77, 0x7b, 0xf2, 0x6b, 0x6f, 0xc5, 0x30, 0x01, 0x67, 0x2b, 0xfe, 0xd7, 0xab, 0x76,
|
||||
0xca, 0x82, 0xc9, 0x7d, 0xfa, 0x59, 0x47, 0xf0, 0xad, 0xd4, 0xa2, 0xaf, 0x9c, 0xa4, 0x72, 0xc0,
|
||||
0xb7, 0xfd, 0x93, 0x26, 0x36, 0x3f, 0xf7, 0xcc, 0x34, 0xa5, 0xe5, 0xf1, 0x71, 0xd8, 0x31, 0x15,
|
||||
0x04, 0xc7, 0x23, 0xc3, 0x18, 0x96, 0x05, 0x9a, 0x07, 0x12, 0x80, 0xe2, 0xeb, 0x27, 0xb2, 0x75,
|
||||
0x09, 0x83, 0x2c, 0x1a, 0x1b, 0x6e, 0x5a, 0xa0, 0x52, 0x3b, 0xd6, 0xb3, 0x29, 0xe3, 0x2f, 0x84,
|
||||
0x53, 0xd1, 0x00, 0xed, 0x20, 0xfc, 0xb1, 0x5b, 0x6a, 0xcb, 0xbe, 0x39, 0x4a, 0x4c, 0x58, 0xcf,
|
||||
0xd0, 0xef, 0xaa, 0xfb, 0x43, 0x4d, 0x33, 0x85, 0x45, 0xf9, 0x02, 0x7f, 0x50, 0x3c, 0x9f, 0xa8,
|
||||
0x51, 0xa3, 0x40, 0x8f, 0x92, 0x9d, 0x38, 0xf5, 0xbc, 0xb6, 0xda, 0x21, 0x10, 0xff, 0xf3, 0xd2,
|
||||
0xcd, 0x0c, 0x13, 0xec, 0x5f, 0x97, 0x44, 0x17, 0xc4, 0xa7, 0x7e, 0x3d, 0x64, 0x5d, 0x19, 0x73,
|
||||
0x60, 0x81, 0x4f, 0xdc, 0x22, 0x2a, 0x90, 0x88, 0x46, 0xee, 0xb8, 0x14, 0xde, 0x5e, 0x0b, 0xdb,
|
||||
0xe0, 0x32, 0x3a, 0x0a, 0x49, 0x06, 0x24, 0x5c, 0xc2, 0xd3, 0xac, 0x62, 0x91, 0x95, 0xe4, 0x79,
|
||||
0xe7, 0xc8, 0x37, 0x6d, 0x8d, 0xd5, 0x4e, 0xa9, 0x6c, 0x56, 0xf4, 0xea, 0x65, 0x7a, 0xae, 0x08,
|
||||
0xba, 0x78, 0x25, 0x2e, 0x1c, 0xa6, 0xb4, 0xc6, 0xe8, 0xdd, 0x74, 0x1f, 0x4b, 0xbd, 0x8b, 0x8a,
|
||||
0x70, 0x3e, 0xb5, 0x66, 0x48, 0x03, 0xf6, 0x0e, 0x61, 0x35, 0x57, 0xb9, 0x86, 0xc1, 0x1d, 0x9e,
|
||||
0xe1, 0xf8, 0x98, 0x11, 0x69, 0xd9, 0x8e, 0x94, 0x9b, 0x1e, 0x87, 0xe9, 0xce, 0x55, 0x28, 0xdf,
|
||||
0x8c, 0xa1, 0x89, 0x0d, 0xbf, 0xe6, 0x42, 0x68, 0x41, 0x99, 0x2d, 0x0f, 0xb0, 0x54, 0xbb, 0x16};
|
||||
static const byte lookup_sbox_inv[] = {
|
||||
0x52, 0x09, 0x6a, 0xd5, 0x30, 0x36, 0xa5, 0x38, 0xbf, 0x40, 0xa3, 0x9e, 0x81, 0xf3, 0xd7, 0xfb,
|
||||
0x7c, 0xe3, 0x39, 0x82, 0x9b, 0x2f, 0xff, 0x87, 0x34, 0x8e, 0x43, 0x44, 0xc4, 0xde, 0xe9, 0xcb,
|
||||
0x54, 0x7b, 0x94, 0x32, 0xa6, 0xc2, 0x23, 0x3d, 0xee, 0x4c, 0x95, 0x0b, 0x42, 0xfa, 0xc3, 0x4e,
|
||||
0x08, 0x2e, 0xa1, 0x66, 0x28, 0xd9, 0x24, 0xb2, 0x76, 0x5b, 0xa2, 0x49, 0x6d, 0x8b, 0xd1, 0x25,
|
||||
0x72, 0xf8, 0xf6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xd4, 0xa4, 0x5c, 0xcc, 0x5d, 0x65, 0xb6, 0x92,
|
||||
0x6c, 0x70, 0x48, 0x50, 0xfd, 0xed, 0xb9, 0xda, 0x5e, 0x15, 0x46, 0x57, 0xa7, 0x8d, 0x9d, 0x84,
|
||||
0x90, 0xd8, 0xab, 0x00, 0x8c, 0xbc, 0xd3, 0x0a, 0xf7, 0xe4, 0x58, 0x05, 0xb8, 0xb3, 0x45, 0x06,
|
||||
0xd0, 0x2c, 0x1e, 0x8f, 0xca, 0x3f, 0x0f, 0x02, 0xc1, 0xaf, 0xbd, 0x03, 0x01, 0x13, 0x8a, 0x6b,
|
||||
0x3a, 0x91, 0x11, 0x41, 0x4f, 0x67, 0xdc, 0xea, 0x97, 0xf2, 0xcf, 0xce, 0xf0, 0xb4, 0xe6, 0x73,
|
||||
0x96, 0xac, 0x74, 0x22, 0xe7, 0xad, 0x35, 0x85, 0xe2, 0xf9, 0x37, 0xe8, 0x1c, 0x75, 0xdf, 0x6e,
|
||||
0x47, 0xf1, 0x1a, 0x71, 0x1d, 0x29, 0xc5, 0x89, 0x6f, 0xb7, 0x62, 0x0e, 0xaa, 0x18, 0xbe, 0x1b,
|
||||
0xfc, 0x56, 0x3e, 0x4b, 0xc6, 0xd2, 0x79, 0x20, 0x9a, 0xdb, 0xc0, 0xfe, 0x78, 0xcd, 0x5a, 0xf4,
|
||||
0x1f, 0xdd, 0xa8, 0x33, 0x88, 0x07, 0xc7, 0x31, 0xb1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xec, 0x5f,
|
||||
0x60, 0x51, 0x7f, 0xa9, 0x19, 0xb5, 0x4a, 0x0d, 0x2d, 0xe5, 0x7a, 0x9f, 0x93, 0xc9, 0x9c, 0xef,
|
||||
0xa0, 0xe0, 0x3b, 0x4d, 0xae, 0x2a, 0xf5, 0xb0, 0xc8, 0xeb, 0xbb, 0x3c, 0x83, 0x53, 0x99, 0x61,
|
||||
0x17, 0x2b, 0x04, 0x7e, 0xba, 0x77, 0xd6, 0x26, 0xe1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0c, 0x7d};
|
||||
static const byte lookup_g2[] = {
|
||||
0x00, 0x02, 0x04, 0x06, 0x08, 0x0a, 0x0c, 0x0e, 0x10, 0x12, 0x14, 0x16, 0x18, 0x1a, 0x1c, 0x1e,
|
||||
0x20, 0x22, 0x24, 0x26, 0x28, 0x2a, 0x2c, 0x2e, 0x30, 0x32, 0x34, 0x36, 0x38, 0x3a, 0x3c, 0x3e,
|
||||
0x40, 0x42, 0x44, 0x46, 0x48, 0x4a, 0x4c, 0x4e, 0x50, 0x52, 0x54, 0x56, 0x58, 0x5a, 0x5c, 0x5e,
|
||||
0x60, 0x62, 0x64, 0x66, 0x68, 0x6a, 0x6c, 0x6e, 0x70, 0x72, 0x74, 0x76, 0x78, 0x7a, 0x7c, 0x7e,
|
||||
0x80, 0x82, 0x84, 0x86, 0x88, 0x8a, 0x8c, 0x8e, 0x90, 0x92, 0x94, 0x96, 0x98, 0x9a, 0x9c, 0x9e,
|
||||
0xa0, 0xa2, 0xa4, 0xa6, 0xa8, 0xaa, 0xac, 0xae, 0xb0, 0xb2, 0xb4, 0xb6, 0xb8, 0xba, 0xbc, 0xbe,
|
||||
0xc0, 0xc2, 0xc4, 0xc6, 0xc8, 0xca, 0xcc, 0xce, 0xd0, 0xd2, 0xd4, 0xd6, 0xd8, 0xda, 0xdc, 0xde,
|
||||
0xe0, 0xe2, 0xe4, 0xe6, 0xe8, 0xea, 0xec, 0xee, 0xf0, 0xf2, 0xf4, 0xf6, 0xf8, 0xfa, 0xfc, 0xfe,
|
||||
0x1b, 0x19, 0x1f, 0x1d, 0x13, 0x11, 0x17, 0x15, 0x0b, 0x09, 0x0f, 0x0d, 0x03, 0x01, 0x07, 0x05,
|
||||
0x3b, 0x39, 0x3f, 0x3d, 0x33, 0x31, 0x37, 0x35, 0x2b, 0x29, 0x2f, 0x2d, 0x23, 0x21, 0x27, 0x25,
|
||||
0x5b, 0x59, 0x5f, 0x5d, 0x53, 0x51, 0x57, 0x55, 0x4b, 0x49, 0x4f, 0x4d, 0x43, 0x41, 0x47, 0x45,
|
||||
0x7b, 0x79, 0x7f, 0x7d, 0x73, 0x71, 0x77, 0x75, 0x6b, 0x69, 0x6f, 0x6d, 0x63, 0x61, 0x67, 0x65,
|
||||
0x9b, 0x99, 0x9f, 0x9d, 0x93, 0x91, 0x97, 0x95, 0x8b, 0x89, 0x8f, 0x8d, 0x83, 0x81, 0x87, 0x85,
|
||||
0xbb, 0xb9, 0xbf, 0xbd, 0xb3, 0xb1, 0xb7, 0xb5, 0xab, 0xa9, 0xaf, 0xad, 0xa3, 0xa1, 0xa7, 0xa5,
|
||||
0xdb, 0xd9, 0xdf, 0xdd, 0xd3, 0xd1, 0xd7, 0xd5, 0xcb, 0xc9, 0xcf, 0xcd, 0xc3, 0xc1, 0xc7, 0xc5,
|
||||
0xfb, 0xf9, 0xff, 0xfd, 0xf3, 0xf1, 0xf7, 0xf5, 0xeb, 0xe9, 0xef, 0xed, 0xe3, 0xe1, 0xe7, 0xe5};
|
||||
static const byte lookup_g3[] = {
|
||||
0x00, 0x03, 0x06, 0x05, 0x0c, 0x0f, 0x0a, 0x09, 0x18, 0x1b, 0x1e, 0x1d, 0x14, 0x17, 0x12, 0x11,
|
||||
0x30, 0x33, 0x36, 0x35, 0x3c, 0x3f, 0x3a, 0x39, 0x28, 0x2b, 0x2e, 0x2d, 0x24, 0x27, 0x22, 0x21,
|
||||
0x60, 0x63, 0x66, 0x65, 0x6c, 0x6f, 0x6a, 0x69, 0x78, 0x7b, 0x7e, 0x7d, 0x74, 0x77, 0x72, 0x71,
|
||||
0x50, 0x53, 0x56, 0x55, 0x5c, 0x5f, 0x5a, 0x59, 0x48, 0x4b, 0x4e, 0x4d, 0x44, 0x47, 0x42, 0x41,
|
||||
0xc0, 0xc3, 0xc6, 0xc5, 0xcc, 0xcf, 0xca, 0xc9, 0xd8, 0xdb, 0xde, 0xdd, 0xd4, 0xd7, 0xd2, 0xd1,
|
||||
0xf0, 0xf3, 0xf6, 0xf5, 0xfc, 0xff, 0xfa, 0xf9, 0xe8, 0xeb, 0xee, 0xed, 0xe4, 0xe7, 0xe2, 0xe1,
|
||||
0xa0, 0xa3, 0xa6, 0xa5, 0xac, 0xaf, 0xaa, 0xa9, 0xb8, 0xbb, 0xbe, 0xbd, 0xb4, 0xb7, 0xb2, 0xb1,
|
||||
0x90, 0x93, 0x96, 0x95, 0x9c, 0x9f, 0x9a, 0x99, 0x88, 0x8b, 0x8e, 0x8d, 0x84, 0x87, 0x82, 0x81,
|
||||
0x9b, 0x98, 0x9d, 0x9e, 0x97, 0x94, 0x91, 0x92, 0x83, 0x80, 0x85, 0x86, 0x8f, 0x8c, 0x89, 0x8a,
|
||||
0xab, 0xa8, 0xad, 0xae, 0xa7, 0xa4, 0xa1, 0xa2, 0xb3, 0xb0, 0xb5, 0xb6, 0xbf, 0xbc, 0xb9, 0xba,
|
||||
0xfb, 0xf8, 0xfd, 0xfe, 0xf7, 0xf4, 0xf1, 0xf2, 0xe3, 0xe0, 0xe5, 0xe6, 0xef, 0xec, 0xe9, 0xea,
|
||||
0xcb, 0xc8, 0xcd, 0xce, 0xc7, 0xc4, 0xc1, 0xc2, 0xd3, 0xd0, 0xd5, 0xd6, 0xdf, 0xdc, 0xd9, 0xda,
|
||||
0x5b, 0x58, 0x5d, 0x5e, 0x57, 0x54, 0x51, 0x52, 0x43, 0x40, 0x45, 0x46, 0x4f, 0x4c, 0x49, 0x4a,
|
||||
0x6b, 0x68, 0x6d, 0x6e, 0x67, 0x64, 0x61, 0x62, 0x73, 0x70, 0x75, 0x76, 0x7f, 0x7c, 0x79, 0x7a,
|
||||
0x3b, 0x38, 0x3d, 0x3e, 0x37, 0x34, 0x31, 0x32, 0x23, 0x20, 0x25, 0x26, 0x2f, 0x2c, 0x29, 0x2a,
|
||||
0x0b, 0x08, 0x0d, 0x0e, 0x07, 0x04, 0x01, 0x02, 0x13, 0x10, 0x15, 0x16, 0x1f, 0x1c, 0x19, 0x1a};
|
||||
static const byte lookup_g9[] = {
|
||||
0x00, 0x09, 0x12, 0x1b, 0x24, 0x2d, 0x36, 0x3f, 0x48, 0x41, 0x5a, 0x53, 0x6c, 0x65, 0x7e, 0x77,
|
||||
0x90, 0x99, 0x82, 0x8b, 0xb4, 0xbd, 0xa6, 0xaf, 0xd8, 0xd1, 0xca, 0xc3, 0xfc, 0xf5, 0xee, 0xe7,
|
||||
0x3b, 0x32, 0x29, 0x20, 0x1f, 0x16, 0x0d, 0x04, 0x73, 0x7a, 0x61, 0x68, 0x57, 0x5e, 0x45, 0x4c,
|
||||
0xab, 0xa2, 0xb9, 0xb0, 0x8f, 0x86, 0x9d, 0x94, 0xe3, 0xea, 0xf1, 0xf8, 0xc7, 0xce, 0xd5, 0xdc,
|
||||
0x76, 0x7f, 0x64, 0x6d, 0x52, 0x5b, 0x40, 0x49, 0x3e, 0x37, 0x2c, 0x25, 0x1a, 0x13, 0x08, 0x01,
|
||||
0xe6, 0xef, 0xf4, 0xfd, 0xc2, 0xcb, 0xd0, 0xd9, 0xae, 0xa7, 0xbc, 0xb5, 0x8a, 0x83, 0x98, 0x91,
|
||||
0x4d, 0x44, 0x5f, 0x56, 0x69, 0x60, 0x7b, 0x72, 0x05, 0x0c, 0x17, 0x1e, 0x21, 0x28, 0x33, 0x3a,
|
||||
0xdd, 0xd4, 0xcf, 0xc6, 0xf9, 0xf0, 0xeb, 0xe2, 0x95, 0x9c, 0x87, 0x8e, 0xb1, 0xb8, 0xa3, 0xaa,
|
||||
0xec, 0xe5, 0xfe, 0xf7, 0xc8, 0xc1, 0xda, 0xd3, 0xa4, 0xad, 0xb6, 0xbf, 0x80, 0x89, 0x92, 0x9b,
|
||||
0x7c, 0x75, 0x6e, 0x67, 0x58, 0x51, 0x4a, 0x43, 0x34, 0x3d, 0x26, 0x2f, 0x10, 0x19, 0x02, 0x0b,
|
||||
0xd7, 0xde, 0xc5, 0xcc, 0xf3, 0xfa, 0xe1, 0xe8, 0x9f, 0x96, 0x8d, 0x84, 0xbb, 0xb2, 0xa9, 0xa0,
|
||||
0x47, 0x4e, 0x55, 0x5c, 0x63, 0x6a, 0x71, 0x78, 0x0f, 0x06, 0x1d, 0x14, 0x2b, 0x22, 0x39, 0x30,
|
||||
0x9a, 0x93, 0x88, 0x81, 0xbe, 0xb7, 0xac, 0xa5, 0xd2, 0xdb, 0xc0, 0xc9, 0xf6, 0xff, 0xe4, 0xed,
|
||||
0x0a, 0x03, 0x18, 0x11, 0x2e, 0x27, 0x3c, 0x35, 0x42, 0x4b, 0x50, 0x59, 0x66, 0x6f, 0x74, 0x7d,
|
||||
0xa1, 0xa8, 0xb3, 0xba, 0x85, 0x8c, 0x97, 0x9e, 0xe9, 0xe0, 0xfb, 0xf2, 0xcd, 0xc4, 0xdf, 0xd6,
|
||||
0x31, 0x38, 0x23, 0x2a, 0x15, 0x1c, 0x07, 0x0e, 0x79, 0x70, 0x6b, 0x62, 0x5d, 0x54, 0x4f, 0x46};
|
||||
static const byte lookup_g11[] = {
|
||||
0x00, 0x0b, 0x16, 0x1d, 0x2c, 0x27, 0x3a, 0x31, 0x58, 0x53, 0x4e, 0x45, 0x74, 0x7f, 0x62, 0x69,
|
||||
0xb0, 0xbb, 0xa6, 0xad, 0x9c, 0x97, 0x8a, 0x81, 0xe8, 0xe3, 0xfe, 0xf5, 0xc4, 0xcf, 0xd2, 0xd9,
|
||||
0x7b, 0x70, 0x6d, 0x66, 0x57, 0x5c, 0x41, 0x4a, 0x23, 0x28, 0x35, 0x3e, 0x0f, 0x04, 0x19, 0x12,
|
||||
0xcb, 0xc0, 0xdd, 0xd6, 0xe7, 0xec, 0xf1, 0xfa, 0x93, 0x98, 0x85, 0x8e, 0xbf, 0xb4, 0xa9, 0xa2,
|
||||
0xf6, 0xfd, 0xe0, 0xeb, 0xda, 0xd1, 0xcc, 0xc7, 0xae, 0xa5, 0xb8, 0xb3, 0x82, 0x89, 0x94, 0x9f,
|
||||
0x46, 0x4d, 0x50, 0x5b, 0x6a, 0x61, 0x7c, 0x77, 0x1e, 0x15, 0x08, 0x03, 0x32, 0x39, 0x24, 0x2f,
|
||||
0x8d, 0x86, 0x9b, 0x90, 0xa1, 0xaa, 0xb7, 0xbc, 0xd5, 0xde, 0xc3, 0xc8, 0xf9, 0xf2, 0xef, 0xe4,
|
||||
0x3d, 0x36, 0x2b, 0x20, 0x11, 0x1a, 0x07, 0x0c, 0x65, 0x6e, 0x73, 0x78, 0x49, 0x42, 0x5f, 0x54,
|
||||
0xf7, 0xfc, 0xe1, 0xea, 0xdb, 0xd0, 0xcd, 0xc6, 0xaf, 0xa4, 0xb9, 0xb2, 0x83, 0x88, 0x95, 0x9e,
|
||||
0x47, 0x4c, 0x51, 0x5a, 0x6b, 0x60, 0x7d, 0x76, 0x1f, 0x14, 0x09, 0x02, 0x33, 0x38, 0x25, 0x2e,
|
||||
0x8c, 0x87, 0x9a, 0x91, 0xa0, 0xab, 0xb6, 0xbd, 0xd4, 0xdf, 0xc2, 0xc9, 0xf8, 0xf3, 0xee, 0xe5,
|
||||
0x3c, 0x37, 0x2a, 0x21, 0x10, 0x1b, 0x06, 0x0d, 0x64, 0x6f, 0x72, 0x79, 0x48, 0x43, 0x5e, 0x55,
|
||||
0x01, 0x0a, 0x17, 0x1c, 0x2d, 0x26, 0x3b, 0x30, 0x59, 0x52, 0x4f, 0x44, 0x75, 0x7e, 0x63, 0x68,
|
||||
0xb1, 0xba, 0xa7, 0xac, 0x9d, 0x96, 0x8b, 0x80, 0xe9, 0xe2, 0xff, 0xf4, 0xc5, 0xce, 0xd3, 0xd8,
|
||||
0x7a, 0x71, 0x6c, 0x67, 0x56, 0x5d, 0x40, 0x4b, 0x22, 0x29, 0x34, 0x3f, 0x0e, 0x05, 0x18, 0x13,
|
||||
0xca, 0xc1, 0xdc, 0xd7, 0xe6, 0xed, 0xf0, 0xfb, 0x92, 0x99, 0x84, 0x8f, 0xbe, 0xb5, 0xa8, 0xa3};
|
||||
static const byte lookup_g13[] = {
|
||||
0x00, 0x0d, 0x1a, 0x17, 0x34, 0x39, 0x2e, 0x23, 0x68, 0x65, 0x72, 0x7f, 0x5c, 0x51, 0x46, 0x4b,
|
||||
0xd0, 0xdd, 0xca, 0xc7, 0xe4, 0xe9, 0xfe, 0xf3, 0xb8, 0xb5, 0xa2, 0xaf, 0x8c, 0x81, 0x96, 0x9b,
|
||||
0xbb, 0xb6, 0xa1, 0xac, 0x8f, 0x82, 0x95, 0x98, 0xd3, 0xde, 0xc9, 0xc4, 0xe7, 0xea, 0xfd, 0xf0,
|
||||
0x6b, 0x66, 0x71, 0x7c, 0x5f, 0x52, 0x45, 0x48, 0x03, 0x0e, 0x19, 0x14, 0x37, 0x3a, 0x2d, 0x20,
|
||||
0x6d, 0x60, 0x77, 0x7a, 0x59, 0x54, 0x43, 0x4e, 0x05, 0x08, 0x1f, 0x12, 0x31, 0x3c, 0x2b, 0x26,
|
||||
0xbd, 0xb0, 0xa7, 0xaa, 0x89, 0x84, 0x93, 0x9e, 0xd5, 0xd8, 0xcf, 0xc2, 0xe1, 0xec, 0xfb, 0xf6,
|
||||
0xd6, 0xdb, 0xcc, 0xc1, 0xe2, 0xef, 0xf8, 0xf5, 0xbe, 0xb3, 0xa4, 0xa9, 0x8a, 0x87, 0x90, 0x9d,
|
||||
0x06, 0x0b, 0x1c, 0x11, 0x32, 0x3f, 0x28, 0x25, 0x6e, 0x63, 0x74, 0x79, 0x5a, 0x57, 0x40, 0x4d,
|
||||
0xda, 0xd7, 0xc0, 0xcd, 0xee, 0xe3, 0xf4, 0xf9, 0xb2, 0xbf, 0xa8, 0xa5, 0x86, 0x8b, 0x9c, 0x91,
|
||||
0x0a, 0x07, 0x10, 0x1d, 0x3e, 0x33, 0x24, 0x29, 0x62, 0x6f, 0x78, 0x75, 0x56, 0x5b, 0x4c, 0x41,
|
||||
0x61, 0x6c, 0x7b, 0x76, 0x55, 0x58, 0x4f, 0x42, 0x09, 0x04, 0x13, 0x1e, 0x3d, 0x30, 0x27, 0x2a,
|
||||
0xb1, 0xbc, 0xab, 0xa6, 0x85, 0x88, 0x9f, 0x92, 0xd9, 0xd4, 0xc3, 0xce, 0xed, 0xe0, 0xf7, 0xfa,
|
||||
0xb7, 0xba, 0xad, 0xa0, 0x83, 0x8e, 0x99, 0x94, 0xdf, 0xd2, 0xc5, 0xc8, 0xeb, 0xe6, 0xf1, 0xfc,
|
||||
0x67, 0x6a, 0x7d, 0x70, 0x53, 0x5e, 0x49, 0x44, 0x0f, 0x02, 0x15, 0x18, 0x3b, 0x36, 0x21, 0x2c,
|
||||
0x0c, 0x01, 0x16, 0x1b, 0x38, 0x35, 0x22, 0x2f, 0x64, 0x69, 0x7e, 0x73, 0x50, 0x5d, 0x4a, 0x47,
|
||||
0xdc, 0xd1, 0xc6, 0xcb, 0xe8, 0xe5, 0xf2, 0xff, 0xb4, 0xb9, 0xae, 0xa3, 0x80, 0x8d, 0x9a, 0x97};
|
||||
static const byte lookup_g14[] = {
|
||||
0x00, 0x0e, 0x1c, 0x12, 0x38, 0x36, 0x24, 0x2a, 0x70, 0x7e, 0x6c, 0x62, 0x48, 0x46, 0x54, 0x5a,
|
||||
0xe0, 0xee, 0xfc, 0xf2, 0xd8, 0xd6, 0xc4, 0xca, 0x90, 0x9e, 0x8c, 0x82, 0xa8, 0xa6, 0xb4, 0xba,
|
||||
0xdb, 0xd5, 0xc7, 0xc9, 0xe3, 0xed, 0xff, 0xf1, 0xab, 0xa5, 0xb7, 0xb9, 0x93, 0x9d, 0x8f, 0x81,
|
||||
0x3b, 0x35, 0x27, 0x29, 0x03, 0x0d, 0x1f, 0x11, 0x4b, 0x45, 0x57, 0x59, 0x73, 0x7d, 0x6f, 0x61,
|
||||
0xad, 0xa3, 0xb1, 0xbf, 0x95, 0x9b, 0x89, 0x87, 0xdd, 0xd3, 0xc1, 0xcf, 0xe5, 0xeb, 0xf9, 0xf7,
|
||||
0x4d, 0x43, 0x51, 0x5f, 0x75, 0x7b, 0x69, 0x67, 0x3d, 0x33, 0x21, 0x2f, 0x05, 0x0b, 0x19, 0x17,
|
||||
0x76, 0x78, 0x6a, 0x64, 0x4e, 0x40, 0x52, 0x5c, 0x06, 0x08, 0x1a, 0x14, 0x3e, 0x30, 0x22, 0x2c,
|
||||
0x96, 0x98, 0x8a, 0x84, 0xae, 0xa0, 0xb2, 0xbc, 0xe6, 0xe8, 0xfa, 0xf4, 0xde, 0xd0, 0xc2, 0xcc,
|
||||
0x41, 0x4f, 0x5d, 0x53, 0x79, 0x77, 0x65, 0x6b, 0x31, 0x3f, 0x2d, 0x23, 0x09, 0x07, 0x15, 0x1b,
|
||||
0xa1, 0xaf, 0xbd, 0xb3, 0x99, 0x97, 0x85, 0x8b, 0xd1, 0xdf, 0xcd, 0xc3, 0xe9, 0xe7, 0xf5, 0xfb,
|
||||
0x9a, 0x94, 0x86, 0x88, 0xa2, 0xac, 0xbe, 0xb0, 0xea, 0xe4, 0xf6, 0xf8, 0xd2, 0xdc, 0xce, 0xc0,
|
||||
0x7a, 0x74, 0x66, 0x68, 0x42, 0x4c, 0x5e, 0x50, 0x0a, 0x04, 0x16, 0x18, 0x32, 0x3c, 0x2e, 0x20,
|
||||
0xec, 0xe2, 0xf0, 0xfe, 0xd4, 0xda, 0xc8, 0xc6, 0x9c, 0x92, 0x80, 0x8e, 0xa4, 0xaa, 0xb8, 0xb6,
|
||||
0x0c, 0x02, 0x10, 0x1e, 0x34, 0x3a, 0x28, 0x26, 0x7c, 0x72, 0x60, 0x6e, 0x44, 0x4a, 0x58, 0x56,
|
||||
0x37, 0x39, 0x2b, 0x25, 0x0f, 0x01, 0x13, 0x1d, 0x47, 0x49, 0x5b, 0x55, 0x7f, 0x71, 0x63, 0x6d,
|
||||
0xd7, 0xd9, 0xcb, 0xc5, 0xef, 0xe1, 0xf3, 0xfd, 0xa7, 0xa9, 0xbb, 0xb5, 0x9f, 0x91, 0x83, 0x8d};
|
||||
|
||||
// Xor's all elements in a n byte array a by b
|
||||
static void xor_s(byte * a, const byte *b, int n) {
|
||||
int i;
|
||||
for (i = 0; i < n; i++) {
|
||||
a[i] ^= b[i];
|
||||
}
|
||||
}
|
||||
|
||||
// Xor the current cipher state by a specific round key
|
||||
static void xor_round_key(byte *state, const byte *keys, int round) {
|
||||
xor_s(state, keys + round * 16, 16);
|
||||
}
|
||||
|
||||
// Apply the rijndael s-box to all elements in an array
|
||||
// http://en.wikipedia.org/wiki/Rijndael_S-box
|
||||
static void sub_bytes(byte *a, int n) {
|
||||
int i;
|
||||
for (i = 0; i < n; i++) {
|
||||
a[i] = lookup_sbox[a[i]];
|
||||
}
|
||||
}
|
||||
static void sub_bytes_inv(byte *a, int n) {
|
||||
int i;
|
||||
for (i = 0; i < n; i++) {
|
||||
a[i] = lookup_sbox_inv[a[i]];
|
||||
}
|
||||
}
|
||||
|
||||
// Perform the core key schedule transform on 4 bytes, as part of the key expansion process
|
||||
// http://en.wikipedia.org/wiki/Rijndael_key_schedule#Key_schedule_core
|
||||
static void key_schedule_core(byte *a, int i) {
|
||||
byte temp = a[0]; // Rotate the output eight bits to the left
|
||||
a[0] = a[1];
|
||||
a[1] = a[2];
|
||||
a[2] = a[3];
|
||||
a[3] = temp;
|
||||
sub_bytes(a, 4); // Apply Rijndael's S-box on all four individual bytes in the output word
|
||||
a[0] ^= lookup_rcon[i]; // On just the first (leftmost) byte of the output word, perform the rcon operation with i
|
||||
// as the input, and exclusive or the rcon output with the first byte of the output word
|
||||
}
|
||||
|
||||
// Expand the 16-byte key to 11 round keys (176 bytes)
|
||||
// http://en.wikipedia.org/wiki/Rijndael_key_schedule#The_key_schedule
|
||||
void oqs_aes128_load_schedule_c(const uint8_t *key, void **_schedule) {
|
||||
*_schedule = malloc(16 * 11);
|
||||
assert(*_schedule != NULL);
|
||||
uint8_t *schedule = (uint8_t *) *_schedule;
|
||||
int bytes = 16; // The count of how many bytes we've created so far
|
||||
int i = 1; // The rcon iteration value i is set to 1
|
||||
int j; // For repeating the second stage 3 times
|
||||
byte t[4]; // Temporary working area known as 't' in the Wiki article
|
||||
memcpy(schedule, key, 16); // The first 16 bytes of the expanded key are simply the encryption key
|
||||
|
||||
while (bytes < 176) { // Until we have 176 bytes of expanded key, we do the following:
|
||||
memcpy(t, schedule + bytes - 4, 4); // We assign the value of the previous four bytes in the expanded key to t
|
||||
key_schedule_core(t, i); // We perform the key schedule core on t, with i as the rcon iteration value
|
||||
i++; // We increment i by 1
|
||||
xor_s(t, schedule + bytes - 16, 4); // We exclusive-or t with the four-byte block 16 bytes before the new expanded key.
|
||||
memcpy(schedule + bytes, t, 4); // This becomes the next 4 bytes in the expanded key
|
||||
bytes += 4; // Keep track of how many expanded key bytes we've added
|
||||
|
||||
// We then do the following three times to create the next twelve bytes
|
||||
for (j = 0; j < 3; j++) {
|
||||
memcpy(t, schedule + bytes - 4, 4); // We assign the value of the previous 4 bytes in the expanded key to t
|
||||
xor_s(t, schedule + bytes - 16, 4); // We exclusive-or t with the four-byte block n bytes before
|
||||
memcpy(schedule + bytes, t, 4); // This becomes the next 4 bytes in the expanded key
|
||||
bytes += 4; // Keep track of how many expanded key bytes we've added
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void oqs_aes128_free_schedule_c(void *schedule) {
|
||||
if (schedule != NULL) {
|
||||
free(schedule);
|
||||
}
|
||||
}
|
||||
|
||||
// Apply the shift rows step on the 16 byte cipher state
|
||||
// http://en.wikipedia.org/wiki/Advanced_Encryption_Standard#The_ShiftRows_step
|
||||
static void shift_rows(byte *state) {
|
||||
int i;
|
||||
byte temp[16];
|
||||
memcpy(temp, state, 16);
|
||||
for (i = 0; i < 16; i++) {
|
||||
state[i] = temp[shift_rows_table[i]];
|
||||
}
|
||||
}
|
||||
static void shift_rows_inv(byte *state) {
|
||||
int i;
|
||||
byte temp[16];
|
||||
memcpy(temp, state, 16);
|
||||
for (i = 0; i < 16; i++) {
|
||||
state[i] = temp[shift_rows_table_inv[i]];
|
||||
}
|
||||
}
|
||||
|
||||
// Perform the mix columns matrix on one column of 4 bytes
|
||||
// http://en.wikipedia.org/wiki/Rijndael_mix_columns
|
||||
static void mix_col(byte *state) {
|
||||
byte a0 = state[0];
|
||||
byte a1 = state[1];
|
||||
byte a2 = state[2];
|
||||
byte a3 = state[3];
|
||||
state[0] = lookup_g2[a0] ^ lookup_g3[a1] ^ a2 ^ a3;
|
||||
state[1] = lookup_g2[a1] ^ lookup_g3[a2] ^ a3 ^ a0;
|
||||
state[2] = lookup_g2[a2] ^ lookup_g3[a3] ^ a0 ^ a1;
|
||||
state[3] = lookup_g2[a3] ^ lookup_g3[a0] ^ a1 ^ a2;
|
||||
}
|
||||
|
||||
// Perform the mix columns matrix on each column of the 16 bytes
|
||||
static void mix_cols(byte *state) {
|
||||
mix_col(state);
|
||||
mix_col(state + 4);
|
||||
mix_col(state + 8);
|
||||
mix_col(state + 12);
|
||||
}
|
||||
|
||||
// Perform the inverse mix columns matrix on one column of 4 bytes
|
||||
// http://en.wikipedia.org/wiki/Rijndael_mix_columns
|
||||
static void mix_col_inv(byte *state) {
|
||||
byte a0 = state[0];
|
||||
byte a1 = state[1];
|
||||
byte a2 = state[2];
|
||||
byte a3 = state[3];
|
||||
state[0] = lookup_g14[a0] ^ lookup_g9[a3] ^ lookup_g13[a2] ^ lookup_g11[a1];
|
||||
state[1] = lookup_g14[a1] ^ lookup_g9[a0] ^ lookup_g13[a3] ^ lookup_g11[a2];
|
||||
state[2] = lookup_g14[a2] ^ lookup_g9[a1] ^ lookup_g13[a0] ^ lookup_g11[a3];
|
||||
state[3] = lookup_g14[a3] ^ lookup_g9[a2] ^ lookup_g13[a1] ^ lookup_g11[a0];
|
||||
}
|
||||
|
||||
// Perform the inverse mix columns matrix on each column of the 16 bytes
|
||||
static void mix_cols_inv(byte *state) {
|
||||
mix_col_inv(state);
|
||||
mix_col_inv(state + 4);
|
||||
mix_col_inv(state + 8);
|
||||
mix_col_inv(state + 12);
|
||||
}
|
||||
|
||||
void oqs_aes128_enc_c(const uint8_t *plaintext, const void *_schedule, uint8_t *ciphertext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// First Round
|
||||
memcpy(ciphertext, plaintext, 16);
|
||||
xor_round_key(ciphertext, schedule, 0);
|
||||
|
||||
// Middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
sub_bytes(ciphertext, 16);
|
||||
shift_rows(ciphertext);
|
||||
mix_cols(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, i + 1);
|
||||
}
|
||||
|
||||
// Final Round
|
||||
sub_bytes(ciphertext, 16);
|
||||
shift_rows(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, 10);
|
||||
}
|
||||
|
||||
|
||||
void oqs_aes128_dec_c(const uint8_t *ciphertext, const void *_schedule, uint8_t *plaintext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// Reverse the final Round
|
||||
memcpy(plaintext, ciphertext, 16);
|
||||
xor_round_key(plaintext, schedule, 10);
|
||||
shift_rows_inv(plaintext);
|
||||
sub_bytes_inv(plaintext, 16);
|
||||
|
||||
// Reverse the middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
xor_round_key(plaintext, schedule, 9 - i);
|
||||
mix_cols_inv(plaintext);
|
||||
shift_rows_inv(plaintext);
|
||||
sub_bytes_inv(plaintext, 16);
|
||||
}
|
||||
|
||||
// Reverse the first Round
|
||||
xor_round_key(plaintext, schedule, 0);
|
||||
}
|
||||
|
||||
// It's not enc nor dec, it's something in between
|
||||
void oqs_mhy128_enc_c(const uint8_t *plaintext, const void *_schedule, uint8_t *ciphertext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// First Round
|
||||
memcpy(ciphertext, plaintext, 16);
|
||||
xor_round_key(ciphertext, schedule, 0);
|
||||
|
||||
// Middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
sub_bytes_inv(ciphertext, 16);
|
||||
shift_rows_inv(ciphertext);
|
||||
mix_cols_inv(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, i + 1);
|
||||
}
|
||||
|
||||
// Final Round
|
||||
sub_bytes_inv(ciphertext, 16);
|
||||
shift_rows_inv(ciphertext);
|
||||
xor_round_key(ciphertext, schedule, 10);
|
||||
}
|
||||
|
||||
void oqs_mhy128_dec_c(const uint8_t *ciphertext, const void *_schedule, uint8_t *plaintext) {
|
||||
const uint8_t *schedule = (const uint8_t *) _schedule;
|
||||
int i; // To count the rounds
|
||||
|
||||
// Reverse the final Round
|
||||
memcpy(plaintext, ciphertext, 16);
|
||||
xor_round_key(plaintext, schedule, 10);
|
||||
shift_rows(plaintext);
|
||||
sub_bytes(plaintext, 16);
|
||||
|
||||
// Reverse the middle rounds
|
||||
for (i = 0; i < 9; i++) {
|
||||
xor_round_key(plaintext, schedule, 9 - i);
|
||||
mix_cols(plaintext);
|
||||
shift_rows(plaintext);
|
||||
sub_bytes(plaintext, 16);
|
||||
}
|
||||
|
||||
// Reverse the first Round
|
||||
xor_round_key(plaintext, schedule, 0);
|
||||
}
|
||||
@@ -1,66 +0,0 @@
|
||||
/**
|
||||
* \file aes.h
|
||||
* \brief Header defining the API for OQS AES
|
||||
*/
|
||||
|
||||
#ifndef __OQS_AES_H
|
||||
#define __OQS_AES_H
|
||||
|
||||
#include <stdint.h>
|
||||
#include <stdlib.h>
|
||||
|
||||
/**
|
||||
* Function to fill a key schedule given an initial key.
|
||||
*
|
||||
* @param key Initial Key.
|
||||
* @param schedule Abstract data structure for a key schedule.
|
||||
* @param forEncryption 1 if key schedule is for encryption, 0 if for decryption.
|
||||
*/
|
||||
void OQS_AES128_load_schedule(const uint8_t *key, void **schedule, int for_encryption);
|
||||
|
||||
/**
|
||||
* Function to free a key schedule.
|
||||
*
|
||||
* @param schedule Schedule generated with OQS_AES128_load_schedule().
|
||||
*/
|
||||
void OQS_AES128_free_schedule(void *schedule);
|
||||
|
||||
/**
|
||||
* Function to encrypt blocks of plaintext using ECB mode.
|
||||
* A schedule based on the key is generated and used internally.
|
||||
*
|
||||
* @param plaintext Plaintext to be encrypted.
|
||||
* @param plaintext_len Length on the plaintext in bytes. Must be a multiple of 16.
|
||||
* @param key Key to be used for encryption.
|
||||
* @param ciphertext Pointer to a block of memory which >= in size to the plaintext block. The result will be written here.
|
||||
*/
|
||||
void OQS_AES128_ECB_enc(const uint8_t *plaintext, const size_t plaintext_len, const uint8_t *key, uint8_t *ciphertext);
|
||||
|
||||
/**
|
||||
* Function to decrypt blocks of plaintext using ECB mode.
|
||||
* A schedule based on the key is generated and used internally.
|
||||
*
|
||||
* @param ciphertext Ciphertext to be decrypted.
|
||||
* @param ciphertext_len Length on the ciphertext in bytes. Must be a multiple of 16.
|
||||
* @param key Key to be used for encryption.
|
||||
* @param ciphertext Pointer to a block of memory which >= in size to the ciphertext block. The result will be written here.
|
||||
*/
|
||||
void OQS_AES128_ECB_dec(const uint8_t *ciphertext, const size_t ciphertext_len, const uint8_t *key, uint8_t *plaintext);
|
||||
|
||||
/**
|
||||
* Same as OQS_AES128_ECB_enc() except a schedule generated by
|
||||
* OQS_AES128_load_schedule() is passed rather then a key. This is faster
|
||||
* if the same schedule is used for multiple encryptions since it does
|
||||
* not have to be regenerated from the key.
|
||||
*/
|
||||
void OQS_AES128_ECB_enc_sch(const uint8_t *plaintext, const size_t plaintext_len, const void *schedule, uint8_t *ciphertext);
|
||||
|
||||
/**
|
||||
* Same as OQS_AES128_ECB_dec() except a schedule generated by
|
||||
* OQS_AES128_load_schedule() is passed rather then a key. This is faster
|
||||
* if the same schedule is used for multiple encryptions since it does
|
||||
* not have to be regenerated from the key.
|
||||
*/
|
||||
void OQS_AES128_ECB_dec_sch(const uint8_t *ciphertext, const size_t ciphertext_len, const void *schedule, uint8_t *plaintext);
|
||||
|
||||
#endif
|
||||
@@ -1,31 +0,0 @@
|
||||
#include "memecrypto.h"
|
||||
|
||||
#include <cstring>
|
||||
#include <stdio.h>
|
||||
|
||||
extern "C" void oqs_mhy128_enc_c(const uint8_t *plaintext, const void *_schedule, uint8_t *ciphertext);
|
||||
extern "C" void oqs_mhy128_dec_c(const uint8_t *ciphertext, const void *_schedule, uint8_t *plaintext);
|
||||
|
||||
static uint8_t dexor16(const uint8_t *c) {
|
||||
uint8_t ret = 0;
|
||||
for (int i = 0; i < 16; i++)
|
||||
ret ^= c[i];
|
||||
return ret;
|
||||
}
|
||||
|
||||
void memecrypto_prepare_key(const uint8_t *in, uint8_t *out) {
|
||||
for (int i = 0; i < 0xB0; i++)
|
||||
out[i] = dexor16(&in[0x10 * i]);
|
||||
}
|
||||
|
||||
void memecrypto_decrypt(const uint8_t *key, uint8_t *data) {
|
||||
uint8_t plaintext[16];
|
||||
oqs_mhy128_enc_c(data, key, plaintext);
|
||||
memcpy(data, plaintext, 16);
|
||||
}
|
||||
|
||||
void memecrypto_encrypt(const uint8_t *key, uint8_t *data) {
|
||||
uint8_t ciphertext[16];
|
||||
oqs_mhy128_dec_c(data, key, ciphertext);
|
||||
memcpy(data, ciphertext, 16);
|
||||
}
|
||||
@@ -1,12 +0,0 @@
|
||||
#ifndef MEMECRYPTO_H
|
||||
#define MEMECRYPTO_H
|
||||
|
||||
#include <cstdint>
|
||||
|
||||
void memecrypto_prepare_key(const uint8_t *in, uint8_t *out);
|
||||
|
||||
void memecrypto_decrypt(const uint8_t *key, uint8_t *data);
|
||||
|
||||
void memecrypto_encrypt(const uint8_t *key, uint8_t *data);
|
||||
|
||||
#endif //MEMECRYPTO_H
|
||||
@@ -1,146 +0,0 @@
|
||||
#include "metadata.h"
|
||||
|
||||
#include <cstring>
|
||||
#include <random>
|
||||
#include <stdio.h>
|
||||
|
||||
#include "memecrypto.h"
|
||||
#include "metadatastringdec.h"
|
||||
|
||||
unsigned char initial_prev_xor[] = { 0xad, 0x2f, 0x42, 0x30, 0x67, 0x04, 0xb0, 0x9c, 0x9d, 0x2a, 0xc0, 0xba, 0x0e, 0xbf, 0xa5, 0x68 };
|
||||
|
||||
bool get_global_metadata_keys(uint8_t *src, size_t srcn, uint8_t *longkey, uint8_t *shortkey) {
|
||||
if (srcn != 0x4000)
|
||||
return false;
|
||||
|
||||
if (*(uint16_t *) (src + 0xc8) != 0xfc2e || *(uint16_t *) (src + 0xca) != 0x2cfe)
|
||||
return true;
|
||||
|
||||
auto offB00 = *(uint16_t *) (src + 0xd2);
|
||||
|
||||
for (size_t i = 0; i < 16; i++)
|
||||
shortkey[i] = src[offB00 + i] ^ src[0x3000 + i];
|
||||
|
||||
for (size_t i = 0; i < 0xb00; i++)
|
||||
longkey[i] = src[offB00 + 0x10 + i] ^ src[0x3000 + 0x10 + i] ^ shortkey[i % 16];
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
bool gen_global_metadata_key(uint8_t* src, size_t srcn) {
|
||||
if (srcn != 0x4000)
|
||||
return false;
|
||||
|
||||
#if 0
|
||||
std::vector<uint8_t> read_file(const char* n);
|
||||
auto data = read_file("xorpad.bin");
|
||||
memcpy(src, data.data(), 0x4000);
|
||||
|
||||
return false;
|
||||
#endif
|
||||
|
||||
std::mt19937_64 rand (0xDEADBEEF);
|
||||
|
||||
uint64_t* key = (uint64_t*)src;
|
||||
|
||||
for (size_t i = 0; i < srcn / sizeof(uint64_t); i++)
|
||||
key[i] = rand();
|
||||
|
||||
*(uint16_t *) (src + 0xc8) = 0xfc2e; // Magic
|
||||
*(uint16_t *) (src + 0xca) = 0x2cfe; // Magic
|
||||
*(uint16_t *) (src + 0xd2) = rand() & 0x1FFFu; // Just some random value
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
void decrypt_global_metadata_inner(uint8_t *data, size_t size) {
|
||||
uint8_t longkey[0xB00];
|
||||
uint8_t longkeyp[0xB0];
|
||||
uint8_t shortkey[16];
|
||||
get_global_metadata_keys(data + size - 0x4000, 0x4000, longkey, shortkey);
|
||||
for (int i = 0; i < 16; i++)
|
||||
shortkey[i] ^= initial_prev_xor[i];
|
||||
memecrypto_prepare_key(longkey, longkeyp);
|
||||
|
||||
auto perentry = (uint32_t) (size / 0x100 / 0x40);
|
||||
for (int i = 0; i < 0x100; i++) {
|
||||
auto off = (0x40u * perentry) * i;
|
||||
|
||||
uint8_t prev[16];
|
||||
memcpy(prev, shortkey, 16);
|
||||
for (int j = 0; j < 4; j++) {
|
||||
uint8_t curr[16];
|
||||
memcpy(curr, &data[off + j * 0x10], 16);
|
||||
|
||||
memecrypto_decrypt(longkeyp, curr);
|
||||
|
||||
for (int k = 0; k < 16; k++)
|
||||
curr[k] ^= prev[k];
|
||||
|
||||
memcpy(prev, &data[off + j * 0x10], 16);
|
||||
memcpy(&data[off + j * 0x10], curr, 16);
|
||||
}
|
||||
}
|
||||
|
||||
uint8_t literal_dec_key[0x5000];
|
||||
recrypt_global_metadata_header_string_fields(data, size, literal_dec_key);
|
||||
recrypt_global_metadata_header_string_literals(data, size, literal_dec_key);
|
||||
}
|
||||
|
||||
extern "C" int decrypt_global_metadata(uint8_t *data, size_t size) {
|
||||
try {
|
||||
decrypt_global_metadata_inner(data, size);
|
||||
return 0;
|
||||
} catch (...) {
|
||||
return -1;
|
||||
}
|
||||
}
|
||||
|
||||
void encrypt_global_metadata_inner(uint8_t* data, size_t size) {
|
||||
uint8_t literal_dec_key[0x5000];
|
||||
|
||||
gen_global_metadata_key(data + size - 0x4000, 0x4000);
|
||||
|
||||
generate_key_for_global_metadata_header_string(data, size, literal_dec_key);
|
||||
|
||||
recrypt_global_metadata_header_string_literals(data, size, literal_dec_key);
|
||||
recrypt_global_metadata_header_string_fields(data, size, literal_dec_key);
|
||||
|
||||
uint8_t longkey[0xB00];
|
||||
uint8_t longkeyp[0xB0];
|
||||
uint8_t shortkey[16];
|
||||
|
||||
get_global_metadata_keys(data + size - 0x4000, 0x4000, longkey, shortkey);
|
||||
for (int i = 0; i < 16; i++)
|
||||
shortkey[i] ^= initial_prev_xor[i];
|
||||
memecrypto_prepare_key(longkey, longkeyp);
|
||||
|
||||
auto perentry = (uint32_t) (size / 0x100 / 0x40);
|
||||
for (int i = 0; i < 0x100; i++) {
|
||||
auto off = (0x40u * perentry) * i;
|
||||
|
||||
uint8_t prev[16];
|
||||
memcpy(prev, shortkey, 16);
|
||||
for (int j = 0; j < 4; j++) {
|
||||
uint8_t curr[16];
|
||||
memcpy(curr, &data[off + j * 0x10], 16);
|
||||
|
||||
for (int k = 0; k < 16; k++)
|
||||
curr[k] ^= prev[k];
|
||||
|
||||
memecrypto_encrypt(longkeyp, curr);
|
||||
|
||||
memcpy(prev, curr, 16);
|
||||
memcpy(&data[off + j * 0x10], curr, 16);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" int encrypt_global_metadata(uint8_t* data, size_t size) {
|
||||
try {
|
||||
encrypt_global_metadata_inner(data, size);
|
||||
return 0;
|
||||
} catch (...) {
|
||||
return -1;
|
||||
}
|
||||
}
|
||||
@@ -1,10 +0,0 @@
|
||||
#ifndef METADATA_H
|
||||
#define METADATA_H
|
||||
|
||||
#include <cstdint>
|
||||
#include <cstdlib>
|
||||
|
||||
extern "C" int decrypt_global_metadata(uint8_t *data, size_t size);
|
||||
extern "C" int encrypt_global_metadata(uint8_t *data, size_t size);
|
||||
|
||||
#endif //METADATA_H
|
||||
@@ -1,121 +0,0 @@
|
||||
#include "metadatastringdec.h"
|
||||
|
||||
#include <stdexcept>
|
||||
#include <random>
|
||||
#include <stdio.h>
|
||||
|
||||
struct m_header_fields {
|
||||
char filler1[0x18];
|
||||
uint32_t stringLiteralDataOffset; // 18
|
||||
uint32_t stringLiteralDataCount; // 1c
|
||||
uint32_t stringLiteralOffset; // 20
|
||||
uint32_t stringLiteralCount; // 24
|
||||
char filler2[0xd8 - 0x28];
|
||||
uint32_t stringOffset, stringCount;
|
||||
};
|
||||
|
||||
struct m_literal {
|
||||
uint32_t offset, length;
|
||||
};
|
||||
|
||||
void generate_key_for_global_metadata_header_string(uint8_t* data, size_t len, uint8_t* literal_dec_key) {
|
||||
if (len < sizeof(m_header_fields))
|
||||
throw std::out_of_range("data not big enough for global metadata header");
|
||||
|
||||
uint32_t values[0x12] = {
|
||||
*(uint32_t *) (data + 0x60),
|
||||
*(uint32_t *) (data + 0x64),
|
||||
*(uint32_t *) (data + 0x68),
|
||||
*(uint32_t *) (data + 0x6c),
|
||||
*(uint32_t *) (data + 0x140),
|
||||
*(uint32_t *) (data + 0x144),
|
||||
*(uint32_t *) (data + 0x148),
|
||||
*(uint32_t *) (data + 0x14c),
|
||||
*(uint32_t *) (data + 0x100),
|
||||
*(uint32_t *) (data + 0x104),
|
||||
*(uint32_t *) (data + 0x108),
|
||||
*(uint32_t *) (data + 0x10c),
|
||||
*(uint32_t *) (data + 0xf0),
|
||||
*(uint32_t *) (data + 0xf4),
|
||||
*(uint32_t *) (data + 8),
|
||||
*(uint32_t *) (data + 0xc),
|
||||
*(uint32_t *) (data + 0x10),
|
||||
*(uint32_t *) (data + 0x14)
|
||||
};
|
||||
|
||||
uint64_t seed = ((uint64_t) values[values[0] & 0xfu] << 0x20u) | values[(values[0x11] & 0xf) + 2];
|
||||
|
||||
std::mt19937_64 rand (seed);
|
||||
|
||||
for (int i = 0; i < 6; i++) // Skip
|
||||
rand();
|
||||
|
||||
auto key64 = (uint64_t *) literal_dec_key;
|
||||
for (int i = 0; i < 0xa00; i++)
|
||||
key64[i] = rand();
|
||||
}
|
||||
|
||||
void recrypt_global_metadata_header_string_fields(uint8_t *data, size_t len, uint8_t *literal_dec_key) {
|
||||
if (len < sizeof(m_header_fields))
|
||||
throw std::out_of_range("data not big enough for global metadata header");
|
||||
|
||||
uint32_t values[0x12] = {
|
||||
*(uint32_t *) (data + 0x60),
|
||||
*(uint32_t *) (data + 0x64),
|
||||
*(uint32_t *) (data + 0x68),
|
||||
*(uint32_t *) (data + 0x6c),
|
||||
*(uint32_t *) (data + 0x140),
|
||||
*(uint32_t *) (data + 0x144),
|
||||
*(uint32_t *) (data + 0x148),
|
||||
*(uint32_t *) (data + 0x14c),
|
||||
*(uint32_t *) (data + 0x100),
|
||||
*(uint32_t *) (data + 0x104),
|
||||
*(uint32_t *) (data + 0x108),
|
||||
*(uint32_t *) (data + 0x10c),
|
||||
*(uint32_t *) (data + 0xf0),
|
||||
*(uint32_t *) (data + 0xf4),
|
||||
*(uint32_t *) (data + 8),
|
||||
*(uint32_t *) (data + 0xc),
|
||||
*(uint32_t *) (data + 0x10),
|
||||
*(uint32_t *) (data + 0x14)
|
||||
};
|
||||
|
||||
uint64_t seed = ((uint64_t) values[values[0] & 0xfu] << 0x20u) | values[(values[0x11] & 0xf) + 2];
|
||||
|
||||
std::mt19937_64 rand (seed);
|
||||
|
||||
auto header = (m_header_fields *) data;
|
||||
header->stringCount ^= (uint32_t) rand();
|
||||
header->stringOffset ^= (uint32_t) rand();
|
||||
rand();
|
||||
header->stringLiteralOffset ^= (uint32_t) rand();
|
||||
header->stringLiteralDataCount ^= (uint32_t) rand();
|
||||
header->stringLiteralDataOffset ^= (uint32_t) rand();
|
||||
|
||||
auto key64 = (uint64_t *) literal_dec_key;
|
||||
for (int i = 0; i < 0xa00; i++)
|
||||
key64[i] = rand();
|
||||
}
|
||||
|
||||
void recrypt_global_metadata_header_string_literals(uint8_t *data, size_t len, uint8_t *literal_dec_key) {
|
||||
if (len < sizeof(m_header_fields))
|
||||
throw std::out_of_range("data not big enough for global metadata header");
|
||||
|
||||
auto header = (m_header_fields *) data;
|
||||
if ((size_t) header->stringLiteralCount + header->stringLiteralOffset > len)
|
||||
throw std::out_of_range("file trimmed or string literal offset/count field invalid");
|
||||
|
||||
auto literals = (m_literal *) (data + header->stringLiteralOffset);
|
||||
auto count = header->stringLiteralCount / sizeof(m_literal);
|
||||
for (size_t i = 0; i < count; i++) {
|
||||
auto slen = literals[i].length;
|
||||
uint8_t *str = data + header->stringLiteralDataOffset + literals[i].offset;
|
||||
uint8_t *okey = literal_dec_key + (i % 0x2800);
|
||||
|
||||
if ((size_t) header->stringLiteralDataOffset + literals[i].offset + slen > len)
|
||||
throw std::out_of_range("file trimmed or contains invalid string entry");
|
||||
|
||||
for (size_t j = 0; j < slen; j++)
|
||||
str[j] ^= literal_dec_key[(j + 0x1400u) % 0x5000u] ^ (okey[j % 0x2800u] + (uint8_t) j);
|
||||
}
|
||||
}
|
||||
@@ -1,13 +0,0 @@
|
||||
#ifndef METADATASTRINGDEC_H
|
||||
#define METADATASTRINGDEC_H
|
||||
|
||||
#include <cstdint>
|
||||
#include <cstdlib>
|
||||
|
||||
void recrypt_global_metadata_header_string_fields(uint8_t *data, size_t len, uint8_t *literal_dec_key);
|
||||
|
||||
void recrypt_global_metadata_header_string_literals(uint8_t *data, size_t len, uint8_t *literal_dec_key);
|
||||
|
||||
void generate_key_for_global_metadata_header_string(uint8_t* data, size_t len, uint8_t* literal_dec_key);
|
||||
|
||||
#endif //METADATASTRINGDEC_H
|
||||
@@ -1,22 +0,0 @@
|
||||
#[cfg(windows)]
|
||||
pub fn reopen_as_admin() {
|
||||
use std::process::{exit, Command};
|
||||
|
||||
let install = std::env::current_exe().unwrap();
|
||||
|
||||
println!("Opening as admin: {}", install.to_str().unwrap());
|
||||
|
||||
Command::new("powershell.exe")
|
||||
.arg("powershell")
|
||||
.arg(format!(
|
||||
"-command \"&{{Start-Process -filepath '{}' -verb runas}}\"",
|
||||
install.to_str().unwrap()
|
||||
))
|
||||
.spawn()
|
||||
.expect("Error starting exec as admin");
|
||||
|
||||
exit(0);
|
||||
}
|
||||
|
||||
#[cfg(target_os = "macos")]
|
||||
pub fn reopen_as_admin() {}
|
||||
@@ -1,49 +0,0 @@
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::path::PathBuf;
|
||||
use std::string::String;
|
||||
|
||||
// Config may not exist, or may be old, so it's okay if these are optional
|
||||
#[derive(Serialize, Deserialize, Debug, Default)]
|
||||
pub struct Configuration {
|
||||
pub toggle_grasscutter: Option<bool>,
|
||||
pub game_install_path: Option<String>,
|
||||
pub grasscutter_with_game: Option<bool>,
|
||||
pub grasscutter_path: Option<String>,
|
||||
pub java_path: Option<String>,
|
||||
pub close_action: Option<u64>,
|
||||
pub startup_launch: Option<bool>,
|
||||
pub last_ip: Option<String>,
|
||||
pub last_port: Option<String>,
|
||||
pub language: Option<String>,
|
||||
pub custom_background: Option<String>,
|
||||
pub use_theme_background: Option<bool>,
|
||||
pub cert_generated: Option<bool>,
|
||||
pub theme: Option<String>,
|
||||
pub https_enabled: Option<bool>,
|
||||
pub debug_enabled: Option<bool>,
|
||||
pub patch_rsa: Option<bool>,
|
||||
pub use_internal_proxy: Option<bool>,
|
||||
pub wipe_login: Option<bool>,
|
||||
pub horny_mode: Option<bool>,
|
||||
pub auto_mongodb: Option<bool>,
|
||||
pub un_elevated: Option<bool>,
|
||||
pub redirect_more: Option<bool>,
|
||||
pub launch_args: Option<String>,
|
||||
pub offline_mode: Option<bool>,
|
||||
}
|
||||
|
||||
pub fn config_path() -> PathBuf {
|
||||
let mut path = tauri::api::path::data_dir().unwrap();
|
||||
path.push("cultivation");
|
||||
path.push("configuration.json");
|
||||
|
||||
path
|
||||
}
|
||||
|
||||
pub fn get_config() -> Configuration {
|
||||
let path = config_path();
|
||||
let config = std::fs::read_to_string(path).unwrap_or("{}".to_string());
|
||||
let config: Configuration = serde_json::from_str(&config).unwrap_or_default();
|
||||
|
||||
config
|
||||
}
|
||||
@@ -1,117 +0,0 @@
|
||||
use once_cell::sync::Lazy;
|
||||
|
||||
use std::cmp::min;
|
||||
use std::fs::File;
|
||||
use std::io::Write;
|
||||
use std::sync::Mutex;
|
||||
|
||||
use futures_util::StreamExt;
|
||||
|
||||
// This will create a downloads list that will be used to check if we should continue downloading the file
|
||||
static DOWNLOADS: Lazy<Mutex<Vec<String>>> = Lazy::new(|| Mutex::new(Vec::new()));
|
||||
|
||||
// Lots of help from: https://gist.github.com/giuliano-oliveira/4d11d6b3bb003dba3a1b53f43d81b30d
|
||||
// and docs ofc
|
||||
#[tauri::command]
|
||||
pub async fn download_file(window: tauri::Window, url: &str, path: &str) -> Result<(), String> {
|
||||
// Reqwest setup
|
||||
let res = match reqwest::get(url).await {
|
||||
Ok(r) => r,
|
||||
Err(_e) => {
|
||||
emit_download_err(window, format!("Failed to request {}", url), path);
|
||||
return Err(format!("Failed to request {}", url));
|
||||
}
|
||||
};
|
||||
let total_size = res.content_length().unwrap_or(0);
|
||||
|
||||
// Create file path
|
||||
let mut file = match File::create(path) {
|
||||
Ok(f) => f,
|
||||
Err(_e) => {
|
||||
emit_download_err(window, format!("Failed to create file '{}'", path), path);
|
||||
return Err(format!("Failed to create file '{}'", path));
|
||||
}
|
||||
};
|
||||
let mut downloaded: u64 = 0;
|
||||
let mut total_downloaded: u64 = 0;
|
||||
|
||||
// File stream
|
||||
let mut stream = res.bytes_stream();
|
||||
|
||||
// Assuming all goes well, add to the downloads list
|
||||
DOWNLOADS.lock().unwrap().push(path.to_string());
|
||||
|
||||
// Await chunks
|
||||
while let Some(item) = stream.next().await {
|
||||
// Stop the loop if the download is removed from the list
|
||||
if !DOWNLOADS.lock().unwrap().contains(&path.to_string()) {
|
||||
break;
|
||||
}
|
||||
|
||||
let chunk = match item {
|
||||
Ok(itm) => itm,
|
||||
Err(e) => {
|
||||
emit_download_err(window, "Error while downloading file".to_string(), path);
|
||||
return Err(format!("Error while downloading file: {}", e));
|
||||
}
|
||||
};
|
||||
let vect = &chunk.to_vec()[..];
|
||||
|
||||
// Write bytes
|
||||
match file.write_all(vect) {
|
||||
Ok(x) => x,
|
||||
Err(e) => {
|
||||
emit_download_err(window, "Error while writing file".to_string(), path);
|
||||
return Err(format!("Error while writing file: {}", e));
|
||||
}
|
||||
}
|
||||
|
||||
// New progress
|
||||
let new = min(downloaded + (chunk.len() as u64), total_size);
|
||||
downloaded = new;
|
||||
|
||||
total_downloaded += chunk.len() as u64;
|
||||
|
||||
let mut res_hash = std::collections::HashMap::new();
|
||||
|
||||
res_hash.insert("downloaded".to_string(), downloaded.to_string());
|
||||
res_hash.insert("total".to_string(), total_size.to_string());
|
||||
res_hash.insert("path".to_string(), path.to_string());
|
||||
res_hash.insert("total_downloaded".to_string(), total_downloaded.to_string());
|
||||
|
||||
// Create event to send to frontend
|
||||
window.emit("download_progress", &res_hash).unwrap();
|
||||
}
|
||||
|
||||
// One more "finish" event
|
||||
window.emit("download_finished", &path).unwrap();
|
||||
|
||||
// We are done
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn emit_download_err(window: tauri::Window, msg: String, path: &str) {
|
||||
let mut res_hash = std::collections::HashMap::new();
|
||||
|
||||
res_hash.insert("error".to_string(), msg);
|
||||
res_hash.insert("path".to_string(), path.to_string());
|
||||
|
||||
window.emit("download_error", &res_hash).unwrap();
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn stop_download(path: String) {
|
||||
// Check if the path is in the downloads list
|
||||
let mut downloads = DOWNLOADS.lock().unwrap();
|
||||
let index = downloads.iter().position(|x| x == &path);
|
||||
|
||||
// Remove from list
|
||||
if let Some(i) = index {
|
||||
downloads.remove(i);
|
||||
}
|
||||
|
||||
// Delete the file from disk
|
||||
if let Err(_e) = std::fs::remove_file(&path) {
|
||||
// Do nothing
|
||||
}
|
||||
}
|
||||
@@ -1,169 +0,0 @@
|
||||
use file_diff::diff;
|
||||
use std::fs;
|
||||
use std::io::{Read, Write};
|
||||
use std::path::PathBuf;
|
||||
|
||||
#[tauri::command]
|
||||
pub fn rename(path: String, new_name: String) {
|
||||
let mut new_path = path.clone();
|
||||
|
||||
// Check if file/folder to replace exists
|
||||
if fs::metadata(&path).is_err() {
|
||||
return;
|
||||
}
|
||||
|
||||
// Check if path uses forward or back slashes
|
||||
if new_path.contains('\\') {
|
||||
new_path = path.replace('\\', "/");
|
||||
}
|
||||
|
||||
let path_replaced = &path.replace(new_path.split('/').last().unwrap(), &new_name);
|
||||
|
||||
match fs::rename(&path, path_replaced) {
|
||||
Ok(_) => {
|
||||
println!("Renamed {} to {}", &path, path_replaced);
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Error: {}", e);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn dir_create(path: String) {
|
||||
fs::create_dir_all(path).unwrap();
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn dir_exists(path: &str) -> bool {
|
||||
let path_buf = PathBuf::from(path);
|
||||
fs::metadata(path_buf).is_ok()
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn dir_is_empty(path: &str) -> bool {
|
||||
let path_buf = PathBuf::from(path);
|
||||
fs::read_dir(path_buf).unwrap().count() == 0
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn dir_delete(path: &str) {
|
||||
let path_buf = PathBuf::from(path);
|
||||
fs::remove_dir_all(path_buf).unwrap();
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn are_files_identical(path1: &str, path2: &str) -> bool {
|
||||
diff(path1, path2)
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn copy_file(path: String, new_path: String) -> bool {
|
||||
let filename = &path.split('/').last().unwrap();
|
||||
let path_buf = PathBuf::from(&path);
|
||||
|
||||
// If the new path doesn't exist, create it.
|
||||
if !dir_exists(PathBuf::from(&new_path).pop().to_string().as_str()) {
|
||||
std::fs::create_dir_all(&new_path).unwrap();
|
||||
}
|
||||
|
||||
// Copy old to new
|
||||
match std::fs::copy(path_buf, format!("{}/{}", new_path, filename)) {
|
||||
Ok(_) => true,
|
||||
Err(e) => {
|
||||
println!("Failed to copy file: {}", e);
|
||||
println!("Path: {}", path);
|
||||
println!("New Path: {}", new_path);
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn copy_file_with_new_name(path: String, new_path: String, new_name: String) -> bool {
|
||||
let mut new_path_buf = PathBuf::from(&new_path);
|
||||
let path_buf = PathBuf::from(&path);
|
||||
|
||||
// If the new path doesn't exist, create it.
|
||||
if !dir_exists(PathBuf::from(&new_path).pop().to_string().as_str()) {
|
||||
match std::fs::create_dir_all(&new_path) {
|
||||
Ok(_) => {}
|
||||
Err(e) => {
|
||||
println!("Failed to create directory: {}", e);
|
||||
return false;
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
new_path_buf.push(new_name);
|
||||
|
||||
// Copy old to new
|
||||
match std::fs::copy(path_buf, &new_path_buf) {
|
||||
Ok(_) => true,
|
||||
Err(e) => {
|
||||
println!("Failed to copy file: {}", e);
|
||||
println!("Path: {}", path);
|
||||
println!("New Path: {}", new_path);
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn delete_file(path: String) -> bool {
|
||||
let path_buf = PathBuf::from(&path);
|
||||
|
||||
match std::fs::remove_file(path_buf) {
|
||||
Ok(_) => true,
|
||||
Err(e) => {
|
||||
println!("Failed to delete file: {}", e);
|
||||
false
|
||||
}
|
||||
};
|
||||
|
||||
false
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn read_file(path: String) -> String {
|
||||
let path_buf = PathBuf::from(&path);
|
||||
|
||||
let mut file = match fs::File::open(path_buf) {
|
||||
Ok(file) => file,
|
||||
Err(e) => {
|
||||
println!("Failed to open file {}: {}", &path, e);
|
||||
if path.contains("config") {
|
||||
// Server.ts won't print the error so handle the message here for the user
|
||||
println!("Server config not found or invalid. Be sure to run the server at least once to generate it before making edits.");
|
||||
}
|
||||
return String::new(); // Send back error for handling by the caller
|
||||
}
|
||||
};
|
||||
|
||||
let mut contents = String::new();
|
||||
file.read_to_string(&mut contents).unwrap();
|
||||
|
||||
contents
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn write_file(path: String, contents: String) {
|
||||
let path_buf = PathBuf::from(&path);
|
||||
|
||||
// Create file if it exists, otherwise just open and rewrite
|
||||
let mut file = match fs::File::create(path_buf) {
|
||||
Ok(file) => file,
|
||||
Err(e) => {
|
||||
println!("Failed to open file: {}", e);
|
||||
return;
|
||||
}
|
||||
};
|
||||
|
||||
// Write contents to file
|
||||
match file.write_all(contents.as_bytes()) {
|
||||
Ok(_) => (),
|
||||
Err(e) => {
|
||||
println!("Failed to write to file: {}", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,95 +0,0 @@
|
||||
use crate::file_helpers;
|
||||
use crate::web;
|
||||
use std::collections::HashMap;
|
||||
use std::fs::read_dir;
|
||||
use std::io::Read;
|
||||
use std::path::PathBuf;
|
||||
|
||||
static SITE_URL: &str = "https://gamebanana.com";
|
||||
|
||||
#[tauri::command]
|
||||
pub async fn get_download_links(mod_id: String) -> String {
|
||||
web::query(format!("{}/apiv9/Mod/{}/DownloadPage", SITE_URL, mod_id).as_str()).await
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub async fn list_submissions(mode: String, page: String, search: String) -> String {
|
||||
if search.is_empty() {
|
||||
web::query(
|
||||
format!(
|
||||
"{}/apiv9/Util/Game/Submissions?_idGameRow=8552&_nPage={}&_nPerpage=50&_sMode={}",
|
||||
SITE_URL, page, mode
|
||||
)
|
||||
.as_str(),
|
||||
)
|
||||
.await
|
||||
} else {
|
||||
web::query(
|
||||
format!(
|
||||
"{}/apiv11/Util/Search/Results?_nPage={}&_sOrder=best_match&_idGameRow=8552&_sSearchString={}&_csvFields=name,description,article,attribs,studio,owner,credits",
|
||||
SITE_URL, page, search
|
||||
)
|
||||
.as_str()
|
||||
)
|
||||
.await
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub async fn list_mods(path: String) -> HashMap<String, String> {
|
||||
let mut path_buf = PathBuf::from(path);
|
||||
|
||||
// If the path includes a file, remove it
|
||||
if path_buf.file_name().is_some() {
|
||||
path_buf.pop();
|
||||
}
|
||||
|
||||
// Ensure we are in the Mods folder
|
||||
path_buf.push("Mods");
|
||||
|
||||
// Check if dir is empty
|
||||
if file_helpers::dir_is_empty(path_buf.to_str().unwrap()) {
|
||||
return HashMap::new();
|
||||
}
|
||||
|
||||
let mut mod_info_files = vec![];
|
||||
let mut mod_info_strings = HashMap::new();
|
||||
|
||||
for entry in read_dir(path_buf).unwrap() {
|
||||
let entry = entry.unwrap();
|
||||
let path = entry.path();
|
||||
|
||||
// Check each dir for a modinfo.json file
|
||||
if path.is_dir() {
|
||||
let mut mod_info_path = path.clone();
|
||||
mod_info_path.push("modinfo.json");
|
||||
if mod_info_path.exists() {
|
||||
// Push path AND file contents into the hashmap using path as key
|
||||
mod_info_files.push(mod_info_path.to_str().unwrap().to_string());
|
||||
} else {
|
||||
// No modinfo, but we can still push a JSON obj with the folder name
|
||||
mod_info_strings.insert(
|
||||
path.to_str().unwrap().to_string(),
|
||||
format!(
|
||||
"{{ \"name\": \"{}\" }}",
|
||||
path.file_name().unwrap().to_str().unwrap()
|
||||
),
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Read each modinfo.json file
|
||||
for mod_info_file in mod_info_files {
|
||||
let mut mod_info_string = String::new();
|
||||
|
||||
// It is safe to unwrap here since we *know* that the file exists
|
||||
let mut file = std::fs::File::open(&mod_info_file).unwrap();
|
||||
file.read_to_string(&mut mod_info_string).unwrap();
|
||||
|
||||
// Push into hashmap using path as key
|
||||
mod_info_strings.insert(mod_info_file, mod_info_string);
|
||||
}
|
||||
|
||||
mod_info_strings
|
||||
}
|
||||
@@ -1,58 +0,0 @@
|
||||
use crate::system_helpers::*;
|
||||
use std::path::{Path, PathBuf};
|
||||
|
||||
#[tauri::command]
|
||||
pub async fn get_lang(window: tauri::Window, lang: String) -> String {
|
||||
let lang = lang.to_lowercase();
|
||||
|
||||
// Send contents of language file back
|
||||
let lang_path: PathBuf = [&install_location(), "lang", &format!("{}.json", lang)]
|
||||
.iter()
|
||||
.collect();
|
||||
match std::fs::read_to_string(lang_path) {
|
||||
Ok(x) => x,
|
||||
Err(e) => {
|
||||
emit_lang_err(window, format!("Failed to read language file: {}", e));
|
||||
"".to_string()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub async fn get_languages() -> std::collections::HashMap<String, String> {
|
||||
// for each lang file, set the key as the filename and the value as the lang_name contained in the file
|
||||
let mut languages = std::collections::HashMap::new();
|
||||
|
||||
let lang_files = std::fs::read_dir(Path::new(&install_location()).join("lang")).unwrap();
|
||||
|
||||
for entry in lang_files {
|
||||
let entry = entry.unwrap();
|
||||
let path = entry.path();
|
||||
let filename = path
|
||||
.file_name()
|
||||
.unwrap_or_else(|| panic!("Failed to get filename from path: {:?}", path))
|
||||
.to_str()
|
||||
.unwrap_or_else(|| panic!("Failed to convert filename to string: {:?}", path))
|
||||
.to_string();
|
||||
|
||||
let content = match std::fs::read_to_string(&path) {
|
||||
Ok(x) => x,
|
||||
Err(e) => {
|
||||
println!("Failed to read language file: {}", e);
|
||||
break;
|
||||
}
|
||||
};
|
||||
|
||||
languages.insert(filename.to_string(), content);
|
||||
}
|
||||
|
||||
languages
|
||||
}
|
||||
|
||||
pub fn emit_lang_err(window: tauri::Window, msg: String) {
|
||||
let mut res_hash = std::collections::HashMap::new();
|
||||
|
||||
res_hash.insert("error".to_string(), msg);
|
||||
|
||||
window.emit("lang_error", &res_hash).unwrap();
|
||||
}
|
||||
@@ -1,538 +0,0 @@
|
||||
#![cfg_attr(
|
||||
all(not(debug_assertions), target_os = "windows"),
|
||||
windows_subsystem = "windows"
|
||||
)]
|
||||
|
||||
use args::{Args, ArgsError};
|
||||
use file_helpers::dir_exists;
|
||||
|
||||
use once_cell::sync::Lazy;
|
||||
use proxy::set_proxy_addr;
|
||||
use std::fs;
|
||||
use std::io::Write;
|
||||
use std::{collections::HashMap, sync::Mutex};
|
||||
use tauri::api::path::data_dir;
|
||||
use tauri::async_runtime::block_on;
|
||||
|
||||
use std::thread;
|
||||
use sysinfo::{Pid, ProcessExt, System, SystemExt};
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
use crate::admin::reopen_as_admin;
|
||||
#[cfg(target_os = "windows")]
|
||||
use system_helpers::is_elevated;
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
use std::{
|
||||
thread::{sleep, JoinHandle},
|
||||
time::{Duration, Instant},
|
||||
};
|
||||
|
||||
mod admin;
|
||||
mod config;
|
||||
mod downloader;
|
||||
mod file_helpers;
|
||||
mod gamebanana;
|
||||
mod lang;
|
||||
mod patch;
|
||||
mod proxy;
|
||||
mod release;
|
||||
mod system_helpers;
|
||||
mod unzip;
|
||||
mod web;
|
||||
|
||||
static WATCH_GAME_PROCESS: Lazy<Mutex<String>> = Lazy::new(|| Mutex::new(String::new()));
|
||||
static WATCH_GRASSCUTTER_PROCESS: Lazy<Mutex<String>> = Lazy::new(|| Mutex::new(String::new()));
|
||||
static GC_PID: std::sync::Mutex<usize> = Mutex::new(696969);
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub static AAGL_THREAD: Lazy<Mutex<Option<JoinHandle<()>>>> = Lazy::new(|| Mutex::new(None));
|
||||
|
||||
fn try_flush() {
|
||||
std::io::stdout().flush().unwrap_or(())
|
||||
}
|
||||
|
||||
async fn parse_args(inp: &Vec<String>) -> Result<Args, ArgsError> {
|
||||
let mut args = Args::new(
|
||||
"Cultivation",
|
||||
"Private server helper program for an Anime Game",
|
||||
);
|
||||
args.flag("h", "help", "Print various CLI args");
|
||||
args.flag("p", "proxy", "Start the proxy server");
|
||||
args.flag("G", "launch-game", "Launch the game");
|
||||
args.flag("o", "other-redirects", "Redirect other certain anime games");
|
||||
args.flag(
|
||||
"A",
|
||||
"no-admin",
|
||||
"Launch without requiring admin permissions",
|
||||
);
|
||||
args.flag(
|
||||
"g",
|
||||
"no-gui",
|
||||
"Run in CLI mode. Requires -A to be passed as well.",
|
||||
);
|
||||
args.flag("s", "server", "Launch the configured GC server");
|
||||
args.flag(
|
||||
"P",
|
||||
"patch",
|
||||
"Patch your game before launching, with whatever your game version needs",
|
||||
);
|
||||
args.flag(
|
||||
"N",
|
||||
"non-elevated-game",
|
||||
"Launch the game without admin permissions",
|
||||
);
|
||||
args.option(
|
||||
"H",
|
||||
"host",
|
||||
"Set host to connect to (eg. 'localhost:443' or 'my.awesomeserver.com:6969)",
|
||||
"SERVER_HOST",
|
||||
getopts::Occur::Optional,
|
||||
None,
|
||||
);
|
||||
args.option(
|
||||
"a",
|
||||
"game-args",
|
||||
"Arguments to pass to the game process, if launching it",
|
||||
r#""-opt-one -opt-two""#,
|
||||
getopts::Occur::Optional,
|
||||
None,
|
||||
);
|
||||
|
||||
args.parse(inp).unwrap();
|
||||
|
||||
let config = config::get_config();
|
||||
|
||||
if args.value_of("help")? {
|
||||
println!("{}", args.full_usage());
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
if args.value_of("launch-game")? {
|
||||
let game_path = config.game_install_path;
|
||||
let game_args: String = args.value_of("game-args").unwrap_or_default();
|
||||
|
||||
// Patch if needed
|
||||
if args.value_of("patch")? {
|
||||
patch::patch_game().await;
|
||||
}
|
||||
|
||||
if game_path.is_some() {
|
||||
if args.value_of("non-elevated-game")? {
|
||||
system_helpers::run_un_elevated(game_path.unwrap(), Some(game_args))
|
||||
} else {
|
||||
system_helpers::run_program(game_path.unwrap(), Some(game_args))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if args.value_of("server")? && config.grasscutter_path.is_some() && config.java_path.is_some() {
|
||||
let server_jar = config.grasscutter_path.unwrap();
|
||||
let mut server_path = server_jar.clone();
|
||||
// Strip jar name from path
|
||||
if server_path.contains('/') {
|
||||
// Can never panic because of if
|
||||
let len = server_jar.rfind('/').unwrap();
|
||||
server_path.truncate(len);
|
||||
} else if server_path.contains('\\') {
|
||||
let len = server_jar.rfind('\\').unwrap();
|
||||
server_path.truncate(len);
|
||||
}
|
||||
let java_path = config.java_path.unwrap();
|
||||
|
||||
system_helpers::run_jar(server_jar, server_path.to_string(), java_path);
|
||||
}
|
||||
|
||||
if args.value_of::<String>("host").is_ok() && !args.value_of::<String>("host")?.is_empty() {
|
||||
let host = args.value_of::<String>("host")?;
|
||||
set_proxy_addr(host);
|
||||
}
|
||||
|
||||
if args.value_of("proxy")? {
|
||||
println!("Starting proxy server...");
|
||||
let mut pathbuf = tauri::api::path::data_dir().unwrap();
|
||||
pathbuf.push("cultivation");
|
||||
pathbuf.push("ca");
|
||||
|
||||
if args.value_of("other_redirects")? {
|
||||
proxy::set_redirect_more();
|
||||
}
|
||||
|
||||
connect(8035, pathbuf.to_str().unwrap().to_string()).await;
|
||||
}
|
||||
|
||||
Ok(args)
|
||||
}
|
||||
|
||||
fn main() -> Result<(), ArgsError> {
|
||||
let args: Vec<String> = std::env::args().collect();
|
||||
let parsed_args = block_on(parse_args(&args)).unwrap();
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
if !is_elevated() && !parsed_args.value_of("no-admin")? {
|
||||
println!("===============================================================================");
|
||||
println!("You running as a non-elevated user. Some stuff will almost definitely not work.");
|
||||
println!("===============================================================================");
|
||||
|
||||
reopen_as_admin();
|
||||
}
|
||||
|
||||
// Setup datadir/cultivation just in case something went funky and it wasn't made
|
||||
if !dir_exists(data_dir().unwrap().join("cultivation").to_str().unwrap()) {
|
||||
fs::create_dir_all(data_dir().unwrap().join("cultivation")).unwrap();
|
||||
}
|
||||
|
||||
// Always set CWD to the location of the executable.
|
||||
let mut exe_path = std::env::current_exe().unwrap();
|
||||
exe_path.pop();
|
||||
std::env::set_current_dir(&exe_path).unwrap();
|
||||
|
||||
// For disabled GUI
|
||||
ctrlc::set_handler(|| {
|
||||
disconnect();
|
||||
block_on(patch::unpatch_game());
|
||||
std::process::exit(0);
|
||||
})
|
||||
.unwrap_or(());
|
||||
|
||||
if !parsed_args.value_of("no-gui")? {
|
||||
tauri::Builder::default()
|
||||
.invoke_handler(tauri::generate_handler![
|
||||
enable_process_watcher,
|
||||
enable_grasscutter_watcher,
|
||||
connect,
|
||||
disconnect,
|
||||
req_get,
|
||||
is_game_running,
|
||||
is_grasscutter_running,
|
||||
restart_grasscutter,
|
||||
get_theme_list,
|
||||
system_helpers::run_command,
|
||||
system_helpers::run_program,
|
||||
system_helpers::run_program_relative,
|
||||
system_helpers::start_service,
|
||||
system_helpers::service_status,
|
||||
system_helpers::stop_service,
|
||||
system_helpers::run_jar,
|
||||
system_helpers::run_jar_root,
|
||||
system_helpers::open_in_browser,
|
||||
system_helpers::install_location,
|
||||
system_helpers::is_elevated,
|
||||
system_helpers::set_migoto_target,
|
||||
system_helpers::set_migoto_delay,
|
||||
system_helpers::wipe_registry,
|
||||
system_helpers::get_platform,
|
||||
system_helpers::run_un_elevated,
|
||||
system_helpers::jvm_add_cap,
|
||||
system_helpers::jvm_remove_cap,
|
||||
patch::patch_game,
|
||||
patch::unpatch_game,
|
||||
proxy::set_proxy_addr,
|
||||
proxy::generate_ca_files,
|
||||
proxy::set_redirect_more,
|
||||
release::get_latest_release,
|
||||
unzip::unzip,
|
||||
file_helpers::rename,
|
||||
file_helpers::dir_create,
|
||||
file_helpers::dir_exists,
|
||||
file_helpers::dir_is_empty,
|
||||
file_helpers::dir_delete,
|
||||
file_helpers::copy_file,
|
||||
file_helpers::copy_file_with_new_name,
|
||||
file_helpers::delete_file,
|
||||
file_helpers::are_files_identical,
|
||||
file_helpers::read_file,
|
||||
file_helpers::write_file,
|
||||
downloader::download_file,
|
||||
downloader::stop_download,
|
||||
lang::get_lang,
|
||||
lang::get_languages,
|
||||
web::valid_url,
|
||||
web::web_get,
|
||||
gamebanana::get_download_links,
|
||||
gamebanana::list_submissions,
|
||||
gamebanana::list_mods
|
||||
])
|
||||
.on_window_event(|event| {
|
||||
if let tauri::WindowEvent::CloseRequested { .. } = event.event() {
|
||||
// Ensure all proxy stuff is handled
|
||||
disconnect();
|
||||
}
|
||||
})
|
||||
.run(tauri::generate_context!())
|
||||
.expect("error while running tauri application");
|
||||
} else {
|
||||
try_flush();
|
||||
println!("Press enter or CTRL-C twice to quit...");
|
||||
std::io::stdin().read_line(&mut String::new()).unwrap();
|
||||
}
|
||||
|
||||
// Always disconnect upon closing the program
|
||||
disconnect();
|
||||
|
||||
// Always unpatch game upon closing the program
|
||||
block_on(patch::unpatch_game());
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn is_game_running() -> bool {
|
||||
// Grab the game process name
|
||||
let proc = WATCH_GAME_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
!proc.is_empty()
|
||||
}
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = process;
|
||||
|
||||
window.listen("disable_process_watcher", |_e| {
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
});
|
||||
|
||||
println!("Starting process watcher...");
|
||||
|
||||
thread::spawn(move || {
|
||||
// Initial sleep for 8 seconds, since running 20 different injectors or whatever can take a while
|
||||
std::thread::sleep(std::time::Duration::from_secs(10));
|
||||
|
||||
let mut system = System::new_all();
|
||||
|
||||
loop {
|
||||
// Shorten loop timer to avoid user closing Cultivation before unpatching/proxy disconnecting
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
|
||||
// Refresh system info
|
||||
system.refresh_all();
|
||||
|
||||
// Grab the game process name
|
||||
let proc = WATCH_GAME_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
if !proc.is_empty() {
|
||||
let mut proc_with_name = system.processes_by_exact_name(&proc);
|
||||
let exists = proc_with_name.next().is_some();
|
||||
|
||||
// If the game process closes, disable the proxy.
|
||||
if !exists {
|
||||
println!("Game closed");
|
||||
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
disconnect();
|
||||
|
||||
window.emit("game_closed", &()).unwrap();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
// The library takes care of it
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {
|
||||
drop(process);
|
||||
thread::spawn(move || {
|
||||
let end_time = Instant::now() + Duration::from_secs(60);
|
||||
let game_thread = loop {
|
||||
let mut lock = AAGL_THREAD.lock().unwrap();
|
||||
if lock.is_some() {
|
||||
break lock.take().unwrap();
|
||||
}
|
||||
drop(lock);
|
||||
if end_time < Instant::now() {
|
||||
// If more than 60 seconds pass something has gone wrong
|
||||
println!("Waiting for game thread timed out");
|
||||
return;
|
||||
}
|
||||
// Otherwhise wait in order to not use too many CPU cycles
|
||||
sleep(Duration::from_millis(128));
|
||||
};
|
||||
game_thread.join().unwrap();
|
||||
println!("Game closed");
|
||||
|
||||
*WATCH_GAME_PROCESS.lock().unwrap() = "".to_string();
|
||||
disconnect();
|
||||
|
||||
window.emit("game_closed", &()).unwrap();
|
||||
});
|
||||
}
|
||||
|
||||
#[cfg(target_os = "macos")]
|
||||
#[tauri::command]
|
||||
fn enable_process_watcher(window: tauri::Window, process: String) {}
|
||||
|
||||
#[tauri::command]
|
||||
fn is_grasscutter_running() -> bool {
|
||||
// Grab the grasscutter process name
|
||||
let proc = WATCH_GRASSCUTTER_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
!proc.is_empty()
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
fn restart_grasscutter(window: tauri::Window) -> bool {
|
||||
let pid: usize = *GC_PID.lock().unwrap();
|
||||
let system = System::new_all();
|
||||
// Get the process
|
||||
if let Some(process) = system.process(Pid::from(pid)) {
|
||||
// Kill it
|
||||
if process.kill() {
|
||||
// Also kill the cmd it was open in
|
||||
if let Some(parent) = system.process(process.parent().unwrap()) {
|
||||
parent.kill();
|
||||
}
|
||||
for process_gc in system.processes_by_name("java") {
|
||||
if process_gc.cmd().last().unwrap().contains("grasscutter") {
|
||||
process_gc.kill();
|
||||
}
|
||||
}
|
||||
window.emit("disable_grasscutter_watcher", &()).unwrap();
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
// Start again
|
||||
window.emit("start_grasscutter", &()).unwrap();
|
||||
true
|
||||
} else {
|
||||
false
|
||||
}
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(unix)]
|
||||
#[tauri::command]
|
||||
fn restart_grasscutter(_window: tauri::Window) {
|
||||
// Placeholder text for imports
|
||||
let s = System::new();
|
||||
if let Some(process) = s.process(Pid::from(1337)) {
|
||||
println!("{}", process.name());
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn enable_grasscutter_watcher(window: tauri::Window, process: String) {
|
||||
let grasscutter_name = process.clone();
|
||||
let mut gc_pid = Pid::from(696969);
|
||||
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = process;
|
||||
|
||||
window.listen("disable_grasscutter_watcher", |_e| {
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = "".to_string();
|
||||
});
|
||||
|
||||
println!("Starting grasscutter watcher...");
|
||||
|
||||
thread::spawn(move || {
|
||||
// Initial sleep for 1 second while Grasscutter opens
|
||||
std::thread::sleep(std::time::Duration::from_secs(3));
|
||||
|
||||
let mut system = System::new_all();
|
||||
|
||||
for process_gc in system.processes_by_name("java") {
|
||||
if process_gc.cmd().last().unwrap().contains(&grasscutter_name) {
|
||||
gc_pid = process_gc.pid();
|
||||
*GC_PID.lock().unwrap() = gc_pid.into();
|
||||
window
|
||||
.emit("grasscutter_started", gc_pid.to_string())
|
||||
.unwrap();
|
||||
}
|
||||
}
|
||||
|
||||
loop {
|
||||
// Shorten loop timer to avoid user closing Cultivation before automatic stuff
|
||||
thread::sleep(std::time::Duration::from_secs(2));
|
||||
|
||||
// Refresh system info
|
||||
system.refresh_all();
|
||||
|
||||
// Grab the grasscutter process name
|
||||
let proc = WATCH_GRASSCUTTER_PROCESS.lock().unwrap().to_string();
|
||||
|
||||
if !proc.is_empty() {
|
||||
let mut exists = true;
|
||||
|
||||
if system.process(gc_pid).is_none() {
|
||||
exists = false;
|
||||
}
|
||||
|
||||
// If the grasscutter process closes.
|
||||
if !exists {
|
||||
println!("Grasscutter closed");
|
||||
|
||||
*WATCH_GRASSCUTTER_PROCESS.lock().unwrap() = "".to_string();
|
||||
|
||||
window.emit("grasscutter_closed", &()).unwrap();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn connect(port: u16, certificate_path: String) {
|
||||
// Log message to console.
|
||||
println!("Connecting to proxy...");
|
||||
|
||||
// Change proxy settings.
|
||||
proxy::connect_to_proxy(port);
|
||||
|
||||
// Create and start a proxy.
|
||||
proxy::create_proxy(port, certificate_path).await;
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
fn disconnect() {
|
||||
// Log message to console.
|
||||
println!("Disconnecting from proxy...");
|
||||
|
||||
// Change proxy settings.
|
||||
proxy::disconnect_from_proxy();
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn req_get(url: String) -> String {
|
||||
// Send a GET request to the specified URL and send the response body back to the client.
|
||||
web::query(&url.to_string()).await
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
async fn get_theme_list(data_dir: String) -> Vec<HashMap<String, String>> {
|
||||
let theme_loc = format!("{}/themes", data_dir);
|
||||
|
||||
// Ensure folder exists
|
||||
if !std::path::Path::new(&theme_loc).exists() {
|
||||
std::fs::create_dir_all(&theme_loc).unwrap();
|
||||
}
|
||||
|
||||
// Read each index.json folder in each theme folder
|
||||
let mut themes = Vec::new();
|
||||
|
||||
for entry in std::fs::read_dir(&theme_loc).unwrap() {
|
||||
let entry = entry.unwrap();
|
||||
let path = entry.path();
|
||||
|
||||
if path.is_dir() {
|
||||
let index_path = format!("{}/index.json", path.to_str().unwrap());
|
||||
|
||||
if std::path::Path::new(&index_path).exists() {
|
||||
let theme_json = std::fs::read_to_string(&index_path).unwrap();
|
||||
|
||||
let mut map = HashMap::new();
|
||||
|
||||
map.insert("json".to_string(), theme_json);
|
||||
map.insert("path".to_string(), path.to_str().unwrap().to_string());
|
||||
|
||||
// Push key-value pair containing "json" and "path"
|
||||
themes.push(map);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
themes
|
||||
}
|
||||
@@ -1,230 +0,0 @@
|
||||
use crate::config;
|
||||
use crate::file_helpers;
|
||||
use crate::system_helpers;
|
||||
use std::path::PathBuf;
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
use once_cell::sync::Lazy;
|
||||
#[cfg(target_os = "linux")]
|
||||
use std::sync::Arc;
|
||||
#[cfg(target_os = "linux")]
|
||||
use tokio::sync::Mutex;
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
static PATCH_STATE: Lazy<Arc<Mutex<Option<PatchState>>>> = Lazy::new(|| Arc::new(Mutex::new(None)));
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
enum PatchState {
|
||||
NotExist,
|
||||
Same,
|
||||
BakNotExist,
|
||||
BakExist,
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
use PatchState::*;
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
impl PatchState {
|
||||
fn to_wta(self) -> WhatToUnpach {
|
||||
let (mhyp_renamed, game_was_patched) = match self {
|
||||
NotExist => (false, true),
|
||||
Same => (false, true),
|
||||
BakNotExist => (true, true),
|
||||
BakExist => (false, false),
|
||||
};
|
||||
WhatToUnpach {
|
||||
mhyp_renamed,
|
||||
game_was_patched,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[derive(Debug, Clone)]
|
||||
struct WhatToUnpach {
|
||||
mhyp_renamed: bool,
|
||||
game_was_patched: bool,
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
pub async fn patch_game() -> bool {
|
||||
let patch_path = PathBuf::from(system_helpers::install_location()).join("patch/version.dll");
|
||||
|
||||
// Are we already patched with mhypbase? If so, that's fine, just continue as normal
|
||||
let game_is_patched = file_helpers::are_files_identical(
|
||||
patch_path.clone().to_str().unwrap(),
|
||||
PathBuf::from(get_game_rsa_path().await.unwrap())
|
||||
.join("mhypbase.dll")
|
||||
.to_str()
|
||||
.unwrap(),
|
||||
);
|
||||
|
||||
// Tell user they won't be unpatched with manual mhypbase patch
|
||||
if game_is_patched {
|
||||
println!(
|
||||
"You are already patched using mhypbase, so you will not be auto patched and unpatched!"
|
||||
);
|
||||
return true;
|
||||
}
|
||||
|
||||
// Copy the patch to game files
|
||||
let replaced = file_helpers::copy_file_with_new_name(
|
||||
patch_path.clone().to_str().unwrap().to_string(),
|
||||
get_game_rsa_path().await.unwrap(),
|
||||
String::from("version.dll"),
|
||||
);
|
||||
|
||||
if !replaced {
|
||||
return false;
|
||||
}
|
||||
|
||||
true
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub async fn patch_game() -> bool {
|
||||
let mut patch_state_mutex = PATCH_STATE.lock().await;
|
||||
if patch_state_mutex.is_some() {
|
||||
println!("Game already patched!");
|
||||
}
|
||||
|
||||
let patch_path = PathBuf::from(system_helpers::install_location()).join("patch/version.dll");
|
||||
let game_mhyp = PathBuf::from(get_game_rsa_path().await.unwrap()).join("mhypbase.dll");
|
||||
let game_mhyp_bak = PathBuf::from(get_game_rsa_path().await.unwrap()).join("mhypbase.dll.bak");
|
||||
|
||||
let patch_state = if !game_mhyp.exists() {
|
||||
NotExist
|
||||
} else if file_helpers::are_files_identical(
|
||||
patch_path.to_str().unwrap(),
|
||||
game_mhyp.to_str().unwrap(),
|
||||
) {
|
||||
Same
|
||||
} else if !game_mhyp_bak.exists() {
|
||||
BakNotExist
|
||||
} else {
|
||||
BakExist
|
||||
};
|
||||
|
||||
match patch_state {
|
||||
NotExist => {
|
||||
// No renaming needed.
|
||||
// Copy version.dll as mhypbase.dll
|
||||
file_helpers::copy_file_with_new_name(
|
||||
patch_path.clone().to_str().unwrap().to_string(),
|
||||
get_game_rsa_path().await.unwrap(),
|
||||
String::from("mhypbase.dll"),
|
||||
);
|
||||
}
|
||||
Same => {
|
||||
// No renaming needed.
|
||||
// No copying needed.
|
||||
println!("The game is already patched.");
|
||||
}
|
||||
BakNotExist => {
|
||||
// The current mhypbase.dll is most likely the original
|
||||
|
||||
// Rename mhypbase.dll to mhypbase.dll.bak
|
||||
file_helpers::rename(
|
||||
game_mhyp.to_str().unwrap().to_string(),
|
||||
game_mhyp_bak
|
||||
.file_name()
|
||||
.unwrap()
|
||||
.to_str()
|
||||
.unwrap()
|
||||
.to_string(),
|
||||
);
|
||||
// Copy version.dll as mhypbase.dll
|
||||
file_helpers::copy_file_with_new_name(
|
||||
patch_path.clone().to_str().unwrap().to_string(),
|
||||
get_game_rsa_path().await.unwrap(),
|
||||
String::from("mhypbase.dll"),
|
||||
);
|
||||
}
|
||||
BakExist => {
|
||||
// Can't rename. mhypbase.dll.bak already exists.
|
||||
// Can't patch. mhypbase.dll exists.
|
||||
// This SHOULD NOT HAPPEN
|
||||
println!("The game directory contains a mhypbase.dll, but it's different from the patch.");
|
||||
println!("Make sure you have the original mhypbase.dll.");
|
||||
println!("Delete any other copy, and place the original copy in the game directory with the original name.");
|
||||
}
|
||||
}
|
||||
|
||||
patch_state_mutex.replace(patch_state);
|
||||
patch_state.to_wta().game_was_patched
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
pub async fn unpatch_game() -> bool {
|
||||
// Just delete patch since it's not replacing any existing file
|
||||
let deleted = file_helpers::delete_file(
|
||||
PathBuf::from(get_game_rsa_path().await.unwrap())
|
||||
.join("version.dll")
|
||||
.to_str()
|
||||
.unwrap()
|
||||
.to_string(),
|
||||
);
|
||||
|
||||
deleted
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub async fn unpatch_game() -> bool {
|
||||
// TODO: Prevent the launcher from unpatching the game two times
|
||||
// This might be related to redirecting calls from the ts version of
|
||||
// unpatchGame to the rust version
|
||||
let mut patch_state_mutex = PATCH_STATE.lock().await;
|
||||
let patch_state = patch_state_mutex.take();
|
||||
if patch_state.is_none() {
|
||||
println!("Game not patched!");
|
||||
// NOTE: true is returned since otherwhise the launcher thinks unpatching failed
|
||||
// NOTE: actually it should be false since delete_file always returns false
|
||||
return false;
|
||||
}
|
||||
let patch_state = patch_state.unwrap();
|
||||
|
||||
let game_mhyp = PathBuf::from(get_game_rsa_path().await.unwrap()).join("mhypbase.dll");
|
||||
let game_mhyp_bak = PathBuf::from(get_game_rsa_path().await.unwrap()).join("mhypbase.dll.bak");
|
||||
|
||||
let WhatToUnpach {
|
||||
mhyp_renamed,
|
||||
game_was_patched,
|
||||
} = patch_state.to_wta();
|
||||
|
||||
// If the current mhypbase.dll is the patch, then delete it.
|
||||
let deleted = if game_was_patched {
|
||||
file_helpers::delete_file(game_mhyp.to_str().unwrap().to_string());
|
||||
true
|
||||
} else {
|
||||
false
|
||||
};
|
||||
// If we renamed the original mhypbase.dll to mhypbase.dll.bak
|
||||
// rename mhypbase.dll.bak back to mhypbase.dll
|
||||
if mhyp_renamed {
|
||||
file_helpers::rename(
|
||||
game_mhyp_bak.to_str().unwrap().to_string(),
|
||||
game_mhyp.to_str().unwrap().to_string(),
|
||||
)
|
||||
}
|
||||
|
||||
// NOTE: As mentioned in a note above, false should be returned if the function succeded
|
||||
// and true if it failed
|
||||
!deleted
|
||||
}
|
||||
|
||||
pub async fn get_game_rsa_path() -> Option<String> {
|
||||
let config = config::get_config();
|
||||
|
||||
config.game_install_path.as_ref()?;
|
||||
|
||||
let mut game_folder = PathBuf::from(config.game_install_path.unwrap());
|
||||
game_folder.pop();
|
||||
|
||||
Some(format!("{}/", game_folder.to_str().unwrap()).replace('\\', "/"))
|
||||
}
|
||||
@@ -1,521 +0,0 @@
|
||||
/*
|
||||
* Built on example code from:
|
||||
* https://github.com/omjadas/hudsucker/blob/main/examples/log.rs
|
||||
*/
|
||||
|
||||
use crate::config::get_config;
|
||||
|
||||
use once_cell::sync::Lazy;
|
||||
use std::{path::PathBuf, str::FromStr, sync::Mutex};
|
||||
|
||||
use hudsucker::{
|
||||
async_trait::async_trait,
|
||||
certificate_authority::RcgenAuthority,
|
||||
hyper::{Body, Request, Response, StatusCode},
|
||||
*,
|
||||
};
|
||||
use rcgen::*;
|
||||
|
||||
use std::fs;
|
||||
use std::net::SocketAddr;
|
||||
use std::path::Path;
|
||||
|
||||
use rustls_pemfile as pemfile;
|
||||
use tauri::{api::path::data_dir, http::Uri};
|
||||
|
||||
#[cfg(windows)]
|
||||
use registry::{Data, Hive, Security};
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
use crate::system_helpers::{AsRoot, SpawnItsFineReally};
|
||||
#[cfg(target_os = "linux")]
|
||||
use anime_launcher_sdk::{config::ConfigExt, genshin::config::Config};
|
||||
#[cfg(target_os = "linux")]
|
||||
use std::{fs::File, io::Write, process::Command};
|
||||
|
||||
async fn shutdown_signal() {
|
||||
tokio::signal::ctrl_c()
|
||||
.await
|
||||
.expect("Failed to install CTRL+C signal handler");
|
||||
}
|
||||
|
||||
// Global ver for getting server address.
|
||||
static SERVER: Lazy<Mutex<String>> = Lazy::new(|| Mutex::new("http://localhost:443".to_string()));
|
||||
static REDIRECT_MORE: Lazy<Mutex<bool>> = Lazy::new(|| Mutex::new(false));
|
||||
|
||||
#[derive(Clone)]
|
||||
struct ProxyHandler;
|
||||
|
||||
#[tauri::command]
|
||||
pub fn set_proxy_addr(addr: String) {
|
||||
if addr.contains(' ') {
|
||||
let addr2 = addr.replace(' ', "");
|
||||
*SERVER.lock().unwrap() = addr2;
|
||||
} else {
|
||||
*SERVER.lock().unwrap() = addr;
|
||||
}
|
||||
|
||||
println!("Set server to {}", SERVER.lock().unwrap());
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn set_redirect_more() {
|
||||
*REDIRECT_MORE.lock().unwrap() = true;
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl HttpHandler for ProxyHandler {
|
||||
async fn handle_request(
|
||||
&mut self,
|
||||
_ctx: &HttpContext,
|
||||
mut req: Request<Body>,
|
||||
) -> RequestOrResponse {
|
||||
let uri = req.uri().to_string();
|
||||
|
||||
let mut more = get_config().redirect_more;
|
||||
|
||||
if *REDIRECT_MORE.lock().unwrap() {
|
||||
more = Some(true);
|
||||
}
|
||||
|
||||
match more {
|
||||
Some(true) => {
|
||||
if uri.contains("hoyoverse.com")
|
||||
|| uri.contains("mihoyo.com")
|
||||
|| uri.contains("yuanshen.com")
|
||||
|| uri.contains("starrails.com")
|
||||
|| uri.contains("bhsr.com")
|
||||
|| uri.contains("bh3.com")
|
||||
|| uri.contains("honkaiimpact3.com")
|
||||
|| uri.contains("zenlesszonezero.com")
|
||||
{
|
||||
// Handle CONNECTs
|
||||
if req.method().as_str() == "CONNECT" {
|
||||
let builder = Response::builder()
|
||||
.header("DecryptEndpoint", "Created")
|
||||
.status(StatusCode::OK);
|
||||
let res = builder.body(()).unwrap();
|
||||
|
||||
// Respond to CONNECT
|
||||
*res.body()
|
||||
} else {
|
||||
let uri_path_and_query = req.uri().path_and_query().unwrap().as_str();
|
||||
// Create new URI.
|
||||
let new_uri =
|
||||
Uri::from_str(format!("{}{}", SERVER.lock().unwrap(), uri_path_and_query).as_str())
|
||||
.unwrap();
|
||||
// Set request URI to the new one.
|
||||
*req.uri_mut() = new_uri;
|
||||
}
|
||||
}
|
||||
}
|
||||
Some(false) => {
|
||||
if uri.contains("hoyoverse.com")
|
||||
|| uri.contains("mihoyo.com")
|
||||
|| uri.contains("yuanshen.com")
|
||||
{
|
||||
// Handle CONNECTs
|
||||
if req.method().as_str() == "CONNECT" {
|
||||
let builder = Response::builder()
|
||||
.header("DecryptEndpoint", "Created")
|
||||
.status(StatusCode::OK);
|
||||
let res = builder.body(()).unwrap();
|
||||
|
||||
// Respond to CONNECT
|
||||
*res.body()
|
||||
} else {
|
||||
let uri_path_and_query = req.uri().path_and_query().unwrap().as_str();
|
||||
// Create new URI.
|
||||
let new_uri =
|
||||
Uri::from_str(format!("{}{}", SERVER.lock().unwrap(), uri_path_and_query).as_str())
|
||||
.unwrap();
|
||||
// Set request URI to the new one.
|
||||
*req.uri_mut() = new_uri;
|
||||
}
|
||||
}
|
||||
}
|
||||
// Use default as fallback
|
||||
None => {
|
||||
if uri.contains("hoyoverse.com")
|
||||
|| uri.contains("mihoyo.com")
|
||||
|| uri.contains("yuanshen.com")
|
||||
{
|
||||
// Handle CONNECTs
|
||||
if req.method().as_str() == "CONNECT" {
|
||||
let builder = Response::builder()
|
||||
.header("DecryptEndpoint", "Created")
|
||||
.status(StatusCode::OK);
|
||||
let res = builder.body(()).unwrap();
|
||||
|
||||
// Respond to CONNECT
|
||||
*res.body()
|
||||
} else {
|
||||
let uri_path_and_query = req.uri().path_and_query().unwrap().as_str();
|
||||
// Create new URI.
|
||||
let new_uri =
|
||||
Uri::from_str(format!("{}{}", SERVER.lock().unwrap(), uri_path_and_query).as_str())
|
||||
.unwrap();
|
||||
// Set request URI to the new one.
|
||||
*req.uri_mut() = new_uri;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
req.into()
|
||||
}
|
||||
|
||||
async fn handle_response(
|
||||
&mut self,
|
||||
_context: &HttpContext,
|
||||
response: Response<Body>,
|
||||
) -> Response<Body> {
|
||||
response
|
||||
}
|
||||
|
||||
async fn should_intercept(&mut self, _ctx: &HttpContext, _req: &Request<Body>) -> bool {
|
||||
let uri = _req.uri().to_string();
|
||||
|
||||
let more = get_config().redirect_more;
|
||||
|
||||
match more {
|
||||
Some(true) => {
|
||||
uri.contains("hoyoverse.com")
|
||||
|| uri.contains("mihoyo.com")
|
||||
|| uri.contains("yuanshen.com")
|
||||
|| uri.contains("starrails.com")
|
||||
|| uri.contains("bhsr.com")
|
||||
|| uri.contains("bh3.com")
|
||||
|| uri.contains("honkaiimpact3.com")
|
||||
|| uri.contains("zenlesszonezero.com")
|
||||
}
|
||||
Some(false) => {
|
||||
uri.contains("hoyoverse.com") || uri.contains("mihoyo.com") || uri.contains("yuanshen.com")
|
||||
}
|
||||
None => {
|
||||
uri.contains("hoyoverse.com") || uri.contains("mihoyo.com") || uri.contains("yuanshen.com")
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Starts an HTTP(S) proxy server.
|
||||
*/
|
||||
pub async fn create_proxy(proxy_port: u16, certificate_path: String) {
|
||||
let cert_path = PathBuf::from(certificate_path);
|
||||
let pk_path = cert_path.join("private.key");
|
||||
let ca_path = cert_path.join("cert.crt");
|
||||
|
||||
// Get the certificate and private key.
|
||||
let mut private_key_bytes: &[u8] = &match fs::read(&pk_path) {
|
||||
// Try regenerating the CA stuff and read it again. If that doesn't work, quit.
|
||||
Ok(b) => b,
|
||||
Err(e) => {
|
||||
println!("Encountered {}. Regenerating CA cert and retrying...", e);
|
||||
generate_ca_files(&data_dir().unwrap().join("cultivation"));
|
||||
|
||||
fs::read(&pk_path).expect("Could not read private key")
|
||||
}
|
||||
};
|
||||
|
||||
let mut ca_cert_bytes: &[u8] = &match fs::read(&ca_path) {
|
||||
// Try regenerating the CA stuff and read it again. If that doesn't work, quit.
|
||||
Ok(b) => b,
|
||||
Err(e) => {
|
||||
println!("Encountered {}. Regenerating CA cert and retrying...", e);
|
||||
generate_ca_files(&data_dir().unwrap().join("cultivation"));
|
||||
|
||||
fs::read(&ca_path).expect("Could not read certificate")
|
||||
}
|
||||
};
|
||||
|
||||
// Parse the private key and certificate.
|
||||
let private_key = rustls::PrivateKey(
|
||||
pemfile::pkcs8_private_keys(&mut private_key_bytes)
|
||||
.expect("Failed to parse private key")
|
||||
.remove(0),
|
||||
);
|
||||
|
||||
let ca_cert = rustls::Certificate(
|
||||
pemfile::certs(&mut ca_cert_bytes)
|
||||
.expect("Failed to parse CA certificate")
|
||||
.remove(0),
|
||||
);
|
||||
|
||||
// Create the certificate authority.
|
||||
let authority = RcgenAuthority::new(private_key, ca_cert, 1_000)
|
||||
.expect("Failed to create Certificate Authority");
|
||||
|
||||
// Create an instance of the proxy.
|
||||
let proxy = ProxyBuilder::new()
|
||||
.with_addr(SocketAddr::from(([0, 0, 0, 0], proxy_port)))
|
||||
.with_rustls_client()
|
||||
.with_ca(authority)
|
||||
.with_http_handler(ProxyHandler)
|
||||
.build();
|
||||
|
||||
// Start the proxy.
|
||||
tokio::spawn(proxy.start(shutdown_signal()));
|
||||
}
|
||||
|
||||
/**
|
||||
* Connects to the local HTTP(S) proxy server.
|
||||
*/
|
||||
#[cfg(windows)]
|
||||
pub fn connect_to_proxy(proxy_port: u16) {
|
||||
// Create 'ProxyServer' string.
|
||||
let server_string: String = format!(
|
||||
"http=127.0.0.1:{};https=127.0.0.1:{}",
|
||||
proxy_port, proxy_port
|
||||
);
|
||||
|
||||
// Fetch the 'Internet Settings' registry key.
|
||||
let settings = Hive::CurrentUser
|
||||
.open(
|
||||
r"Software\Microsoft\Windows\CurrentVersion\Internet Settings",
|
||||
// Only write should be needed but too many cases of Culti not being able to read/write proxy settings
|
||||
Security::AllAccess,
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
// Set registry values.
|
||||
settings
|
||||
.set_value("ProxyServer", &Data::String(server_string.parse().unwrap()))
|
||||
.unwrap();
|
||||
settings.set_value("ProxyEnable", &Data::U32(1)).unwrap();
|
||||
|
||||
println!("Connected to the proxy.");
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub fn connect_to_proxy(proxy_port: u16) {
|
||||
let mut config = Config::get().unwrap();
|
||||
let proxy_addr = format!("127.0.0.1:{}", proxy_port);
|
||||
if !config.game.environment.contains_key("http_proxy") {
|
||||
config
|
||||
.game
|
||||
.environment
|
||||
.insert("http_proxy".to_string(), proxy_addr.clone());
|
||||
}
|
||||
if !config.game.environment.contains_key("https_proxy") {
|
||||
config
|
||||
.game
|
||||
.environment
|
||||
.insert("https_proxy".to_string(), proxy_addr);
|
||||
}
|
||||
Config::update(config);
|
||||
}
|
||||
|
||||
#[cfg(target_od = "macos")]
|
||||
pub fn connect_to_proxy(_proxy_port: u16) {
|
||||
println!("No Mac support yet. Someone mail me a Macbook and I will do it B)")
|
||||
}
|
||||
|
||||
/**
|
||||
* Disconnects from the local HTTP(S) proxy server.
|
||||
*/
|
||||
#[cfg(windows)]
|
||||
pub fn disconnect_from_proxy() {
|
||||
// Fetch the 'Internet Settings' registry key.
|
||||
let settings = Hive::CurrentUser
|
||||
.open(
|
||||
r"Software\Microsoft\Windows\CurrentVersion\Internet Settings",
|
||||
Security::AllAccess,
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
// Set registry values.
|
||||
settings.set_value("ProxyEnable", &Data::U32(0)).unwrap();
|
||||
|
||||
println!("Disconnected from proxy.");
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub fn disconnect_from_proxy() {
|
||||
let mut config = Config::get().unwrap();
|
||||
if config.game.environment.contains_key("http_proxy") {
|
||||
config.game.environment.remove("http_proxy");
|
||||
}
|
||||
if config.game.environment.contains_key("https_proxy") {
|
||||
config.game.environment.remove("https_proxy");
|
||||
}
|
||||
Config::update(config);
|
||||
}
|
||||
|
||||
#[cfg(target_os = "macos")]
|
||||
pub fn disconnect_from_proxy() {}
|
||||
|
||||
/*
|
||||
* Generates a private key and certificate used by the certificate authority.
|
||||
* Additionally installs the certificate and private key in the Root CA store.
|
||||
* Source: https://github.com/zu1k/good-mitm/raw/master/src/ca/gen.rs
|
||||
*/
|
||||
#[tauri::command]
|
||||
pub fn generate_ca_files(path: &Path) {
|
||||
let mut params = CertificateParams::default();
|
||||
let mut details = DistinguishedName::new();
|
||||
|
||||
// Set certificate details.
|
||||
details.push(DnType::CommonName, "Cultivation");
|
||||
details.push(DnType::OrganizationName, "Grasscutters");
|
||||
details.push(DnType::CountryName, "CN");
|
||||
details.push(DnType::LocalityName, "CN");
|
||||
|
||||
// Set details in the parameter.
|
||||
params.distinguished_name = details;
|
||||
// Set other properties.
|
||||
params.is_ca = IsCa::Ca(BasicConstraints::Unconstrained);
|
||||
params.key_usages = vec![
|
||||
KeyUsagePurpose::DigitalSignature,
|
||||
KeyUsagePurpose::KeyCertSign,
|
||||
KeyUsagePurpose::CrlSign,
|
||||
];
|
||||
|
||||
// Create certificate.
|
||||
let cert = Certificate::from_params(params).unwrap();
|
||||
let cert_crt = cert.serialize_pem().unwrap();
|
||||
let private_key = cert.serialize_private_key_pem();
|
||||
|
||||
// Make certificate directory.
|
||||
let cert_dir = path.join("ca");
|
||||
match fs::create_dir(&cert_dir) {
|
||||
Ok(_) => {}
|
||||
Err(e) => {
|
||||
println!("{}", e);
|
||||
}
|
||||
};
|
||||
|
||||
// Write the certificate to a file.
|
||||
let cert_path = cert_dir.join("cert.crt");
|
||||
match fs::write(&cert_path, cert_crt) {
|
||||
Ok(_) => println!("Wrote certificate to {}", cert_path.to_str().unwrap()),
|
||||
Err(e) => println!(
|
||||
"Error writing certificate to {}: {}",
|
||||
cert_path.to_str().unwrap(),
|
||||
e
|
||||
),
|
||||
}
|
||||
|
||||
// Write the private key to a file.
|
||||
let private_key_path = cert_dir.join("private.key");
|
||||
match fs::write(&private_key_path, private_key) {
|
||||
Ok(_) => println!(
|
||||
"Wrote private key to {}",
|
||||
private_key_path.to_str().unwrap()
|
||||
),
|
||||
Err(e) => println!(
|
||||
"Error writing private key to {}: {}",
|
||||
private_key_path.to_str().unwrap(),
|
||||
e
|
||||
),
|
||||
}
|
||||
|
||||
// Install certificate into the system's Root CA store.
|
||||
install_ca_files(&cert_path);
|
||||
}
|
||||
|
||||
/*
|
||||
* Attempts to install the certificate authority's certificate into the Root CA store.
|
||||
*/
|
||||
#[cfg(windows)]
|
||||
pub fn install_ca_files(cert_path: &Path) {
|
||||
crate::system_helpers::run_command(
|
||||
"certutil",
|
||||
vec!["-user", "-addstore", "Root", cert_path.to_str().unwrap()],
|
||||
None,
|
||||
);
|
||||
println!("Installed certificate.");
|
||||
}
|
||||
|
||||
#[cfg(target_os = "macos")]
|
||||
pub fn install_ca_files(cert_path: &Path) {
|
||||
crate::system_helpers::run_command(
|
||||
"security",
|
||||
vec![
|
||||
"add-trusted-cert",
|
||||
"-d",
|
||||
"-r",
|
||||
"trustRoot",
|
||||
"-k",
|
||||
"/Library/Keychains/System.keychain",
|
||||
cert_path.to_str().unwrap(),
|
||||
],
|
||||
None,
|
||||
);
|
||||
println!("Installed certificate.");
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub fn install_ca_files(cert_path: &Path) {
|
||||
let platform = os_type::current_platform();
|
||||
use os_type::OSType::*;
|
||||
// TODO: Add more distros
|
||||
match &platform.os_type {
|
||||
// Debian-based
|
||||
Debian | Ubuntu | Kali => {
|
||||
let usr_certs = PathBuf::from("/usr/local/share/ca-certificates");
|
||||
let usr_cert_path = usr_certs.join("cultivation.crt");
|
||||
|
||||
// We want to execute multiple commands, but we don't want multiple pkexec prompts
|
||||
// so we have to use a script
|
||||
let script = Path::new("/tmp/cultivation-inject-ca-cert.sh");
|
||||
let mut scriptf = File::create(script).unwrap();
|
||||
#[cfg(debug_assertions)]
|
||||
let setflags = "xe";
|
||||
#[cfg(not(debug_assertions))]
|
||||
let setflags = "e";
|
||||
write!(
|
||||
scriptf,
|
||||
r#"#!/usr/bin/env bash
|
||||
set -{}
|
||||
CERT="{}"
|
||||
CERT_DIR="{}"
|
||||
CERT_TARGET="{}"
|
||||
# Create dir if it doesn't exist
|
||||
if ! [[ -d "$CERT_DIR" ]]; then
|
||||
mkdir -v "$CERT_DIR"
|
||||
fi
|
||||
cp -v "$CERT" "$CERT_TARGET"
|
||||
update-ca-certificates
|
||||
"#,
|
||||
setflags,
|
||||
cert_path.to_str().unwrap(),
|
||||
usr_certs.to_str().unwrap(),
|
||||
usr_cert_path.to_str().unwrap()
|
||||
)
|
||||
.unwrap();
|
||||
scriptf.flush().unwrap();
|
||||
drop(scriptf);
|
||||
let _ = Command::new("bash")
|
||||
.arg(script)
|
||||
.as_root_gui()
|
||||
.spawn_its_fine_really("Unable to install certificate");
|
||||
if let Err(e) = fs::remove_file(script) {
|
||||
println!("Unable to remove certificate install script: {}", e);
|
||||
};
|
||||
}
|
||||
// RedHat-based
|
||||
//Redhat | CentOS |
|
||||
// Arch-based
|
||||
Arch | Manjaro => {
|
||||
let _ = Command::new("trust")
|
||||
.arg("anchor")
|
||||
.arg("--store")
|
||||
.arg(cert_path)
|
||||
.as_root_gui()
|
||||
.spawn_its_fine_really("Unable to install certificate");
|
||||
}
|
||||
OSX => unreachable!(),
|
||||
_ => {
|
||||
println!("Unsupported Linux distribution.");
|
||||
return;
|
||||
}
|
||||
}
|
||||
println!("Installed certificate.");
|
||||
}
|
||||
|
||||
#[cfg(not(any(windows, target_os = "macos", target_os = "linux")))]
|
||||
pub fn install_ca_files(_cert_path: &Path) {
|
||||
println!("Certificate installation is not supported on this platform.");
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
#[derive(serde::Serialize, serde::Deserialize)]
|
||||
pub struct Release {
|
||||
pub tag_name: String,
|
||||
pub link: String,
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub async fn get_latest_release() -> Release {
|
||||
let url = "https://api.github.com/repos/Grasscutters/Cultivation/releases/latest";
|
||||
let client = reqwest::Client::new();
|
||||
let response = client
|
||||
.get(url)
|
||||
.header("User-Agent", "Cultivation")
|
||||
.send()
|
||||
.await
|
||||
.unwrap();
|
||||
let text = response.text().await.unwrap();
|
||||
|
||||
// This includes ip when github rate limits you, so avoid it for now to avoid leaks through screenshots
|
||||
//println!("Response: {}", text);
|
||||
|
||||
// Parse "tag_name" from JSON
|
||||
let json: serde_json::Value = serde_json::from_str(&text).unwrap();
|
||||
let tag_name = json["tag_name"].as_str().unwrap();
|
||||
|
||||
// Parse "html_url"
|
||||
let link = json["html_url"].as_str().unwrap();
|
||||
|
||||
Release {
|
||||
tag_name: tag_name.to_string(),
|
||||
link: link.to_string(),
|
||||
}
|
||||
}
|
||||
@@ -1,709 +0,0 @@
|
||||
use ini::Ini;
|
||||
use std::path::PathBuf;
|
||||
use std::process::Command;
|
||||
|
||||
#[cfg(windows)]
|
||||
use std::ffi::OsStr;
|
||||
#[cfg(windows)]
|
||||
use {
|
||||
registry::{Data, Hive, Security},
|
||||
windows_service::service::{ServiceAccess, ServiceState::Stopped},
|
||||
windows_service::service_manager::{ServiceManager, ServiceManagerAccess},
|
||||
};
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
use crate::AAGL_THREAD;
|
||||
#[cfg(target_os = "linux")]
|
||||
use anime_launcher_sdk::{
|
||||
config::ConfigExt, genshin::config::Config, genshin::game, genshin::states::LauncherState,
|
||||
wincompatlib::prelude::*,
|
||||
};
|
||||
#[cfg(target_os = "linux")]
|
||||
use std::{path::Path, process::Stdio, thread};
|
||||
#[cfg(target_os = "linux")]
|
||||
use term_detect::get_terminal;
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
fn guess_user_terminal() -> String {
|
||||
if let Ok(term) = get_terminal() {
|
||||
return term.0;
|
||||
}
|
||||
eprintln!("Could not guess default terminal. Try setting the $TERMINAL environment variable.");
|
||||
// If everything fails, default to xterm
|
||||
"xterm".to_string()
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
fn rawstrcmd(cmd: &Command) -> String {
|
||||
format!("{:?}", cmd)
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
fn strcmd(cmd: &Command) -> String {
|
||||
format!("bash -c {:?}", rawstrcmd(cmd))
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub trait AsRoot {
|
||||
fn as_root(&self) -> Self;
|
||||
fn as_root_gui(&self) -> Self;
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
impl AsRoot for Command {
|
||||
fn as_root(&self) -> Self {
|
||||
let mut cmd = Command::new("sudo");
|
||||
cmd.arg("--").arg("bash").arg("-c").arg(rawstrcmd(self));
|
||||
cmd
|
||||
}
|
||||
fn as_root_gui(&self) -> Self {
|
||||
let mut cmd = Command::new("pkexec");
|
||||
cmd.arg("bash").arg("-c").arg(rawstrcmd(self));
|
||||
cmd
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
trait InTerminalEmulator {
|
||||
fn in_terminal(&self) -> Self;
|
||||
fn in_terminal_noclose(&self) -> Self;
|
||||
}
|
||||
#[cfg(target_os = "linux")]
|
||||
impl InTerminalEmulator for Command {
|
||||
fn in_terminal(&self) -> Self {
|
||||
let mut cmd = Command::new(guess_user_terminal());
|
||||
cmd.arg("-e").arg(strcmd(self));
|
||||
cmd
|
||||
}
|
||||
fn in_terminal_noclose(&self) -> Self {
|
||||
let mut cmd = Command::new(guess_user_terminal());
|
||||
cmd.arg("--noclose");
|
||||
cmd.arg("-e").arg(strcmd(self));
|
||||
cmd
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
pub trait SpawnItsFineReally {
|
||||
fn spawn_its_fine_really(&mut self, msg: &str) -> anyhow::Result<()>;
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
impl SpawnItsFineReally for Command {
|
||||
fn spawn_its_fine_really(&mut self, msg: &str) -> anyhow::Result<()> {
|
||||
let res = self.status();
|
||||
let Ok(status) = res else {
|
||||
let error = res.unwrap_err();
|
||||
println!("{}: {}", msg, &error);
|
||||
return Err(error.into());
|
||||
};
|
||||
if !status.success() {
|
||||
println!("{}: {}", msg, status);
|
||||
Err(anyhow::anyhow!("{}: {}", msg, status))
|
||||
} else {
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn run_program(path: String, args: Option<String>) {
|
||||
// Without unwrap_or, this can crash when UAC prompt is denied
|
||||
match open::with(
|
||||
format!("{} {}", path, args.unwrap_or_else(|| "".into())),
|
||||
path.clone(),
|
||||
) {
|
||||
Ok(_) => (),
|
||||
Err(e) => println!("Failed to open program ({}): {}", &path, e),
|
||||
};
|
||||
}
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
#[tauri::command]
|
||||
pub fn run_program_relative(path: String, args: Option<String>) {
|
||||
// Save the current working directory
|
||||
let cwd = std::env::current_dir().unwrap();
|
||||
|
||||
// Set the new working directory to the path before the executable
|
||||
let mut path_buf = std::path::PathBuf::from(&path);
|
||||
path_buf.pop();
|
||||
|
||||
// Set new working directory
|
||||
std::env::set_current_dir(&path_buf).unwrap();
|
||||
|
||||
// Without unwrap_or, this can crash when UAC prompt is denied
|
||||
open::that(format!("{} {}", &path, args.unwrap_or_else(|| "".into()))).unwrap_or(());
|
||||
|
||||
// Restore the original working directory
|
||||
std::env::set_current_dir(cwd).unwrap();
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub fn run_program_relative(path: String, args: Option<String>) {
|
||||
// This program should not run as root
|
||||
run_un_elevated(path, args)
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn run_command(program: &str, args: Vec<&str>, relative: Option<bool>) {
|
||||
let prog = program.to_string();
|
||||
let args = args.iter().map(|s| s.to_string()).collect::<Vec<String>>();
|
||||
|
||||
// Commands should not block (this is for the reshade injector mostly)
|
||||
std::thread::spawn(move || {
|
||||
// Save the current working directory
|
||||
let cwd = std::env::current_dir().unwrap();
|
||||
|
||||
if relative.unwrap_or(false) {
|
||||
// Set the new working directory to the path before the executable
|
||||
let mut path_buf = std::path::PathBuf::from(&prog);
|
||||
path_buf.pop();
|
||||
|
||||
// Set new working directory
|
||||
std::env::set_current_dir(&path_buf).unwrap();
|
||||
}
|
||||
|
||||
// Run the command
|
||||
let mut command = Command::new(&prog);
|
||||
command.args(&args);
|
||||
command.spawn().unwrap();
|
||||
|
||||
// Restore the original working directory
|
||||
std::env::set_current_dir(cwd).unwrap();
|
||||
});
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn run_jar(path: String, execute_in: String, java_path: String) {
|
||||
let command = if java_path.is_empty() {
|
||||
format!("java -jar \"{}\"", path)
|
||||
} else {
|
||||
format!("\"{}\" -jar \"{}\"", java_path, path)
|
||||
};
|
||||
|
||||
println!("Launching .jar with command: {}", &command);
|
||||
|
||||
// Open the program from the specified path.
|
||||
#[cfg(not(target_os = "linux"))]
|
||||
match open::with(
|
||||
format!("/k cd /D \"{}\" & {}", &execute_in, &command),
|
||||
"C:\\Windows\\System32\\cmd.exe",
|
||||
) {
|
||||
Ok(_) => (),
|
||||
Err(e) => println!("Failed to open jar ({} from {}): {}", &path, &execute_in, e),
|
||||
};
|
||||
#[cfg(target_os = "linux")]
|
||||
thread::spawn(move || {
|
||||
match Command::new(guess_user_terminal())
|
||||
.arg("-e")
|
||||
.arg(command)
|
||||
.current_dir(execute_in.clone())
|
||||
.spawn()
|
||||
{
|
||||
Ok(mut handler) => {
|
||||
// Prevent creation of zombie processes
|
||||
handler
|
||||
.wait()
|
||||
.expect("Grasscutter exited with non-zero exit code");
|
||||
}
|
||||
Err(e) => println!("Failed to open jar ({} from {}): {}", &path, &execute_in, e),
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
#[cfg(not(target_os = "linux"))]
|
||||
#[tauri::command]
|
||||
pub fn run_jar_root(_path: String, _execute_in: String, _java_path: String) {
|
||||
panic!("Not implemented");
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub fn run_jar_root(path: String, execute_in: String, java_path: String) {
|
||||
let mut command = if java_path.is_empty() {
|
||||
Command::new("java")
|
||||
} else {
|
||||
Command::new(java_path)
|
||||
};
|
||||
command.arg("-jar").arg(&path).current_dir(&execute_in);
|
||||
|
||||
println!("Launching .jar with command: {}", strcmd(&command));
|
||||
|
||||
// Open the program from the specified path.
|
||||
thread::spawn(move || {
|
||||
match command.as_root_gui().in_terminal().spawn() {
|
||||
Ok(mut handler) => {
|
||||
// Prevent creation of zombie processes
|
||||
handler
|
||||
.wait()
|
||||
.expect("Grasscutter exited with non-zero exit code");
|
||||
}
|
||||
Err(e) => println!("Failed to open jar ({} from {}): {}", &path, &execute_in, e),
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
#[cfg(target_os = "windows")]
|
||||
#[tauri::command]
|
||||
pub fn run_un_elevated(path: String, args: Option<String>) {
|
||||
// Open the program non-elevated.
|
||||
match open::with(
|
||||
format!(
|
||||
"cmd /min /C \"set __COMPAT_LAYER=RUNASINVOKER && start \"\" \"{}\"\" {}",
|
||||
path,
|
||||
args.unwrap_or_else(|| "".into())
|
||||
),
|
||||
"C:\\Windows\\System32\\cmd.exe",
|
||||
) {
|
||||
Ok(_) => (),
|
||||
Err(e) => println!("Failed to open program ({}): {}", &path, e),
|
||||
};
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
fn aagl_wine_run<P: AsRef<Path>>(path: P, args: Option<String>) -> Command {
|
||||
let config = Config::get().unwrap();
|
||||
let wine = config.get_selected_wine().unwrap().unwrap();
|
||||
let wine_run = wine
|
||||
.to_wine(
|
||||
config.components.path,
|
||||
Some(config.game.wine.builds.join(&wine.name)),
|
||||
)
|
||||
.with_prefix(config.game.wine.prefix)
|
||||
.with_loader(WineLoader::Current)
|
||||
.with_arch(WineArch::Win64);
|
||||
let env: Vec<(String, String)> = config
|
||||
.game
|
||||
.wine
|
||||
.sync
|
||||
.get_env_vars()
|
||||
.clone()
|
||||
.into_iter()
|
||||
.map(|(k, v)| (k.to_string(), v.to_string()))
|
||||
.collect();
|
||||
use anime_launcher_sdk::components::wine::UnifiedWine::*;
|
||||
let wined = match wine_run {
|
||||
Default(wine) => wine,
|
||||
Proton(proton) => proton.wine().clone(),
|
||||
};
|
||||
let mut cmd = Command::new(&wined.binary);
|
||||
cmd.arg(path.as_ref()).envs(wined.get_envs()).envs(env);
|
||||
if let Some(args) = args {
|
||||
let mut args: Vec<String> = args.split(' ').map(|x| x.to_string()).collect();
|
||||
cmd.args(&mut args);
|
||||
};
|
||||
cmd
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub fn run_un_elevated(path: String, args: Option<String>) {
|
||||
let path = Path::new(&path);
|
||||
let exec_name = path.file_name().unwrap().to_str().unwrap();
|
||||
if exec_name == ["Yuan", "Shen", ".exe"].join("").as_str()
|
||||
|| exec_name == ["Gen", "shin", "Impact", ".exe"].join("").as_str()
|
||||
{
|
||||
let game_thread = thread::spawn(|| {
|
||||
'statechk: {
|
||||
let state = LauncherState::get_from_config(|_| {});
|
||||
let Ok(state) = state else {
|
||||
println!("Failed to get state: {}", state.unwrap_err());
|
||||
break 'statechk;
|
||||
};
|
||||
use anime_launcher_sdk::genshin::states::LauncherState::*;
|
||||
match state {
|
||||
FolderMigrationRequired { from, .. } => Err(format!(
|
||||
"A folder migration is required ({:?} needs to be moved)",
|
||||
from
|
||||
)),
|
||||
WineNotInstalled => Err("Wine is not installed".to_string()),
|
||||
PrefixNotExists => Err("The Wine prefix does not exist".to_string()),
|
||||
GameNotInstalled(_) => Err("The game is not installed".to_string()),
|
||||
_ => Ok(()),
|
||||
}
|
||||
.expect("Can't launch game. Check the other launcher.");
|
||||
}
|
||||
if let Err(e) = game::run() {
|
||||
println!("An error occurred while running the game: {}", e);
|
||||
}
|
||||
});
|
||||
{
|
||||
let mut game_thead_lock = AAGL_THREAD.lock().unwrap();
|
||||
game_thead_lock.replace(game_thread);
|
||||
}
|
||||
return;
|
||||
}
|
||||
// Run exe with wine
|
||||
if path.extension().unwrap() == "exe" {
|
||||
let path = path.to_owned().clone();
|
||||
thread::spawn(move || {
|
||||
let _ = aagl_wine_run(&path, args)
|
||||
.current_dir(path.parent().unwrap())
|
||||
.in_terminal()
|
||||
.spawn_its_fine_really(&format!(
|
||||
"Failed to open program ({})",
|
||||
path.to_str().unwrap()
|
||||
));
|
||||
});
|
||||
}
|
||||
println!(
|
||||
"Can't run {:?}. Running this type of file is not supported yet.",
|
||||
path
|
||||
);
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn open_in_browser(url: String) {
|
||||
// Open the URL in the default browser.
|
||||
match open::that(url) {
|
||||
Ok(_) => (),
|
||||
Err(e) => println!("Failed to open URL: {}", e),
|
||||
};
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn install_location() -> String {
|
||||
let mut exe_path = std::env::current_exe().unwrap();
|
||||
|
||||
#[cfg(windows)]
|
||||
{
|
||||
// Get the path to the executable.
|
||||
exe_path.pop();
|
||||
|
||||
return exe_path.to_str().unwrap().to_string();
|
||||
}
|
||||
#[cfg(target_os = "linux")]
|
||||
{
|
||||
let bin_name = exe_path.file_name().unwrap().to_str().unwrap().to_string();
|
||||
exe_path.pop();
|
||||
if exe_path.starts_with("/usr/bin") {
|
||||
let mut path = PathBuf::from("/usr/lib");
|
||||
path.push(bin_name);
|
||||
path
|
||||
} else {
|
||||
exe_path
|
||||
}
|
||||
.to_str()
|
||||
.unwrap()
|
||||
.to_string()
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn set_migoto_target(window: tauri::Window, migoto_path: String) -> bool {
|
||||
let mut migoto_pathbuf = PathBuf::from(migoto_path);
|
||||
|
||||
migoto_pathbuf.pop();
|
||||
migoto_pathbuf.push("d3dx.ini");
|
||||
|
||||
let mut conf = match Ini::load_from_file(&migoto_pathbuf) {
|
||||
Ok(c) => {
|
||||
println!("Loaded migoto ini");
|
||||
c
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Error loading migoto config: {}", e);
|
||||
return false;
|
||||
}
|
||||
};
|
||||
|
||||
window.emit("migoto_set", &()).unwrap();
|
||||
|
||||
// Set options
|
||||
conf
|
||||
.with_section(Some("Loader"))
|
||||
.set("target", "GenshinImpact.exe");
|
||||
|
||||
// Write file
|
||||
match conf.write_to_file(&migoto_pathbuf) {
|
||||
Ok(_) => {
|
||||
println!("Wrote config!");
|
||||
true
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Error writing config: {}", e);
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn set_migoto_delay(migoto_path: String) -> bool {
|
||||
let mut migoto_pathbuf = PathBuf::from(migoto_path);
|
||||
|
||||
migoto_pathbuf.pop();
|
||||
migoto_pathbuf.push("d3dx.ini");
|
||||
|
||||
let mut conf = match Ini::load_from_file(&migoto_pathbuf) {
|
||||
Ok(c) => {
|
||||
println!("Loaded migoto ini");
|
||||
c
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Error loading migoto config: {}", e);
|
||||
return false;
|
||||
}
|
||||
};
|
||||
|
||||
// Set options
|
||||
conf.with_section(Some("Loader")).set("delay", "20");
|
||||
|
||||
// Write file
|
||||
match conf.write_to_file(&migoto_pathbuf) {
|
||||
Ok(_) => {
|
||||
println!("Wrote delay!");
|
||||
true
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Error writing delay: {}", e);
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
pub fn wipe_registry(exec_name: String) {
|
||||
// Fetch the 'Internet Settings' registry key.
|
||||
let settings =
|
||||
match Hive::CurrentUser.open(format!("Software\\miHoYo\\{}", exec_name), Security::Write) {
|
||||
Ok(s) => s,
|
||||
Err(e) => {
|
||||
println!("Error getting registry setting: {}", e);
|
||||
return;
|
||||
}
|
||||
};
|
||||
|
||||
// Wipe login cache
|
||||
match settings.set_value(
|
||||
"MIHOYOSDK_ADL_PROD_OVERSEA_h1158948810",
|
||||
&Data::String("".parse().unwrap()),
|
||||
) {
|
||||
Ok(_) => (),
|
||||
Err(e) => println!("Error wiping registry: {}", e),
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
pub fn service_status(service: String) -> bool {
|
||||
let manager = match ServiceManager::local_computer(None::<&str>, ServiceManagerAccess::CONNECT) {
|
||||
Ok(manager) => manager,
|
||||
Err(_e) => return false,
|
||||
};
|
||||
let my_service = match manager.open_service(service.clone(), ServiceAccess::QUERY_STATUS) {
|
||||
Ok(my_service) => my_service,
|
||||
Err(_e) => {
|
||||
println!("{} service not found! Not installed?", service);
|
||||
return false;
|
||||
}
|
||||
};
|
||||
let status_result = my_service.query_status();
|
||||
if let Ok(..) = status_result {
|
||||
let status = status_result.unwrap();
|
||||
println!("{} service status: {:?}", service, status.current_state);
|
||||
if status.current_state == Stopped {
|
||||
// Start the service if it is stopped
|
||||
start_service(service);
|
||||
}
|
||||
true
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
fn to_linux_service_name(service: &str) -> Option<String> {
|
||||
Some(format!(
|
||||
"{}.service",
|
||||
match service {
|
||||
"MongoDB" => "mongod",
|
||||
_ => return None,
|
||||
}
|
||||
))
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub fn service_status(service: String) -> bool {
|
||||
// Change Windows service name into Linux service name
|
||||
let service_lnx = to_linux_service_name(&service);
|
||||
if service_lnx.is_none() {
|
||||
return false;
|
||||
}
|
||||
let service_lnx = service_lnx.unwrap();
|
||||
let status = Command::new("systemctl")
|
||||
.arg("is-active")
|
||||
.arg(service_lnx)
|
||||
.stdout(Stdio::null())
|
||||
.status();
|
||||
if status.is_err() {
|
||||
return false;
|
||||
}
|
||||
let status = status.unwrap().success();
|
||||
if status {
|
||||
status
|
||||
} else {
|
||||
start_service(service)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
pub fn start_service(service: String) -> bool {
|
||||
println!("Starting service: {}", service);
|
||||
let manager = match ServiceManager::local_computer(None::<&str>, ServiceManagerAccess::CONNECT) {
|
||||
Ok(manager) => manager,
|
||||
Err(_e) => return false,
|
||||
};
|
||||
let my_service = match manager.open_service(service, ServiceAccess::START) {
|
||||
Ok(my_service) => my_service,
|
||||
Err(_e) => return false,
|
||||
};
|
||||
match my_service.start(&[OsStr::new("Started service!")]) {
|
||||
Ok(_s) => true,
|
||||
Err(_e) => return false,
|
||||
};
|
||||
true
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub fn start_service(service: String) -> bool {
|
||||
println!("Starting service: {}", service);
|
||||
let service_lnx = to_linux_service_name(&service);
|
||||
if service_lnx.is_none() {
|
||||
return false;
|
||||
}
|
||||
let service_lnx = service_lnx.unwrap();
|
||||
Command::new("systemctl")
|
||||
.arg("start")
|
||||
.arg(service_lnx)
|
||||
.spawn_its_fine_really(&format!("Failed to stop service {}", service))
|
||||
.is_ok()
|
||||
}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
pub fn stop_service(service: String) -> bool {
|
||||
println!("Stopping service: {}", service);
|
||||
let manager = match ServiceManager::local_computer(None::<&str>, ServiceManagerAccess::CONNECT) {
|
||||
Ok(manager) => manager,
|
||||
Err(_e) => return false,
|
||||
};
|
||||
let my_service = match manager.open_service(service, ServiceAccess::STOP) {
|
||||
Ok(my_service) => my_service,
|
||||
Err(_e) => return false,
|
||||
};
|
||||
match my_service.stop() {
|
||||
Ok(_s) => true,
|
||||
Err(_e) => return false,
|
||||
};
|
||||
true
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub fn stop_service(service: String) -> bool {
|
||||
println!("Stopping service: {}", service);
|
||||
let service_lnx = to_linux_service_name(&service);
|
||||
if service_lnx.is_none() {
|
||||
return false;
|
||||
}
|
||||
let service_lnx = service_lnx.unwrap();
|
||||
Command::new("systemctl")
|
||||
.arg("stop")
|
||||
.arg(service_lnx)
|
||||
.spawn_its_fine_really(&format!("Failed to start service {}", service))
|
||||
.is_ok()
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub fn wipe_registry(exec_name: String) {
|
||||
println!("Wiping registry");
|
||||
let regpath = format!("HKCU\\Software\\miHoYo\\{}", exec_name);
|
||||
let mut cmd = aagl_wine_run("reg", None);
|
||||
cmd.args([
|
||||
"DELETE",
|
||||
®path,
|
||||
"/f",
|
||||
"/v",
|
||||
"MIHOYOSDK_ADL_PROD_OVERSEA_h1158948810",
|
||||
]);
|
||||
let _ = cmd.spawn_its_fine_really("Error wiping registry");
|
||||
}
|
||||
|
||||
#[cfg(target_os = "macos")]
|
||||
#[tauri::command]
|
||||
pub fn wipe_registry(_exec_name: String) {}
|
||||
|
||||
#[cfg(windows)]
|
||||
#[tauri::command]
|
||||
pub fn is_elevated() -> bool {
|
||||
is_elevated::is_elevated()
|
||||
}
|
||||
|
||||
#[cfg(unix)]
|
||||
#[tauri::command]
|
||||
pub fn is_elevated() -> bool {
|
||||
sudo::check() == sudo::RunningAs::Root
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub fn get_platform() -> &'static str {
|
||||
std::env::consts::OS
|
||||
}
|
||||
|
||||
#[cfg(not(target_os = "linux"))]
|
||||
#[tauri::command]
|
||||
pub async fn jvm_add_cap(_java_path: String) -> bool {
|
||||
panic!("Not implemented");
|
||||
}
|
||||
|
||||
#[cfg(not(target_os = "linux"))]
|
||||
#[tauri::command]
|
||||
pub async fn jvm_remove_cap(_java_path: String) -> bool {
|
||||
panic!("Not implemented");
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub async fn jvm_add_cap(java_path: String) -> bool {
|
||||
let mut java_bin = if java_path.is_empty() {
|
||||
which::which("java").expect("Java is not installed")
|
||||
} else {
|
||||
PathBuf::from(&java_path)
|
||||
};
|
||||
while java_bin.is_symlink() {
|
||||
java_bin = java_bin.read_link().unwrap()
|
||||
}
|
||||
println!("Removing cap on {:?}", &java_bin);
|
||||
Command::new("setcap")
|
||||
.arg("CAP_NET_BIND_SERVICE=+eip")
|
||||
.arg(java_bin)
|
||||
.as_root_gui()
|
||||
.spawn_its_fine_really(&format!("Failed to add cap to {}", java_path))
|
||||
.is_ok()
|
||||
}
|
||||
|
||||
#[cfg(target_os = "linux")]
|
||||
#[tauri::command]
|
||||
pub async fn jvm_remove_cap(java_path: String) -> bool {
|
||||
let mut java_bin = if java_path.is_empty() {
|
||||
which::which("java").expect("Java is not installed")
|
||||
} else {
|
||||
PathBuf::from(&java_path)
|
||||
};
|
||||
while java_bin.is_symlink() {
|
||||
java_bin = java_bin.read_link().unwrap()
|
||||
}
|
||||
println!("Setting cap on {:?}", &java_bin);
|
||||
Command::new("setcap")
|
||||
.arg("-r")
|
||||
.arg(java_bin)
|
||||
.as_root_gui()
|
||||
.spawn_its_fine_really(&format!("Failed to remove cap from {}", java_path))
|
||||
.is_ok()
|
||||
}
|
||||
@@ -1,207 +0,0 @@
|
||||
use std::fs::{read_dir, File};
|
||||
use std::path;
|
||||
use std::thread;
|
||||
use unrar::archive::Archive;
|
||||
|
||||
#[tauri::command]
|
||||
pub fn unzip(
|
||||
window: tauri::Window,
|
||||
zipfile: String,
|
||||
destpath: String,
|
||||
top_level: Option<bool>,
|
||||
folder_if_loose: Option<bool>,
|
||||
) {
|
||||
// Read file TODO: replace test file
|
||||
let f = match File::open(&zipfile) {
|
||||
Ok(f) => f,
|
||||
Err(e) => {
|
||||
println!("Failed to open zip file: {}", e);
|
||||
return;
|
||||
}
|
||||
};
|
||||
|
||||
let write_path = path::PathBuf::from(&destpath);
|
||||
|
||||
// Get a list of all current directories
|
||||
let mut dirs = vec![];
|
||||
for entry in read_dir(&write_path).unwrap() {
|
||||
let entry = entry.unwrap();
|
||||
let entry_path = entry.path();
|
||||
if entry_path.is_dir() {
|
||||
dirs.push(entry_path);
|
||||
}
|
||||
}
|
||||
|
||||
// Run extraction in seperate thread
|
||||
thread::spawn(move || {
|
||||
let mut full_path = write_path.clone();
|
||||
|
||||
window.emit("extract_start", &zipfile).unwrap();
|
||||
|
||||
if folder_if_loose.unwrap_or(false) {
|
||||
// Create a new folder with the same name as the zip file
|
||||
let mut file_name = path::Path::new(&zipfile)
|
||||
.file_name()
|
||||
.unwrap()
|
||||
.to_str()
|
||||
.unwrap();
|
||||
|
||||
// remove ".zip" from the end of the file name
|
||||
file_name = &file_name[..file_name.len() - 4];
|
||||
|
||||
let new_path = full_path.join(file_name);
|
||||
match std::fs::create_dir_all(&new_path) {
|
||||
Ok(_) => {}
|
||||
Err(e) => {
|
||||
println!("Failed to create directory: {}", e);
|
||||
return;
|
||||
}
|
||||
};
|
||||
|
||||
full_path = new_path;
|
||||
}
|
||||
|
||||
println!("Is rar file? {}", zipfile.ends_with(".rar"));
|
||||
|
||||
let name;
|
||||
let success;
|
||||
|
||||
// If file ends in zip, OR is unknown, extract as zip, otherwise extract as rar
|
||||
if zipfile.ends_with(".rar") {
|
||||
success = extract_rar(&zipfile, &f, &full_path, top_level.unwrap_or(true));
|
||||
|
||||
let archive = Archive::new(zipfile.clone());
|
||||
name = archive.list().unwrap().next().unwrap().unwrap().filename;
|
||||
} else if zipfile.ends_with(".7z") {
|
||||
success = extract_7z(&zipfile, &f, &full_path, top_level.unwrap_or(true));
|
||||
|
||||
name = String::from("banana");
|
||||
} else {
|
||||
success = extract_zip(&zipfile, &f, &full_path, top_level.unwrap_or(true));
|
||||
|
||||
// Get the name of the inenr file in the zip file
|
||||
let mut zip = zip::ZipArchive::new(&f).unwrap();
|
||||
let file = zip.by_index(0).unwrap();
|
||||
name = file.name().to_string();
|
||||
}
|
||||
|
||||
if !success {
|
||||
let mut res_hash = std::collections::HashMap::new();
|
||||
|
||||
res_hash.insert("path".to_string(), zipfile.to_string());
|
||||
|
||||
window.emit("download_error", &res_hash).unwrap();
|
||||
}
|
||||
|
||||
// If the contents is a jar file, emit that we have extracted a new jar file
|
||||
if name.ends_with(".jar") {
|
||||
window
|
||||
.emit("jar_extracted", destpath.to_string() + name.as_str())
|
||||
.unwrap();
|
||||
}
|
||||
|
||||
// If downloading full build, emit that the jar was extracted with it
|
||||
if zipfile.contains("GrasscutterCulti") {
|
||||
window
|
||||
.emit("jar_extracted", destpath.to_string() + "grasscutter.jar")
|
||||
.unwrap();
|
||||
}
|
||||
|
||||
if zipfile.contains("GrasscutterQuests") {
|
||||
window
|
||||
.emit("jar_extracted", destpath.to_string() + "grasscutter.jar")
|
||||
.unwrap();
|
||||
}
|
||||
|
||||
if zipfile.contains("GIMI") {
|
||||
window
|
||||
.emit(
|
||||
"migoto_extracted",
|
||||
destpath.to_string() + "3DMigoto Loader.exe",
|
||||
)
|
||||
.unwrap();
|
||||
}
|
||||
|
||||
// Delete zip file
|
||||
match std::fs::remove_file(&zipfile) {
|
||||
Ok(_) => {
|
||||
// Get any new directory that could have been created
|
||||
let mut new_dir: String = String::new();
|
||||
for entry in read_dir(&write_path).unwrap() {
|
||||
let entry = entry.unwrap();
|
||||
let entry_path = entry.path();
|
||||
if entry_path.is_dir() && !dirs.contains(&entry_path) {
|
||||
new_dir = entry_path.to_str().unwrap().to_string();
|
||||
}
|
||||
}
|
||||
|
||||
let mut res_hash = std::collections::HashMap::new();
|
||||
res_hash.insert("file", zipfile.to_string());
|
||||
res_hash.insert("new_folder", new_dir);
|
||||
|
||||
window.emit("extract_end", &res_hash).unwrap();
|
||||
println!("Deleted zip file: {}", zipfile);
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Failed to delete zip file: {}", e);
|
||||
}
|
||||
};
|
||||
});
|
||||
}
|
||||
|
||||
fn extract_rar(rarfile: &str, _f: &File, full_path: &path::Path, _top_level: bool) -> bool {
|
||||
let archive = Archive::new(rarfile.to_string());
|
||||
|
||||
let mut open_archive = archive
|
||||
.extract_to(full_path.to_str().unwrap().to_string())
|
||||
.unwrap();
|
||||
|
||||
match open_archive.process() {
|
||||
Ok(_) => {
|
||||
println!(
|
||||
"Extracted rar file to: {}",
|
||||
full_path.to_str().unwrap_or("Error")
|
||||
);
|
||||
|
||||
true
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Failed to extract rar file: {}", e);
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn extract_zip(_zipfile: &str, f: &File, full_path: &path::Path, top_level: bool) -> bool {
|
||||
match zip_extract::extract(f, full_path, top_level) {
|
||||
Ok(_) => {
|
||||
println!(
|
||||
"Extracted zip file to: {}",
|
||||
full_path.to_str().unwrap_or("Error")
|
||||
);
|
||||
|
||||
true
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Failed to extract zip file: {}", e);
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn extract_7z(sevenzfile: &str, _f: &File, full_path: &path::Path, _top_level: bool) -> bool {
|
||||
match sevenz_rust::decompress_file(sevenzfile, full_path) {
|
||||
Ok(_) => {
|
||||
println!(
|
||||
"Extracted 7zip file to: {}",
|
||||
full_path.to_str().unwrap_or("Error")
|
||||
);
|
||||
|
||||
true
|
||||
}
|
||||
Err(e) => {
|
||||
println!("Failed to extract 7zip file: {}", e);
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,50 +0,0 @@
|
||||
use http::header;
|
||||
use once_cell::sync::Lazy;
|
||||
use reqwest::header::{CONTENT_TYPE, USER_AGENT};
|
||||
static CLIENT: Lazy<reqwest::Client> = Lazy::new(|| {
|
||||
let mut headers = header::HeaderMap::new();
|
||||
headers.insert(USER_AGENT, header::HeaderValue::from_static("cultivation"));
|
||||
headers.insert(
|
||||
CONTENT_TYPE,
|
||||
header::HeaderValue::from_static("application/json"),
|
||||
);
|
||||
|
||||
let client = reqwest::Client::builder().default_headers(headers);
|
||||
client.build().unwrap()
|
||||
});
|
||||
|
||||
pub(crate) async fn query(site: &str) -> String {
|
||||
CLIENT
|
||||
.get(site)
|
||||
.send()
|
||||
.await
|
||||
.expect("Failed to get web response")
|
||||
.text()
|
||||
.await
|
||||
.unwrap()
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub(crate) async fn valid_url(url: String) -> bool {
|
||||
// Check if we get a 200 response
|
||||
let client = reqwest::Client::new();
|
||||
|
||||
let response = client
|
||||
.get(url)
|
||||
.header(USER_AGENT, "cultivation")
|
||||
.send()
|
||||
.await
|
||||
.ok();
|
||||
|
||||
if response.is_some() {
|
||||
return response.unwrap().status().as_str() == "200";
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
#[tauri::command]
|
||||
pub async fn web_get(url: String) -> String {
|
||||
// Send a GET request to the specified URL and send the response body back to the client.
|
||||
query(&url).await
|
||||
}
|
||||
Reference in New Issue
Block a user